Notre liste des produits contient les produits de base de nos partenaires.
Les possibilités de nos partneraires ne sont pas limités à l’éventail représenté ici.
N’hésitez pas à nous demander, si vous ne trouvez pas votre produit dans notre portfolio.
Name | CAS | |
---|---|---|
Lithium Carbonate, ACS Grade | 554-13-2 | |
Lithium Carbonate, Industrial Grade | 554-13-2 | |
Lithium Carbonate, Micronized Technical Grade | 554-13-2 | |
Lithium Carbonate, Pharmaceutical Grade | 554-13-2 | |
Lithium Carbonate, Technical Grade | 554-13-2 | |
Lithium Chloride ACS Grade | 7447-41-8 | |
Lithium Chloride Anhydrous Purified | 7447-41-8 | |
Lithium Chloride Anhydrous Technical Grade | 7447-41-8 | |
Lithium Chloride Industrial Grade | 7447-41-8 | |
Lithium Chloride Solution | 7447-41-8 | |
Lithium Fluoride Technical Grade | 7789-24-4 | |
Lithium Hydroxide Monohydrate | 1310-66-3 | |
Lithium Hydroxide Monohydrate Purified | 1310-66-3 | |
Lithium Metal, Catalyst Grade | 7439-93-2 | |
Lithium Metal, Technical Grade | 7439-93-2 | |
Lithium Metal, Alloy Grade | 7439-93-2 | |
Lithium Metal, Alloy Grade High Purity | 7439-93-2 | |
Stabilized Lithium Metal Powder – SLMP® | 7439-93-2 | |
Lithium Phosphate | 10377-52-3 | |
n-Butyllithium in Cyclohexane (15% soln) | 109-72-8 | |
n-Butyllithium in Cyclohexane (20% soln) | 109-72-8 | |
n-Butyllithium in Cyclohexane (24% soln) | 109-72-8 | |
n-Butyllithium in Cyclohexane (Concentrate) | 109-72-8 | |
n-Butyllithium in Heptane (15% Soln) | 109-72-8 | |
n-Butyllithium in Heptane (24% Soln) | 109-72-8 | |
n-Butyllithium in Hexanes (15% soln) | 109-72-8 | |
n-Butyllithium in Hexanes (24% soln) | 109-72-8 | |
n-Butyllithium in Hexanes (30 wt% soln) | 109-72-8 | |
n-Butyllithium in Hexanes (85% soln) | 109-72-8 | |
n-Butyllithium in Toluene (10% Soln) | 109-72-8 | |
n-Butyllithium in Toluene (20% Soln) | 109-72-8 | |
sec-Butyllithium in Cyclohexane | 598-30-1 | |
n-Hexyllithium | 21369-64-2 | |
cis-1,2-Diaminocyclohexane | 1436-59-5 | |
trans-1,2-Diaminocyclohexane | 1121-22-8 | |
(±)-trans-N,N’-Dimethyl-1,2-diaminocyclohexane | 67579-81-1 | |
(±)-trans-N,N’-Dimethyl-1,2-diaminocyclohexane dihydrochloride | 473918-41-1 | |
3-Dimethylaminopropyl chloride hydrochloride | 5407-04-5 | |
3-Dimethylaminopropyl chloride hydrochloride (65%) | 5407-04-5 | |
3-Dimethylamino-2-methylpropyl chloride hydrochloride (65%) | 4261-67-0 | |
3-Dibutylaminopropyl chloride hydrochloride (65%) | 115555-77-6 | |
Triethylamine hydrochloride | 554-68-7 | |
N-Tosylethylenediamine | 14316-16-6 | |
Benzhydrylamine | 91-00-9 | |
Benzhydrylamine hydrochloride | 5267-34-5 | |
N-Phenylglycine | 103-01-5 | |
1-Benzhydryl-3-azetidinol | 18621-17-5 | |
Cyclohexyl mandelic acid | 4335-77-7 | |
Cyclohexyl mandelic acid, methyl ester | 10399-13-0 | |
Cyclopentyl mandelic acid | 427-49-6 | |
(±)-1,2-Diphenyl-1,2-ethanediol | 655-48-1 | |
meso-1,2-Diphenyl-1,2-ethanediol | 492-70-6 | |
4-Hydroxybenzaldehyde | 123-08-0 | |
4-Acetoxybenzaldehyde | 878-00-2 | |
4-(4-Acetoxyphenyl)-2-butanone | 3572-06-3 | |
1,1-Cyclobutanedicarboxylic acid | 5445-51-2 | |
1-Benzosuberone | 826-73-3 | |
Reactive blue 246 | 121888-69-5 | |
Reactive blue 247 | 109561-07-1 | |
(R,R)-(-)-1,2-Diaminocyclohexane | 20439-47-8 | |
(S,S)-(+)-1,2-Diaminocyclohexane | 21436-03-3 | |
(R,R)-(+)-1,2-Diaminocyclohexane hydrochloride | 191480-63-4 | |
(S,S)-(-)-1,2-Diaminocyclohexane hydrochloride | 191480-65-6 | |
(R,R)-(+)-1,2-Diaminocyclohexane L-tartrate | 39961-95-0 | |
(S,S)-(-)-1,2-Diaminocyclohexane D-tartrate | 67333-70-4 | |
(1R,2R)-N,N’-Dimethyl-1,2-diaminocyclohexane | 68737-65-5 | |
(1S,2S)-N,N’-Dimethyl-1,2-diaminocyclohexane | 87583-89-9 | |
(1R,2R)-N,N’-Dibenzyl-1,2-diaminocyclohexane | 143443-23-6 | |
(1S,2S)-N,N’-Dibenzyl-1,2-diaminocyclohexane | 191480-61-2 | |
(1S,2S)-(+)-N-(4-Toluenesulphonyl)-1,2-diaminocyclohexane | 174291-97-5 | |
(1R,2R)-(-)-N-(4-Toluenesulphonyl)-1,2-diaminocyclohexane | 174291-96-4 | |
(1R,2R)-trans-N-Boc-1,2-diaminocyclohexane | 146504-07-6 | |
(1S,2S)-trans-N-Boc-1,2-diaminocyclohexane | 180683-64-1 | |
(1S,2R)-1-(N-Boc-amino)-2-aminocyclohexane (R)-mandelate | 1391731-16-0 | |
(1R,2S)-1-(N-Boc-amino)-2-aminocyclohexane (S)-mandelate | 1192153-41-5 | |
(1R,2S)-2-(N-Cbz-amino)-1-aminocyclohexane | 1067631-21-3 | |
(1S,2R)-2-(N-Cbz-amino)-1-aminocyclohexane | 1067631-22-4 | |
(R)-(+)-Diphenylprolinol | 22348-32-9 | |
(S)-(-)-Diphenylprolinol | 112068-01-6 | |
(1R,2R)-(+)-1,2-Diphenylethylenediamine | 35132-20-8 | |
(1S,2S)-(-)-1,2-Diphenylethylenediamine | 29841-69-8 | |
(1R,2R)-(+)-N,N’-Bis(4-Toluenesulfonyl)-1,2-diphenylethylenediamine | 121758-19-8 | |
(1S,2S)-(-)-N,N’-Bis(4-Toluenesulfonyl)-1,2-diphenylethylenediamine | 170709-41-8 | |
(1R,2R)-(-)-N-(4-Toluenesulphonyl)-1,2-diphenylethylenediamine | 144222-34-4 | |
(1S,2S)-(+)-N-(4-Toluenesulphonyl)-1,2-diphenylethylenediamine | 167316-27-0 | |
(1R,2R)-(+)-N-Methanesulphonyl-1,2-diphenylethylenediamine | 511534-44-4 | |
(1S,2S)-(-)-N-Methanesulphonyl-1,2-diphenylethylenediamine | 300345-76-0 | |
(1R’,1R,2R)-(-)-N-(Camphorsulphonyl)-1,2-diphenylethylenediamine | 676270-67-0 | |
(1S’,1S,2S)-(+)-N-(Camphorsulphonyl)-1,2-diphenylethylenediamine | 676270-65-8 | |
(R)-(+)-N-Methyl-1-phenylethylamine | 5933-40-4 | |
(S)-(-)-N-Methyl-1-phenylethylamine | 19131-99-8 | |
(R)-(+)-1-(4-Methylphenyl)ethylamine | 4187-38-6 | |
(S)-(-)-1-(4-Methylphenyl)ethylamine | 27298-98-2 | |
(R)-(+)-N,N-Dimethyl-1-phenylethylamine | 19342-01-9 | |
(S)-(-)-N,N-Dimethyl-1-phenylethylamine | 17279-31-1 | |
(R,R’)-(+)-Bis(1-phenylethyl)amine hydrochloride | 82398-30-9 | |
(S,S’)-(-)-Bis(1-phenylethyl)amine hydrochloride | 40648-92-8 | |
(R)-(+)-N-Benzyl-1-phenylethylamine | 38235-77-7 | |
(S)-(-)-N-Benzyl-1-phenylethylamine | 17480-69-2 | |
(R)-(+)-1-(1-Naphthyl)ethylamine | 3886-70-2 | |
(S)-(-)-1-(1-Naphthyl)ethylamine | 10420-89-0 | |
(R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride | 82572-04-1 | |
(S)-(-)-1-(1-Naphthyl)ethylamine hydrochloride | 51600-24-9 | |
(R)-(+)-1-(2-Naphthyl)ethylamine | 3906-16-9 | |
(S)-(-)-1-(2-Naphthyl)ethylamine | 3082-62-0 | |
D-Phenylalaninol | 5267-64-1 | |
L-Phenylalaninol | 3182-95-4 | |
(1R,2R)-(-)-trans-1-Amino-2-indanol | 163061-73-2 | |
(1R,2S)-(+)-cis-1-Amino-2-indanol | 136030-00-7 | |
(1S,2R)-(-)-cis-1-Amino-2-indanol | 126456-43-7 | |
(1S,2S)-(+)-trans-1-Amino-2-indanol | 163061-74-3 | |
(R)-(-)-2-Amino-1-butanol | 5856-63-3 | |
(S)-(+)-2-Amino-1-butanol | 5856-62-2 | |
(R)-2-Amino-1-butanol hydrochloride | 40916-56-1 | |
(S)-2-Amino-1-butanol hydrochloride | 28895-09-2 | |
(S)-1,2-Diaminopropane dihydrochloride | 19777-66-3 | |
(S)-3-Methylpiperidine | 17305-22-5 | |
(R)-Quinuclidinol | 25333-42-0 | |
(S)-Methyl 3-Amino-3-phenylpropanoate hydrochloride | 144494-72-4 | |
(S)-1-Aminotetralin | 23357-52-0 | |
(1S)-(+)-Camphorquinone | 2767-84-2 | |
(R)-Cyclohexyl mandelic acid | 20585-39-1 | |
(S)-Cyclohexyl mandelic acid | 20585-34-6 | |
(R)-(-)-2-Phenylbutyric acid | 938-79-4 | |
(S)-(+)-2-Phenylbutyric acid | 4286-15-1 | |
(S)-(+)-2-Isopropyl-2-(4-methylphenyl)acetic acid | 55332-35-9 | |
(1R,2R)-(+)-1,2-Diphenyl-1,2-ethanediol | 52340-78-0 | |
(1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediol | 2325-10-2 | |
(R)-Chlocyphos | 98674-87-4 | |
(S)-Chlocyphos | 98674-86-3 | |
(R)-(-)-2,2-Dimethyl-5-oxo-1,3-dioxalone-4-acetic acid | 113278-68-5 | |
(R,R)-(-)-Jacobsen ligand | 135616-40-9 | |
(S,S)-(+)-Jacobsen ligand | 135616-36-3 | |
(R,R)-Jacobsen cobalt (II) catalyst | 176763-62-5 | |
(S,S)-Jacobsen cobalt (II) catalyst | 188264-84-8 | |
(R,R)-(-)-Jacobsen manganese (III) catalyst | 138124-32-0 | |
(S,S)-(+)-Jacobsen manganese (III) catalyst | 135620-04-1 | |
(R)-(+)-1-(2-Naphthyl)ethanol | 52193-85-8 | |
(S)-(-)-1-(2-Naphthyl)ethanol | 27544-18-9 | |
2,4,6-Tri-tert-butylpyrimidine | 67490-21-5 | |
(R)-methyl-2-Pyrazinemethanol | 1334160-82-5 | |
(S)-methyl-2-Pyrazinemethanol | 1334160-87-0 | |
(R)-(-)-4-Fluorostyrene oxide | 134356-73-3 | |
(S)-(+)-4-Fluorostyrene oxide | 134356-74-4 | |
(2R)-2-(2,4-Difluorophenyl)oxirane | 851634-77-0 | |
(2S)-2-(2,4-Difluorophenyl)oxirane | 851634-78-1 | |
(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol | 127852-28-2 | |
(1S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol | 225920-05-8 | |
(R)-1-(4-Methylthiazol-5-yl)ethanol | 1344944-19-9 | |
(S)-1-(4-Methylthiazol-5-yl)ethanol | 1344940-15-3 | |
(R)-3-Hydroxy-3-phenylpropanenitrile | 73627-97-1 | |
(S)-3-Hydroxy-3-phenylpropanenitrile | 132203-26-0 | |
(R)-3-Hydroxy-3-(4-pyridinyl)propanenitrile | 1372452-66-8 | |
(S)-3-Hydroxy-3-(4-pyridinyl)propanenitrile | 676563-19-2 | |
(R)-4-Bromo-β-hydroxybenzenepropanenitrile | 877876-61-4 | |
(S)-4-Bromo-β-hydroxybenzenepropanenitrile | 877876-70-5 | |
(R)-2,2,2-Trifluoro-1-(3-chlorophenyl)ethanol | 376347-10-3 | |
(S)-2,2,2-Trifluoro-1-(3-chlorophenyl)ethanol | 1372452-83-9 | |
(R)-2,2,2-Trifluoro-1-(4-chlorophenyl)ethanol | 80418-11-7 | |
(S)-2,2,2-Trifluoro-1-(4-chlorophenyl)ethanol | 72487-06-0 | |
(R)-4-(2,2,2-trifluoro-1-hydroxyethyl)benzoic acid | 150821-42-4 | |
(S)-4-(2,2,2-trifluoro-1-hydroxyethyl)benzoic acid | 130534-97-3 | |
(R)-(+)-1-Phenylethanol | 1517-69-7 | |
(S)-(-)-1-Phenylethanol | 1445-91-6 | |
(1R)-1-(3-chlorophenyl)ethan-1-ol | 120121-01-9 | |
(1S)-1-(3-chlorophenyl)ethan-1-ol | 135145-34-5 | |
(R)-1-(3-Fluoro-4-methylphenyl)ethanol | 1344955-38-9 | |
(S)-1-(3-Fluoro-4-methylphenyl)ethanol | 1344930-48-8 | |
(R)-(+)-Phenyloxirane | 20780-53-4 | |
(S)-(-)-Phenyloxirane | 20780-54-5 | |
(2R)-(-)-2-(4-Bromophenyl)oxirane | 62566-68-1 | |
(2S)-(+)-2-(4-Bromophenyl)oxirane | 148684-05-3 | |
(αR)-3-Chloro-α-methyl-4-pyridinemethanol | 1372452-57-7 | |
(αS)-3-Chloro-α-methyl-4-pyridinemethanol | 1016227-99-8 | |
(αR)-α,3-Dimethyl-2-pyrazinemethanol | 1372452-51-1 | |
(αS)-α,3-Dimethyl-2-pyrazinemethanol | 1372452-36-2 | |
tert-Butyl ((2S,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl)carbamate | 162536-40-5 | |
tert-Butyl ((2S,3S)-4-chloro-3-hydroxy-1-phenylbutan-2-yl)carbamate | 165727-45-7 | |
(R)-N-Phenyl-3-hydroxybutanamide | 124095-27-8 | |
(S)-N-Phenyl-3-hydroxybutanamide | 61444-22-2 | |
Methyl (R)-(-)-3-Hydroxybutyrate | 3976-69-0 | |
Methyl (S)-(+)-3-Hydroxybutyrate | 53562-86-0 | |
6-chloro-α-(trifluoromethyl)-(αR)-3-Pyridinemethanol | 1412260-92-4 | |
6-chloro-α-(trifluoromethyl)-(αS)-3-Pyridinemethanol | 1412254-62-6 | |
Hexamethyldisiloxane | 107-46-0 | |
Trimethylchlorosilane | 75-77-4 | |
1,1,1,3,3,3-Hexamethyldisilazane | 999-97-3 | |
N,N´-Bis(trimethylsilyl)urea | 18297-63-7 | |
Hexamethyldisilane | 1450-14-2 | |
N,O-Bis(trimethylsilyl)acetamide | 10416-59-8 | |
N,O-Bis(trimethylsilyl)trifluoroacetamide | 25561-30-2 | |
3-Cyclopentylpropionic acid | 140-77-2 | |
3-Cyclopentylpropionic acid chloride | 104-97-2 | |
N-(Trimethylsilyl)imidazole | 18156-74-6 | |
N-Methyl-N-(trimethylsilyl)trifluoroacetamide | 24589-78-4 | |
N-Methyl-N-(trimethylsilyl)heptafluorobutyramide | 53296-64-3 | |
(N,N-Diethylamino)trimethylsilane | 996-50-9 | |
N,N-Bis(trimethylsilyl)formamide | 15500-60-4 | |
Dimethyl azelate | 1732-10-1 | |
Di-tert-Butylsilane | 30736-07-3 | |
1-(Trimethylsiloxy)cyclohexene | 6651-36-1 | |
2-(Trimethylsilyloxy)-1,3-butadiene | 38053-91-7 | |
2-(Trimethylsiloxy)propene | 1833-53-0 | |
Bis(N,N-dimethylamino)dimethylsilane | 3768-58-9 | |
Ethylcarbazate | 4114-31-2 | |
Heptamethyldisilazane | 920-68-3 | |
N,O-Bis(trimethylsilyl)sulfamate | 18187-06-9 | |
N-(tert-Butyldimethylsilyl)-N-methyltrifluoracetamide | 77377-52-7 | |
N-Methyl-bis(trifluoroacetamide) | 685-27-8 | |
N-Methyl-bis(heptafluorobutyramide) | 73980-71-9 | |
N-Methyl-N-trimethylsilylacetamide | 7449-74-3 | |
N-Trimethylsilylacetamide | 13435-12-6 | |
Sodium bis(trimethylsilyl)amide (in THF) | 1070-89-9 | |
Trimethylbromosilane | 2857-97-8 | |
Trimethylethoxysilane | 1825-62-3 | |
Trimethyliodosilane | 16029-98-4 | |
5-Bromovaleroyl chloride | 4509-90-4 | |
Tris(trimethylsiloxy)ethylene | 69097-20-7 | |
Lithium bis(trimethylsilyl)amide (in THF) | 4039-32-1 | |
a-Chlorophenylacetylchloride | 2912-62-1 | |
Dimethyldichlorosilane | 75-78-5 | |
Trimethylsilyl acetate | 2754-27-0 | |
Trimethylsilyl trifluoromethanesulfonate | 27607-77-8 | |
2,2,4,4,6,6-Hexamethylcyclotrisilazane | 1009-93-4 | |
tert-Butylacetylene (3,3-Dimethyl-1-butyne) | 917-92-0 | |
Isopropylmagnesiumbromide (in 2-MeTHF) | 920-39-8 | |
Dimethyl pimelate | 1732-08-7 | |
Trimethylsilylacetylene | 1066-54-2 | |
Pimelic acid | 111-16-0 | |
1,3-Bis(trimethylsilyl)carbodiimide | 1000-70-0 | |
1,2-Bis(trimethylsilyloxy)ethane | 7381-30-8 | |
1-Trimethylsilyl-3-trimethylsilyloxy-1-butine | 103620-64-0 | |
(Chlorodimethylsilyl)bis(trimethylsilyl)amine | 1586-72-7 | |
Tetramethyl orthosilicate | 681-84-5 | |
Ethyl 2,3-dibromopropionate | 3674-13-3 | |
Potassium bis(trimethylsilyl)amide (in THF) | 40949-94-8 | |
(N,N-Dimethylamino)trimethylsilane | 2083-91-2 | |
Triethylchlorosilane | 994-30-9 | |
t-Butyldimethylsilyl trifluoromethanesulfonate | 69739-34-0 | |
Triethylsilane | 617-86-7 | |
1,1,1,3,3,3-Hexaethyldisilazane | 2117-18-2 | |
Tetraethoxysilane | 78-10-4 | |
Vinyltrimethylsilane | 754-05-2 | |
N-(Trimethylsilyl)morpholine | 13368-42-8 | |
(3-Phenylpropyl)dimethoxymethylsilane | 1233513-31-9 | |
Triethylsilylacetylene | 1777-03-3 | |
Tetraethylsilane | 631-36-7 | |
1H,1H,2H,2H-Perfluorooctyltrichlorosilane | 78560-45-9 | |
2,3-Dibromopropionic acid | 900-05-5 | |
Pimelonitrile | 646-20-8 | |
Pentylmagnesium bromide (in THF) | 693-25-4 | |
Bis(trimethylsilyl)acetylene | 14630-40-1 | |
Allyltrimethylsilane | 762-72-1 | |
Bis(trimethylsilyl)sulfate | 18306-29-1 | |
Triethylsilyl trifluoromethanesulfonate | 79271-56-0 | |
Tetramethylsilane | 75-76-3 | |
Chloromethyl(isopropoxy)dimethylsilane | 18171-11-4 | |
Trifluoracetamid | 354-38-1 | |
Trimethylsilyl cyanide | 7677-24-9 | |
Dimethylphenylchlorosilane | 768-33-2 | |
Tributylchlorosilane | 995-45-9 | |
Zinc chloride in THF | 7646-85-7 | |
2-(Trimethylsilyl)ethanol | 2916-68-9 | |
Methylmagnesium chloride (in THF) | 676-58-4 | |
Ethylmagnesiumbromide (in 2-MeTHF) | 925-90-6 | |
Isopropylmagnesium chloride (in MeTHF) | 1068-55-9 | |
Phenylmagnesium chloride (in THF) | 100-59-4 | |
Isopropylmagnesium chloride (in THF) | 1068-55-9 | |
Allylmagnesium chloride (in THF) | 2622-05-1 | |
Trimethylsilyl isocyanate | 1118-02-1 | |
Di-tert-butylsilyl bis(trifluoromethanesulfonate) | 85272-31-7 | |
N-tert-Butylaminotrimethylsilane | 5577-67-3 | |
Pentylmagnesium chloride (in THF) | 6393-56-2 | |
Ethylmagnesiumbromide (in MTBE) | 925-90-6 | |
Hexylmagnesium chloride in THF | 44767-62-6 | |
Di(tert-butylamino)silane | 186598-40-3 | |
1-Trimethylsilyl-1,2,4-triazole | 18293-54-4 | |
3-N,N-Bis(trimethylsilyl)aminopropyltriethoxysilane | 17940-89-5 | |
Chlorodiphenylsilane | 1631-83-0 | |
1,1,3,3-Tetramethyldisiloxane | 3277-26-7 | |
Trimethylsilyl isothiocyanate | 2290-65-5 | |
Bis(trimethylsilyl)methane | 2117-28-4 | |
Dimethyl(trimethylsilylmethyl)silane | 1189-75-9 | |
4-(N,N-Dimethylamino)phenylmagnesium bromide (in THF) | 7353-91-5 | |
Methylcarbazat | 6294-89-9 | |
(Trimethylsilyl)methanol | 3219-63-4 | |
Tetraacetoxysilane | 562-90-3 | |
(Triisopropylsilyl)acetylene | 89343-06-6 | |
Isobutylmagnesium chloride (in THF) | 5674-02-2 | |
Tris(trimethylsilyl) borate | 4325-85-3 | |
Lithium (trimethylsilyl) acetylide in THF | 54655-07-1 | |
3-Bromopropionitrile | 2417-90-5 | |
Allyl nitrile | 109-75-1 | |
(N,N-Diethylaminopropyl)triethoxysilane | 10049-42-0 | |
N-(Methoxymethyl)-N-(trimethylsilylmethyl)benzylamine | 93102-05-7 | |
Methyldichlorosilane | 75-54-7 | |
N-Benzyl-N-(trimethylsilylmethyl)amine | 53215-95-5 | |
Diphenyldichlorosilane | 80-10-4 | |
Zinc chloride (in 2-MeTHF) | 7646-85-7 | |
1-(t-Butyldimethylsiloxy)-3-chloropropane | 89031-82-3 | |
(4-Bromophenyl)trimethylsilane | 6999-03-7 | |
(Dimethylethoxysilyl)(diethoxysilyl)methane | 1242241-05-9 | |
(3-Chloropropoxy)dimethylisopropylsilane | 1191036-21-1 | |
(N-tert-Butyldimethylsilyl)imidazole | 54925-64-3 | |
Decanoyl chloride | 112-13-0 | |
Vinyloxytrimethylsilane | 6213-94-1 | |
Tetraallylsilane | 1112-66-9 | |
(N-Trimethylsilyl)pyrrolidine | 15097-49-1 | |
1-Trimethylsiloxy-3-chloropropane | 18171-15-8 | |
1-Triethylsiloxy-3-chloropropane | 39059-64-8 | |
1-Vinyldimethylsiloxy-3-chloropropane | - | |
1-Phenyldimethylsiloxy-3-chloropropane | 1015176-63-2 | |
1-Triisopropylsiloxy-3-chloropropane | 162827-30-7 | |
1H,1H,2H,2H-Perfluorooctanphosphonic acid | 252237-40-4 | |
(12-Phosphonododecyl)phosphonic acid | 7450-59-1 | |
1-Vinyl-1,1,3,3-tetramethyldisiloxane | 55967-52-7 | |
Tin tetrachloride (in Dichloromethane) | 7646-78-8 | |
n-Hexoxytrimethylsilane | 17888-62-9 | |
Triisopropylsilylpropyne | 82192-57-2 | |
Bis(trimethylsilyl)malonate | 18457-04-0 | |
Tris(trimethylsilyl)amine | 1586-73-8 | |
N,O-Bis(trimethylsilyl)hydroxylamine | 22737-37-7 | |
Tetravinylsilane | 1112-55-6 | |
(3-N-Methylaminopropyl)trimethoxysilane | 3069-25-8 | |
2,5-Hexanedione | 110-13-4 | |
Bis(tert-butylamino)dimethylsilane | 17940-08-8 | |
Tris(diethylamino)silane | 15112-89-7 | |
(Ethylthio)trimethylsilane | 5573-62-6 | |
2,4,6-Trimethyl-2,4,6-trivinylcyclotrisilazane | 5505-72-6 | |
Ethylpropiolate | 623-47-2 | |
Undecanoyl chloride | 17746-05-3 | |
1-Trimethylsilyl-1-butyne | 62108-37-6 | |
4-Cyanobenzoyl chloride | 6068-72-0 | |
Dichlorodiisopropylsilane | 7751-38-4 | |
1,1-Dichlorosilacyclopentane | 2406-33-9 | |
(2-Bromoethoxy)-tert-butyldimethylsilane | 86864-60-0 | |
Methylmagnesium bromide (in 2-MeTHF) | 75-16-1 | |
Dibutyldichlorosilane | 3449-28-3 | |
N,N,O-Tris(trimethylsilyl)hydroxylamine | 21023-20-1 | |
Isobutylmagnesium bromide (in THF) | 926-62-5 | |
Trimethylsilyl trifluoroacetate | 400-53-3 | |
Isopropenylmagnesium bromide in THF | 13291-18-4 | |
Borton trichloride in DCM | 10294-34-5 | |
Phosphorous oxybromide (in Toluene) | 7789-59-5 | |
2,2-Diethoxypropionitrile | 56011-12-2 | |
Chloromethyltrimethylsilane | 2344-80-1 | |
Ethyl fluoroacetate | 459-72-3 | |
Methyltrichlorosilane | 75-79-6 | |
Acetamide | 60-35-5 | |
Tris(dimethylamino)methylsilane | 3768-57-8 | |
Lithium bis(trimethylsilyl)amide (in Toluene) | 4039-32-1 | |
Triphenylsilanol | 791-31-1 | |
Ammonium chloride | 12125-02-9 | |
t-Butyldimethylchlorosilane (in Toluene) | 18162-48-6 | |
Allyltrimethoxysilane | 2551-83-9 | |
Vinyltriisopropenoxysilane | 15332-99-7 | |
Diphenylsilanediol | 947-42-2 | |
Sodium bis(trimethylsilyl)amide (in Toluene) | 1070-89-9 | |
1-(Trimethylacetyl)imidazole | 4195-19-1 | |
Triphenylchlorosilane | 76-86-8 | |
3-Iodopropyltrimethoxysilane | 14867-28-8 | |
Triisopropylsilane | 6485-79-6 | |
Triisopropylchlorosilane | 13154-24-0 | |
t-Butyldimethylchlorosilane (in THF) | 18162-48-6 | |
Octaphenylcyclotetrasiloxane | 546-56-5 | |
Dimethylchlorosilane | 1066-35-9 | |
1,2-Diphenyl-1,1,2,2-tetramethyldisilane | 1145-98-8 | |
Ammonium trifluoroacetate | 3336-58-1 | |
Tetrakis(trimethylsilyl)silane | 4098-98-0 | |
t-Butyldimethylchlorosilane (in Dichloromethane) | 18162-48-6 | |
Trimethylsilanol | 1066-40-6 | |
N-Vinylformamido-trimethylsilane | 211985-47-6 | |
2-Butynoic acid | 590-93-2 | |
Methylvinyl-bis(N-methylacetoamido)silane | 50791-87-2 | |
(Phenylthio)trimethylsilane | 4551-15-9 | |
1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane | 69304-37-6 | |
p-Tolyltrimethylsilane | 3728-43-6 | |
Octadecyldimethyl(N,N-diethylamino)silane | 98984-76-0 | |
Tris(trimethylsilyl)silane | 1873-77-4 | |
3,5-Heptandione | 7424-54-6 | |
N-trimethylsilyltrifluoroacetamide | 55982-15-5 | |
Aminomethyltrimethylsilane | 18166-02-4 | |
4-(Trimethylsilyl)-3-butyn-2-one | 5930-98-3 | |
Triisopropylsilyl trifluoromethanesulfonate | 80522-42-5 | |
t-Butyldimethylsilane | 29681-57-0 | |
(N-Phenylamino)trimethylsilane | 3768-55-6 | |
Methyl (N-trimethylsilylcarbamate) | 18147-09-6 | |
Tri(n-Butylamino)methylsilan | 16411-33-9 | |
Allyltriethoxysilane | 2550-04-1 | |
Crotononitrile (cis+trans) | 4786-20-3 | |
(3-Phenylpropyl)trimethoxysilane | 152958-90-2 | |
O,O´-Bis(trimethylsilyl)thymine | 7288-28-0 | |
Tetrakis(trimethylsilyloxy)silane | 3555-47-3 | |
2,2,4,4,6,6,8,8-Octamethylcyclotetrasilazane | 1020-84-4 | |
Iodomethyltrimethylsilane | 4206-67-1 | |
Alanyl-L-Glutamine | 39537-23-0 | |
Glycine | 56-40-6 | |
L-Arginine | 74-79-3 | |
L-Arginine HCl | 1119-34-2 | |
L-Arginine L-Glutamate | 4320-30-3 | |
L-Aspartic Acid | 56-84-8 | |
L-Cysteine | 52-90-4 | |
L-Cysteine HCl anhydrous | 52-89-1 | |
L-Cysteine HCl H20 | 7048-04-6 | |
L-Dopa | 59-92-7 | |
L-Glutamic acid | 56-86-0 | |
L-Glutamine | 56-85-9 | |
L-Histidine | 71-00-1 | |
L-Histidine HCl H20 | 5934-29-2 | |
L-Isoleucine | 73-32-5 | |
L-Leucine | 61-90-5 | |
L-Lysine Acetate | 57282-49-2 | |
L-Lysine HCl | 657-27-2 | |
L-Methionine | 63-68-3 | |
L-Phenylalanine | 63-91-2 | |
L-Proline | 147-85-3 | |
L-Serine | 56-45-1 | |
L-Threonine | 72-19-5 | |
L-Tryptophan | 73-22-3 | |
L-Tyrosine | 60-18-4 | |
L-Valine | 72-18-4 | |
N-Acetyl-DL-Tryptophan | 87-32-1 | |
N-Acetyl-L-Cysteine | 616-91-1 | |
N-Acetyl-L-Tyrosine | 537-55-3 | |
Taurine | 107-35-7 | |
1,3-ACETONEDICARBOXYLIC ACID ANHYDRIDE | 10521-08-1 | |
ACETOXY-ACETYL CHLORIDE | 13831-31-7 | |
ACETYLENEDICARBOXYLIC ACID MONO POTASSIUM SALT | 928-04-1 | |
1-AMINOCYCLOBUTANE-CARBOXYLIC ACID METHYLESTER | 215597-35-6 | |
4-AMINOMETHYL-BENZOIC ACID HYDROCHLORIDE | 67688-72-6 | |
4-ANISOYL CHLORIDE | 100-07-2 | |
9-ANTHRACEN-CARBOXYLIC ACID | 723-62-6 | |
BENZOIC ANHYDRIDE | 93-97-0 | |
BENZYL MONOCHLORACETATE | 140-18-1 | |
ETHYL 7-BROMOHEPTANOATE | 29823-18-5 | |
5-BROMOPENTYLACETATE | 15848-22-3 | |
4-(4-FLUOROBENZOYL) BUTYRIC ACID | 149437-76-3 | |
CYCLOHEXYL ACETIC ACID | 5292-21-7 | |
CYCLOHEXYL ACETYL CHLORIDE | 23860-35-7 | |
CYCLOHEXYL MANDELIC ACID | 4335-77-7 | |
CYCLOPENTYL MANDELIC ACID METHYL ESTER | 19833-96-6 | |
CYCLOPROPOXY ACETIC ACID | - | |
2-ETHOXYACETICACID ETHYLESTER | 817-95-8 | |
2-ETHOXYACETYLCHLORIDE | 14077-58-8 | |
ETHYL ISOBUTYRATE | 97-62-1 | |
HEPTANOIC ANHYDRIDE | 626-27-7 | |
HEPTANOYL CHLORIDE | 2528-61-2 | |
HEXANOIC ANHYDRIDE | 2051-49-2 | |
HEXANOYL CHLORIDE | 142-61-0 | |
3-HYDROXYBUTYRIC ACID ETHYLESTER | 5405-41-4 | |
3-HYDROXY GLUTARIC ACID DIETHYLESTER | 32328-03-3 | |
3-HYDROXY GLUTARIC ACID DIMETHYLESTER | 7250-55-7 | |
2-HYDROXY OCTANOIC ACID | 617-73-2 | |
METHYL PHENYL GLYOXYLATE (METHYL BENZOYL FORMATE) | 15206-55-0 | |
4-METHYL VALERIANIC ACID | 646-07-1 | |
4-METHYL VALEROYL CHLORIDE (ISOCAPROYL CHLORIDE) | 38136-29-7 | |
6-METHOXYNAPHTALENE ACETIC ACID | 87901-81-3 | |
1-NAPHTHOYL CHLORIDE | 879-18-5 | |
2-NAPHTHOYL CHLORIDE | 2243-83-6 | |
1-NAPHTOIC ACID | 86-55-5 | |
2-NAPHTOIC ACID | 93-09-4 | |
5-NORBORNENE 2-CARBOXYLIC ACID | 120-74-1 | |
PALMITIC ANHYDRIDE | 623-65-4 | |
4-PENTENOIC ACID | 591-80-0 | |
2-PHENOXY PROPIONYL CHLORIDE | 122-35-0 | |
PHENYLACETYL CHLORIDE | 103-80-0 | |
2-PHENYL BUTYRIC ACID | 90-27-7 | |
2-PHENYL BUTYRIC ACID CHLORIDE | 36854-57-6 | |
4-PHENYL BUTYRIC ACID, SPECIAL GRADE | 1821-12-1 | |
3-PHENYL PROPIONIC ACID CHLORIDE | 645-45-4 | |
3-PHENYL PROPIONIC ACID ETHYL ESTER | 2021-28-5 | |
3-PHENYL PROPIONYL CHLORIDE | 645-45-4 | |
3-(2-CHLOROPHENYL)-PROPIONIC ACID | 1643-28-3 | |
TETRAHYDROFURAN-2- CARBOXYLIC ACID | 16874-33-2 | |
UNDECANOIC ACID | 112-37-8 | |
UNDECENOYL CHLORIDE | 38460-95-6 | |
2-(2-BROMOETHYL) 1,3-DIOXANE (BED) | 33884-43-4 | |
2-(2-BROMOETHYL) 1,3- DIOXOLANE (BEDO) | 18742-02-4 | |
2-(1,3-DIOXOLANE 2-YL) ETHYL TRIPHENYL PHOSPHONIUM BROMIDE | 86608-70-0 | |
2-(1,3-DIOXAN 2-YL) ETHYL TRIPHENYL PHOSPHONIUM BROMIDE (DEPB) | 69891-92-5 | |
AMINOACETALDEHYDE DIETHYLACETAL | 645-36-3 | |
1-AMINO-2-(4-CHLOROPHENYL)- ETHANE | 156-41-2 | |
AMINOCYCLOHEPTANE | 5452-35-7 | |
AMINOCYCLOPENTANE | 1003-03-8 | |
3-AMINO-2,2-DIMETHYLPROPIONAMIDE | 324763-51-1 | |
1-AMINO-2,2-DIPHENYLETHANE | 3963-62-0 | |
1-AMINO-3,3-DIPHENYLPROPANE | 5586-73-2 | |
2-AMINOHEPTANE | 123-82-0 | |
1-AMINO-2-(2-METHOXYPHENYL)- ETHANE | 2045-79-6 | |
4-AMINOMETHYL BENZOIC ACID | 56-91-7 | |
1-AMINO-2-METHYL-BUTANE | 96-15-1 | |
2-AMINOMETHYL-TETRAHYDROFURAN | 4795-29-3 | |
1-AMINONONANE | 112-20-9 | |
2-AMINOOCTANE | 693-16-3 | |
1-AMINOPENTANE | 110-58-7 | |
3-AMINOPENTANE | 616-24-0 | |
1-AMINO-4-PHENYLBUTANE | 13214-66-9 | |
2-AMINO-4-PHENYLBUTANE | 22374-89-6 | |
2-AMINO-1-PHENYLETHANOL | 7568-93-6 | |
1-AMINO-3-PHENYLPROPANE | 2038-57-5 | |
4-CHLOROBENZYLAMINE | 104-86-9 | |
2,5-DICHLOROPENTYLAMINE HYDROCHLORIDE | 62922-45-6 | |
2,5-DIMETHOXY TETRAHYDROFURAN, DMOTHF | 696-59-3 | |
DIMETHYLAMINO ACETALDEHYDE DIETHYLACETAL | 3616-56-6 | |
DI-N-HEXYLAMINE | 143-16-8 | |
2-METHOXYBENZYLAMINE | 6850-57-3 | |
METHYLAMINOACETALDEHYDE DIMETHYLACETAL | 122-07-6 | |
4-METHYLBENZYLAMINE | 104-84-7 | |
NEOPENTYLAMINE | 5813-64-9 | |
N-METHYLETHYLENEDIAMINE | 109-81-9 | |
N,N'-DIISOPROPYLETHYLENE DIAMINE | 4013-94-9 | |
N-(3-METHOXYPROPYL)-N-PENTYLAMINE | 111106-31-1 | |
3-(AMINOMETHYL)-PIPERIDINE | 23099-21-0 | |
TRI-N-HEPTYLAMINE | 2411-36-1 | |
TRI-N-HEXYLAMINE | 102-86-3 | |
VITAMIN E - TPGS - D-A-TOCOPHERYL POLYETHYLENE GLYCOL 1000 SUCCINATE | 9002-96-4 | |
2-CHLORO-5-(4,4,5,5- TETRAMETHYL-[1,3,2]- DIOXABOROLAN-2-YL)-PYRIDIN | 444120-94-9 | |
1-(TETRAHYDROPYRAN-2-YL) -5-(4,4,5,5- TETRAMETHYL-[1,3,2]- DIOXABOROLAN-2-YL)-1H-PYRAZOLE | - | |
3-FLUORO-4-(4,4,5,5- TETRAMETHYL-[1,3,2]- DIOXABOROLAN-2-YL)-PYRIDIN | 458532-88-2 | |
PYRIDIN-3-YL-BORONIC ACID | 1692-25-7 | |
BENZYL-2-BROMOETHYL ETHER | 1462-37-9 | |
2-(2-BROMOETHYL) 1,3-DIOXOLANE (BEDO) | 18742-02-4 | |
PHENOXY ETHYL BROMIDE | 589-10-6 | |
(R)-2-ACETOXY-2-PHENYL ACETIC ACID | 51019-43-3 | |
3-(3,4-DIMETHOXYPHENYL)-L-ALANINE (S-3,4-DMPA) | 32161-30-1 | |
ETHYL TRANS-4- AMINOCYCLOHEXYLCARBOXYLATE HYDROCHLORIDE | 2084-28-8 | |
R-(-)-2-AMINO-1-PHENYLETHANOL | 2549-14-6 | |
S-2-AMINO-1-PHENYLETHANOL | 56613-81-1 | |
(R)-(+)-3-AMINOQUINUCLIDINE DIHYDROCHLORIDE | 123536-14-1 | |
L-(+)-O,O'-DIACETYL-TARTARICACID ANHYDRIDE | 6283-74-5 | |
D-(+)-DIANISOYL-TARTARIC ACID | 191605-10-4 | |
L-(-)-DIANISOYL-TARTARIC ACID | 50583-51-2 | |
DIBENZOYL-D-(+)-TARTARIC ACID HYDRATE | 80822-15-7 | |
(+)-DIBENZOYL-D-TARTARIC ACID MONODIMETHYLAMIDE | 36624-61-0 | |
DIBENZOYL-L-(-)-TARTARIC ACID | 2743-38-6 | |
D-(+)-DIPIVALOYL TARTARIC ACID | 76769-55-6 | |
(S)-2-HYDROXYBUTANOIC ACID | 3347-90-8 | |
(R)-2-HYDROXYBUTANOIC ACID | 20016-85-7 | |
R-(-)-3-HYDROXYQUINUCLIDINE HYDROCHLORIDE | 42437-96-7 | |
S-(+)-3-HYDROXY QUINUCLIDINE | 34583-34-1 | |
D(+)-MALIC ACID | 636-61-3 | |
TRANS-4-METHYLCYCLOHEXANOL | 7731-29-5 | |
(+)-2,3-PINANEDIOL | 18680-27-8 | |
D-SERINE | 312-84-5 | |
D-(-)-TARTARIC ACID | 147-71-7 | |
D-(-)-TARTARIC ACID DIETHYLESTER | 13811-71-7 | |
D-(-)-TARTARIC ACID DIMETHYLESTER | 13171-64-7 | |
L-(+)-TARTARIC ACID DIALLYLAMIDE | 58477-85-3 | |
L-(+)-TARTARIC ACID DIBUTYLESTER | 87-92-3 | |
L-(+)-TARTARIC ACID DIETHYLESTER | 87-91-2 | |
L-(+)-TARTARIC ACID DIISOPROPYLESTER | 2217-15-4 | |
L-(+)-TARTARIC ACID DIMETHYLESTER | 608-68-4 | |
L-(+)-TARTARIC ACID DIPYRROLIDID | 63126-10-3 | |
S-(-)-TETRAHYDROFURAN CARBOXYLIC ACID | 87392-07-2 | |
L-(-)-DI-P-TOLUOYL TARTARIC ACID | 32634-66-5 | |
D-(+)-DI-P-TOLUOYL TARTARIC ACID HYDRATE | 32634-68-7 | |
1-BROMO-3-PHENYLPROPANE | 637-59-2 | |
2-Chloro-2-methylbutane | 594-36-5 | |
5-CHLOROSALICYLALDEHYDE | 635-93-8 | |
CYCLOPENTYLBROMIDE | 137-43-9 | |
CYCLOPENTYLCHLORIDE | 930-28-9 | |
2-PHENYL ETHYL CHLORIDE | 622-24-2 | |
3,5-DIMETHYLISOXAZOLE | 300-87-8 | |
2-FUROYL CHLORIDE | 527-69-5 | |
3-HYDROXYMETHYL-PIPERIDINE | 4606-65-9 | |
4-HYDROXYMETHYL-PIPERIDINE | 6457-49-4 | |
4-HYDROXY-4-PHENYLPIPERIDINE | 40807-61-2 | |
ISONIPECOTIC ACID ETHYL ESTER | 1126-09-6 | |
2-MERCAPTO-1- METHYLIMIDAZOLE | 60-56-0 | |
5-METHYL 7-BROMO 8-HYDROXY QUINOLEINE | 7175-09-9 | |
5-METHYL 8-HYDROXY QUINOLEINE | 5541-67-3 | |
5-(3-CHLOROPROPYL) 3-METHYL ISOXAZOLE | 130800-76-9 | |
4-(1-PYRROLIDINYL)-PIPERIDIN | 5004-07-9 | |
4-PIPERIDINE PROPANOL | 7037-49-2 | |
N-PIPERONYLPIPERAZINE | 32231-06-4 | |
4-PYRIDINE PROPANOL | 2629-72-3 | |
3-QUINUCLIDINONE HYDROCHLORIDE | 1193-65-3 | |
4'-BENZYLOXY PROPIOPHENONE | 4495-66-3 | |
2',4'-DIMETHOXY ACETOPHENONE | 829-20-9 | |
3-METHOXY-PROPIOPHENONE | 37951-49-8 | |
ACETALDEHYDE DIETHYLACETAL (1,1-DIETHOXY ETHANE) | 105-57-7 | |
1-ACETYL NAPHTALENE | 941-98-0 | |
ANISALDEHYDE DIMETHYL ACETAL | 2186-92-7 | |
BENZALDEHYDE DIMETHYL ACETAL | 1125-88-8 | |
BENZETHONIUM CHLORIDE | 121-54-0 | |
6-CHLORO 1-HEXANOL | 2009-83-8 | |
4-CYANO BENZALDEHYDE | 105-07-7 | |
CYCLOHEPTANOL | 502-41-0 | |
1-CYCLOHEXYLNAPHTALENE | 3042-69-1 | |
CYCLOPENTANOL | 96-41-3 | |
CYCLOPENTENE | 142-29-0 | |
DESOXYBENZOIN | 451-40-1 | |
N,N-DIETHYLAMINOETHANETHIOL | 100-38-9 | |
3,5-DIMETHYL 4-HYDROXY BENZONITRILE | 4198-90-7 | |
2,2-DIMETHYLPROPANOIC ACID NITRILE | 630-18-2 | |
N,N-DIMETHYLPROPIONAMIDE | 758-96-3 | |
N-HEPTANOIC ACID NITRILE | 629-08-3 | |
2-HEPTANOL | 543-49-7 | |
4-HYDROXY-3-METHOXYBENZYLALCOHOL | 498-00-0 | |
1-INDANONE | 83-33-0 | |
N-METHOXY-N-METHYLACETAMIDE | 78191-00-1 | |
3-METHOXYBENZYLALCOHOL | 6971-51-3 | |
4-METHOXY BENZONITRILE | 874-90-8 | |
3-METHYL-2-BUTANOL | 598-75-4 | |
2-METHYLCYCLOHEXANOL | 583-59-5 | |
3-METHYLCYCLOHEXANOL | 591-23-1 | |
4-METHYLCYCLOHEXANOL | 589-91-3 | |
2-METHYL 3-TRIFLUOROMETHYL ANILINE (HEMISULFATE) | 54396-44-0 | |
MORIN | 480-16-0 | |
2-NONANOL | 628-99-9 | |
4 - NONYLCYCLOHEXANOL | 4631-96-3 | |
5-NORBORNENE 2-METHYLAMINE | 95-10-3 | |
N-OCTANOIC ACID NITRILE | 124-12-9 | |
3-OCTANOL | 589-98-0 | |
2-OXOBUTANE 1,4-DIOL DIACETATE (OBDA) | 59278-00-1 | |
N-PIPERONYLPIPERAZINE | 32231-06-4 | |
2,4-PENTANEDIOL | 625-69-4 | |
3-PENTEN-2-ONE | 625-33-2 | |
4-PHENYLBUTYRONITRILE | 2046-18-6 | |
3,3',5,5'-TETRAMETHYLBENZIDINE | 54827-17-7 | |
DIETHYL-(E)-2- (CYCLOHEXYLAMINO)- VINYLPHOSPHONATE | 20061-84-1 | |
DIETHYL PHOSPHONO ACETIC ACID | 3095-95-2 | |
DIETHYL DIETHOXYETHYL PHOSPHONATE | 7598-61-0 | |
DIETHYL PHOSPHONOMETHANOL | 3084-40-0 | |
DIETHYL-p-XYLENE-BIS-PHOSPHONATE | 4546-04-7 | |
TERTBUTYLDIETHYL PHOSPHONOACETATE | 27784-76-5 | |
TETRAISOPROPYL METHYLENE DIPHOSPHONATE | 1660-95-3 | |
TOSYLOXYMETHYL DIETHYL PHOSPHONATE | 31618-90-3 | |
TRIETHYL PHOSPHONOACETATE | 867-13-0 | |
TRIETHYL PHOSPHONOFORMATE | 1474-78-8 | |
TRIMETHYL PHOSPHONOACETATE | 5927-18-4 | |
2-ACETYL-4-CHLORO THIOPHENE | 34730-20-6 | |
3-AMINO 4-METHYL THIOPHENE | 23967-97-7 | |
3-AMINO-4-METHYL THIOPHENE CARBOXYLIC ACID, METHYL ESTER | 85006-31-1 | |
5-CHLORO 2-THIOPHENE CARBOXYLIC ACID | 24065-33-6 | |
2,5-DICHLORO 3-ACETYL THIOPHENE | 36157-40-1 | |
2,4-DICHLORO-THIENO[3,2-d]- PYRIMIDINE | 16234-14-3 | |
ETHYL 2-THIENYL GLYOXYLATE | 4075-58-5 | |
3-THIOPHENE CARBOXYLIC ACID | 88-13-1 | |
2-THIOPHENE ETHANOL | 5402-55-1 | |
S-2-AMINO-1-PHENYLETHANOL | 56613-81-1 | |
1,7-DIAMINOHEPTANE | 646-19-5 | |
DIISOPROPYL-D-(-)-TARTRATE | 62961-64-2 | |
N-METHYL-4-PIPERIDINOL | 106-52-5 | |
3-PENTANOL | 584-02-1 | |
3-PHENYLPROPIONIC ACID | 501-52-0 | |
4-(HYDROXYMETHYL)-PYRIDINE | 586-95-8 | |
TRIISONONYLAMINE | 38725-13-2 | |
TRI-N-DECYLAMINE | 1070-01-5 | |
Acid Chlorides Trifluoroacetyl chloride TFAC | 354-32-5 | |
Alkanes 1,1-Dichloro-2,2,2-trifluoroethane (SOLKANE® 123) S123 | 306-83-2 | |
1,1,1,3,3-Pentafluorobutane (SOLKANE® 365mfc) S365mfc | 406-58-6 | |
Amines 2,2,2-Trifluoroethylamine TFEA | 753-90-2 | |
Acids Chlorodifluoroacetic acid CDFA | 76-04-0 | |
Trifluoroacetic acid TFA | 76-05-1 | |
Trifluoromethanesulfonic acid TA | 1493-13-6 | |
Anhydrides Trifluoroacetic acid anhydride TFAH | 407-25-0 | |
Trifluoromethanesulfonic anhydride TAA | 358-23-6 | |
Esters and Acetoacetates Difluoroacetic acid ethyl ester DFAEt | 454-31-9 | |
Trifluoroacetic acid ethyl ester TFAEt | 383-63-1 | |
Trifluoroacetic acid isopropyl ester TFAiP | 400-38-4 | |
Trifluoroacetic acid methyl ester TFAMe | 431-47-0 | |
Ketones 4-Ethoxy-1,1,1-trifluoro-3-buten-2-one ETFBO | 59938-06-6 | |
1,1,1-Trifluoroacetone TFK | 421-50-1 | |
Heterocycles 3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate DFMPA | 176969-34-9 | |
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid TFMPA | 113100-53-1 | |
Solvents for Li-Ion batteries Monofluoroethylene Carbonate F1EC | 114435-02-8 | |
Sodium pyroglutamate | 28874-51-3 | |
L-Pyroglutamic acid | 98-79-3 | |
Palladium on activated carbon | 7440-05-3 | |
Palladium on alumina powder | 7440-05-3 | |
Palladium on calcium carbonate | 7440-05-3 | |
Palladium on titanium silicate | 7440-05-3 | |
Palladium on silica powder | 7440-05-3 | |
Platinum on activated carbon | 7440-06-4 | |
Platinum on alumina powder | 7440-06-4 | |
Platinum on calcium carbonate | 7440-06-4 | |
Platinum on silica powder | 7440-06-4 | |
Rutenium on activated carbon | 7440-18-8 | |
Rhodium on activated carbon | 7440-16-6 | |
(R)-2-(4-hydroxyphenoxy)propanoic acid | 94050-90-5 | |
(S)-2-chloropropionic acid | 29617-66-1 | |
2,2,6,6-tetramethyl-4-oxopiperidinooxy | 2896-70-0 | |
2,2,6,6-tetramethyl-4-substituted-piperidinyl-1-oxy | - | |
2,4-dichlorophenol | 120-83-2 | |
2-(4-chloro-2-methylphenoxy)propionic acid | 7085-19-0 | |
2-chloropropionic acid | 598-78-7 | |
2-n-butyl-benzo[d]isothiazol-3-one | 4299-07-4 | |
4-(tert-butyl)-N-sec-butyl-2,6-dinitroaniline | 33629-47-9 | |
4-chloro-o-cresol | 1570-64-5 | |
4-hydroxy-2,2,6,6-tetramethylpiperidinoxyl | 2226-96-2 | |
4-tert-butyl-2,6-dinitrochlorobenzene | 2213-81-2 | |
Barium selenate | 7787-41-9 | |
Chloroacetic acid | 79-11-8 | |
2-sec-Butyl-4,6-dinitrophenol (Dinoseb) | 88-85-7 | |
(R)-2-(4-chloro-2-methylphenoxy)propionic acid (mecoprop-P (ISO)) | 16484-77-8 | |
Methyl 2-chloropropionate | 17639-93-9 | |
o-cresol | 95-48-7 | |
Dipentamethylene thiuram tetrasulfide | 120-54-7 | |
2-Methyl-1,3-cyclohexanedione | 1193-55-1 | |
2,4-Thiazolidinedione | 2295-31-0 | |
N,N,N',N'-Tetramethylcystamine dihydrochloride | 17339-60-5 | |
1-Octadecanethiol | 2885-00-9 | |
1-Hexadecanethiol | 2917-26-2 | |
Mercaptoacetic acid sodium salt | 367-51-1 | |
3,4 Dimethoxybenzenesulphonyl chloride | 23095-31-0 | |
4-tert-Butylthiophenol | 2396-68-1 | |
1,4-Dimethoxy-2-(2-nitro-1-propenyl)-benzene | 18790-57-3 | |
5-Chlorothiophene-2-sulphonyl chloride | 2766-74-7 | |
3-(3-Hydroxyphenyl)-propionic acid | 621-54-5 | |
Nickel diisobutyldithiocarbamate | 15317-78-9 | |
4-Methylsulphonyl phenyl acetic acid | 90536-66-6 | |
4-(2-Aminoethyl)-aniline | 13472-00-9 | |
2-Benzylaminoethanol | 104-63-2 | |
Mercaptoacetic acid potassium salt | 34452-51-2 | |
1-(Benzylthio)-2-propanone | 10230-69-0 | |
2-Ethyl-1-hexanethiol | 7341-17-5 | |
Sodium ethylxanthate | 140-90-9 | |
4-Aminobenzylamine | 4403-71-8 | |
N-Benzyl-N-methylethanolamine | 101-98-4 | |
3-Mercaptobenzoic acid | 4869-59-4 | |
Tetrabenzylthiuram disulfide | 10591-85-2 | |
DL-m-Tyrosine | 775-06-4 | |
Zinc dibenzyldithiocarbamate | 14726-36-4 | |
4-(2-Mercaptoethyl)-pyridine hydrochloride | 6298-11-9 | |
Sodium dodecyl thiolate | 26960-77-0 | |
N-Benzyl-tert-butylamine | 3378-72-1 | |
Zinc pentamethylenedithiocarbamate | 13878-54-1 | |
Methanesulphonamide | 3144-09-0 | |
3-Cyanobenzylbromide | 28188-41-2 | |
N-Formylpiperidine | 2591-86-8 | |
S-Acetyl-4-(2mercaptoethyl) pyridine | 385398-71-0 | |
Veratrylamine | 5763-61-1 | |
1,3-Cyclohexanedione | 504-02-9 | |
3-Amino-5-(methylthio)-1H-1,2,4-triazole | 45534-08-5 | |
Mercaptoacetic acid calcium salt | 29820-13-1 | |
Mercaptoacetic acid butyl ester | 10047-28-6 | |
Mercaptoacetic acid methyl ester | 2365-48-2 | |
Dipentaerythritol hexakis thioglycolate | 33250-21-4 | |
Potassium dimethyldithiocarbamate | 128-03-0 | |
Bismuth dimethyldithiocarbamate | 21260-46-8 | |
Zinc dibutyldithiocarbamate | 136-23-2 | |
Tetrabutylthiuram disulfide | 1634-02-2 | |
Sodium dibutyldithiocarbamate | 136-30-1 | |
Zinc isopropylxanthate | 1000-90-4 | |
Ferric dimethyldithiocarbamate (Ferbam) | 14484-64-1 | |
Tetramethylthiuram monosulfide | 97-74-5 | |
Diisopropylxanthogen disulfide | 105-65-7 | |
Diethyl xanthogen disulphide | 502-55-6 | |
Sodium isopropylxanthate | 140-93-2 | |
Cystamine dihydrochloride | 56-17-7 | |
N-Methylpiperidine | 626-67-5 | |
4-tert-Butylcyclohexanecarboxylic acid | 5451-55-8/943-29-3 | |
4-(p-Chlorophenyl)-1-cyclohexanecarboxylic acid | 49708-81-8 | |
3-Cyclohexene-1-carboxylic acid methyl ester | 6493-77-2 | |
N,N-Dibenzylamine | 103-49-1 | |
N-Benzylmethylamine | 103-67-3 | |
N-Benzylethylamine | 14321-27-8 | |
Piperidine | 110-89-4 | |
3-(Methylthio)propylamine | 4104-45-4 | |
4-Ethylguaiacol | 2785-89-9 | |
4-Methylguaiacol | 93-51-6 | |
1-Methylpyrazole | 930-36-9 | |
1,3-Propanedithiol | 109-80-8 | |
5-Methylquinoxaline | 13708-12-8 | |
3-Ethoxy-2-cyclohexen-1-one | 5323-87-5 | |
2-Methylpropanimidamide hydrochloride | 22007-68-7 | |
2,2-Dimethylthiopropionamide | 630-22-8 | |
Pyridine-4-carbothioamide | 2196-13-6 | |
4-Hexen-3-one | 2497-21-4 | |
Thiazolidine hydrochloride | 14446-47-0 | |
O-Desmethyl quinine | 524-63-0 | |
3-Butoxycyclohex-2-en-1-one | 16493-04-2 | |
N-Methylthiourea | 598-52-7 | |
Zinc diisononyldithiocarbamate | 84604-96-6 | |
Nickel dibutyldithiocarbamate | 13927-77-0 | |
3-Isobutoxy-2-cyclohexen-1-one | 23074-59-1 | |
2-Methyl-4-propyl-1,3-oxathiane | 67715-80-4 | |
1-Bromo-3,3-dimethylbutane | 1647-23-0 | |
4-Aminohippuric acid | 61-78-9 | |
Cyclopentanecarboxamidine hydrochloride | 81303-69-7 | |
1,4-Cyclohexanediol | 556-48-9 | |
2-(Phenylsulphonyl)-pyridine | 24244-60-8 | |
N-Benzyldiethanolamine | 101-32-6 | |
1,3-Dimethylthiourea | 534-13-4 | |
N,N'-Dimethylthiourea | 534-13-4 | |
Cyclopropanecarbonyl chloride | 4023-34-1 | |
4-Carboxybutyltriphenylphosphonium bromide | 17814-85-6 | |
3,3-bis(Methoxymethyl)-2,5-dimethyl-hexane | 129228-21-3 | |
1-Amino cyclopentyl piperazine | 61379-64-4 | |
1-Heptanethiol | 1639-09-4 | |
2-(Trichloroacetyl)pyrrole | 35302-72-8 | |
2,2'-Sulfonyldiethanol | 2580-77-0 | |
N-Benzylamido malonate | 66825-16-9 | |
2-Piperidin-4-yl-propan-2-ol | 22990-34-7 | |
Carbamic acid, (3-aminophenyl)-, phenylmethyl ester | 113261-00-0 | |
4-Piperidone-benzylcarbamate | 19099-93-5 | |
2-Hydroxethylpiperidine | 1484-84-0 | |
Benzothiophene | 95-15-8 | |
2-(Isopropylsulfonyl)aniline | 76697-50-2 | |
3,3-Dimethyl butyraldehyde | 2987-16-8 | |
Sodium glycinate | 6000-44-8 | |
4-Heptylamine | 16751-59-0 | |
Piperonyloyl chloride | 25054-53-9 | |
2-Methyl-1H-benzimidazole-6-carboxylic acid | 709-19-3 | |
Cyclohexanemethanol, 1-methansulfonate | 14100-97-1 | |
1-Chloro-3,3-dimethylbutane | 2855-08-5 | |
Benzoyl thiourea | 614-23-3 | |
2-Methyl-1,3-benzoxazole-6-amine | 5676-60-8 | |
4-Mercaptobenzoic acid | 1074-36-8 | |
4-Bromo-1,2-phenylenediamine | 1575-37-7 | |
1,3-Cyclohexanediol | 504-01-8 | |
2-Nitro-5-(propylthio)aniline | 57780-75-3 | |
2-Amino-4,6-dimethylpyrimidine | 767-15-7 | |
2,5-Dichlorobenzoxazole | 3621-81-6 | |
N-tert-butyl-2-benzothiazole-sulphenimide | 3741-80-8 | |
Methyl 2-tetrahydrofuroate | 37443-42-8 | |
Pyrrolidine-1-sulfonamide | 4108-88-7 | |
2,4,4'-Trifluorobenzophenone | 70028-88-5 | |
Sodium 1-butanesulfonate | 2386-54-1 | |
2,4-Dibromo-6-nitro aniline | 827-23-6 | |
Methyl sodium phosphorothiate | 23754-87-2 | |
Monomethyl fumerate | 2756-87-8 | |
1-H-Pyrazole-3-carboxilic acid | 1621-91-6 | |
4-Bromoindazole | 186407-74-9 | |
Iodomethyl pivalate | 53064-79-2 | |
4'-Hydroxy-2-chloroacetophenone | 6305-04-0 | |
Cyclohexyl p-toluenesulfonate | 953-91-3 | |
N-Propanol piperidine | 104-58-5 | |
(2-Benzothiazylthio)acetic acid | 6295-57-4 | |
5-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine | 1010120-55-4 | |
4-Methylsulphonylaniline | 5470-49-5 | |
2-Cyano-3,3-bi(methylthio)-2-propenamide | 17823-69-7 | |
Ethyl 4-(dimethylamino)-2-oxobut-3-enoate | 67751-14-8 | |
1,1-Dimethoxy-4-dimethylaminobut-3-en-2-one | 67751-23-9 | |
Ethanone, 1-(1,3-dioxolan-2-yl)- (9CI) | 19358-03-3 | |
1,2-Ethanedithiol | 540-63-6 | |
Methyl 2-chloro-6-methylpyrimidine-4-carboxylate | 89793-11-3 | |
Ethyl 2-chloro-6-methylpyrimidine-4-carboxylate | 265328-14-1 | |
2-Hydroxy-5-methylbenzaldehyde | 613-84-3 | |
2-Hydroxy-3-methylbenzaldehyde | 824-42-0 | |
2-Hydroxy-5-isopropylbenzaldehyde | 68591-07-1 | |
2-Hydroxy-5-tert-butylbenzaldehyde | 2725-53-3 | |
2-Hydroxy-5-tert-amylbenzaldehyde | 63753-16-2 | |
1,1-Dimethoxy-2-propanol | 42919-42-6 | |
Cyclohexanemethylamine | 3218-02-8 | |
Ethyl-4-amino-3-methoxybenzoate | 73368-41-9 | |
2-Methyl-3-nitrobenzoic acid methyl ester | 59382-59-1 | |
1,3-Cyclohexanedicarboxylic acid | 3971-31-1 | |
Pyridin-4-ylethanesulphonic acid | 53054-76-5 | |
2-Oxopropanethioamide | 31787-50-5 | |
1,3-di-isoPropylthiourea | 2986-17-6 | |
Methyl-2-oxocyclopentanecarboxylate | 10472-24-9 | |
Piperidine hydrochloride | 6091-44-7 | |
4-Aminobenzylmethylamine | 38020-69-8 | |
4-Amino-N,N-dimethylbenzylamine | 6406-74-2 | |
Furfuryl alcohol | 98-00-0 | lab scale only |
Piperonyl alcohol | 495-76-1 | lab scale only |
4-Methyl-5-nonanol(-5-nonanone) 9:1 mix alcohol:ketone | 35900-26-6 | lab scale only |
6-Methyl-5-hepten-2-ol | 1569-60-4 | lab scale only |
2,2,4-Trimethyl-1,3-dioxacyclopentane | 1193-11-9 | lab scale only |
2,4-Dimethyl-1,3-dioxolane | 3390-12-3 | lab scale only |
5-Methylfurfural | 620-02-0 | lab scale only |
3-(2-Furyl)-2-methylacrolein | 874-66-8 | lab scale only |
3-(5-Methyl-2-furyl)butanal | 31704-80-0 | lab scale only |
2-Phenyl-2-butenal | 4411-89-6 | lab scale only |
2-Phenyl-2-pentenal | 3491-63-2 | lab scale only |
12-Methyltridecanal 10% in Miglyol | 75853-49-5 | lab scale only |
12-Methyl tridecanal (high grade) | 75853-49-5 | lab scale only |
12-Methyl tridecanal 10% in Triacetin | 75853-49-5 | lab scale only |
1-Tetradecanal | 124-25-4 | lab scale only |
n-Methylpyrrole-2-carboxaldehyde | 1192-58-1 | lab scale only |
5-(Hydroxymethyl)furfural | 67-47-0 | lab scale only |
2,3-Epoxyoctanal | 42134-50-9 | lab scale only |
2,3-Epoxyoctanal (10% in TEC) | 42134-50-9 | lab scale only |
2,3-Epoxydecanal | 1048958-35-5 | lab scale only |
2,3-Epoxydecanal (10% in TEC) | 1048958-35-5 | lab scale only |
8-Methylnonanal | 3085-26-5 | lab scale only |
8-Methylnonanal 10% in Miglyol | 3085-26-5 | lab scale only |
8-Methyldecanal | 127793-88-8 | lab scale only |
8-Methyldecanal 10% in Miglyol | 127793-88-8 | lab scale only |
6-Methyloctanal | 30689-75-9 | lab scale only |
6-Methyloctanal 10% in Miglyol | 30689-75-9 | lab scale only |
6-Methyloctanal (10% in PG) | 30689-75-9 | lab scale only |
2,3-Epoxyheptanal | 58936-30-4 | lab scale only |
2,3-Epoxyheptanal (10% in TEC) | 58936-30-4 | lab scale only |
Ethyl 2-methyl-2-(methylthio)propionate | 49773-24-2 | lab scale only |
Methyl 2-(methylthio)butyrate | 51534-66-8 | lab scale only |
2-(Methylthio)ethanol | 5271-38-5 | lab scale only |
1-(2-Furfurylthio)propanone | 58066-86-7 | lab scale only |
4-(Methylthio)-2-butanone | 34047-39-7 | lab scale only |
3-(Methylthio)hex-1-yl acetate | 51755-85-2 | lab scale only |
(Methylthio)acetone | 14109-72-9 | lab scale only |
Methyl (2-furfurylthio)acetate | 108499-33-8 | lab scale only |
Methyl (methylthio)acetate | 16630-66-3 | lab scale only |
Bis-(methylthio)methane | 1618-26-4 | lab scale only |
5-Methyl-2-(methylthio)furan | 13678-59-6 | lab scale only |
3-(Methylthio)propyl isothiocyanate | 505-79-3 | lab scale only |
4-(Methylthio)butanol | 20582-85-8 | lab scale only |
3-(Methylthio)propyl acetate | 16630-55-0 | lab scale only |
Thioguaiacol | 1073-29-6 | lab scale only |
3-(Methylthio)propanol | 505-10-2 | lab scale only |
Ethyl 3-(furfurylthio)propionate | 94278-27-0 | lab scale only |
Ethyl 2-(methylthio)acetate | 4455-13-4 | lab scale only |
Ethyl 3-(methylthio)butyrate | 233665-96-8 | lab scale only |
3-(Methylthio)hexanal | 38433-74-8 | lab scale only |
3-(Methylthio)propionaldehyde | 3268-49-3 | lab scale only |
3-(Methylthio)hexanol | 51755-66-9 | lab scale only |
Ethyl 3-(methylthio)propionate | 13327-56-5 | lab scale only |
Isoamyl 3-(methylthio)propionate | 93762-35-7 | lab scale only |
4-Methyl-4-(methylthio)pentan-2-one | 23550-40-5 | lab scale only |
3-(Methylthio)butanal | 16630-52-7 | lab scale only |
3-(Methylthio)butanal (10% in Triethyl citrate) | 16630-52-7 | lab scale only |
Methyl 3-(methylthio)propionate | 13532-18-8 | lab scale only |
3-(Methylthio)propyl butyrate | 16630-60-7 | lab scale only |
2-(Methylthio)ethyl acetate | 5862-47-5 | lab scale only |
2-Methyl-3-(methylthio)tetrahydrofuran | - | lab scale only |
2-Methyl-3-(ethylthio)tetrahydrofuran | - | lab scale only |
Methyl 3-(furfurylthio)propionate | 94278-26-9 | lab scale only |
3-(2-Methyl-3-furylthio)butan-2-one | 61295-44-1 | lab scale only |
2-Methyl-3-methylthiofuran | 63012-97-5 | lab scale only |
1-(Methylthio)pentan-3-one; 1-methylsulfanylpentan-3-one | 66735-69-1 | lab scale only |
8-(Methylthio)-p-mentha-3-one | 32637-94-8 | lab scale only |
S-Allyl-L-cysteine | 21593-77-1 | lab scale only |
4-Methylnonanoic acid | 45019-28-1 | lab scale only |
2-(4-Methoxyphenoxy)propionic acid | 13794-15-5 | lab scale only |
Sodium 2-(4-methoxyphenoxy)propionate | 150436-68-3 | lab scale only |
4-Methyloctanoic acid | 54947-74-9 | lab scale only |
4-Ethyloctanoic acid | 16493-80-4 | lab scale only |
2-Methylheptanoic acid | 1188-02-9 | lab scale only |
2-Methylhexanoic acid | 4536-23-6 | lab scale only |
4-Methyl-2-pentenoic acid | 10321-71-8 | lab scale only |
Pyruvic acid | 127-17-3 | lab scale only |
3,5,5-Trimethylcyclohexane-1,2-dione | 4883-60-7 | lab scale only |
3-Methylcyclohexane-1,2-dione | 3008-43-3 | lab scale only |
1,2-Cyclohexanedione | 765-87-7 | lab scale only |
3-Methyl-2,4-nonanedione | 113486-29-6 | lab scale only |
3,5-Dimethyl-1,2-cyclopentanedione | 13494-07-0 | lab scale only |
3,4-Dimethyl-1,2-cyclopentanedione | 13494-06-9 | lab scale only |
4,5-Dimethyl-3-hydroxy-2,5-dihydrofuran-2-one 3% in PG | 28664-35-9 | lab scale only |
5-Ethyl-3-hydroxy-4-methyl-2(5h)-furanone | 698-10-2 | lab scale only |
5-Ethyl-3-hydroxy-4-methyl-2(5h)-furanone (50% in Triacetin) | 698-10-2 | lab scale only |
5-Ethyl-3-hydroxy-4-methyl-2(5h)-furanone (10% in PG) | 698-10-2 | lab scale only |
4-Methoxy-2,5-dimethyl-3(2h)-furanone | 4077-47-8 | lab scale only |
D-p-8-Menthene-1,2-epoxide | 1195-92-2 | lab scale only |
4-Acetoxy-2,5-dimethyl-3(2h)-furanone | 4166-20-5 | lab scale only |
Ethyl 2-ethylacetoacetate | 607-97-6 | lab scale only |
2-Pentyl acetate | 626-38-0 | lab scale only |
2-Pentyl butyrate | 60415-61-4 | lab scale only |
Ethyl 2-acetoxypropionate | 2985-28-6 | lab scale only |
4-Pentenyl acetate | 1576-85-8 | lab scale only |
Ethyl 4-methyloctanoate | 56196-53-3 | lab scale only |
3-Acetoxy-2-butanone | 4906-24-5 | lab scale only |
Methyl 2-methoxybenzoate | 606-45-1 | lab scale only |
Cyclohexyl hexanoate | 6243-10-3 | lab scale only |
Ethyl 2-hydroxy-2-methylbutyrate | 77-70-3 | lab scale only |
Methyl p-tert-butylphenylacetate | 3549-23-3 | lab scale only |
Butan-3-one-2-yl butyrate | 84642-61-5 | lab scale only |
Ethyl cyclohexanecarboxylate | 3289-28-9 | lab scale only |
5-Pentylfuran-2(5h)-one | 21963-26-8 | lab scale only |
3,6-Dimethyl-5,6,7,7-alpha-tetrahydro-2(4h)-benzofuranone | 13341-72-5 | lab scale only |
3,6-Dimethyl-5,6,7,7-alpha-tetrahydro-2(4h)-benzofuranone (1% TEC) | 13341-72-5 | lab scale only |
Maple lactone amyl ether | - | lab scale only |
7-Ethoxy-4-methylcoumarin | 87-05-8 | lab scale only |
2-Acetylfuran | 1192-62-7 | lab scale only |
3-Acetyl-2,5-dimethylfuran | 10599-70-9 | lab scale only |
2-Ethylfuran | 3208-16-0 | lab scale only |
2-Pentylfuran | 3777-69-3 | lab scale only |
2-Propylfuran | 4229-91-8 | lab scale only |
2-Heptylfuran | 3777-71-7 | lab scale only |
2-Acetyl-5-methylfuran | 1193-79-9 | lab scale only |
2-Butylfuran | 4466-24-4 | lab scale only |
2,5-Dimethylfuran | 625-86-5 | lab scale only |
2-Butanoylfuran | 4208-57-5 | lab scale only |
2-Pentanoylfuran | 3194-17-0 | lab scale only |
1-Penten-3-one (10% in Triacetin) | 1629-58-9 | lab scale only |
1-Penten-3-one (10% in Miglyol) | 1629-58-9 | lab scale only |
1-Penten-3-one (10% in PG) | 1629-58-9 | lab scale only |
2-Furyl-2-propanone | 6975-60-6 | lab scale only |
2-Methyltetrahydrofuran-3-one | 3188-00-9 | lab scale only |
Pentyl-2-furyl ketone | 14360-50-0 | lab scale only |
2-Octen-4-one | 4643-27-0 | lab scale only |
5-Methyl-2-hepten-4-one | 81925-81-7 | lab scale only |
1-Octen-3-one (stabilised 0.1% Tocopherol) | 4312-99-6 | lab scale only |
1-Octen-3-one (10% in Triacetin) | 4312-99-6 | lab scale only |
5-Hexen-2-one | 109-49-9 | lab scale only |
1-Hexen-3-one (stabilized 0.5% Methoxy phenol) | 1629-60-3 | lab scale only |
3-Methyl-2-cyclohexenone | 1193-18-6 | lab scale only |
5-Methyl-3-hexen-2-one | 5166-53-0 | lab scale only |
9-Decen-2-one | 35194-30-0 | lab scale only |
Natural borneol | 464-45-9 | lab scale only |
Natural bornyl acetate | 5655-61-8 | lab scale only |
2,4,5-Trimethyl-3-oxazoline | 22694-96-8 | lab scale only |
2,4,5-Trimethyloxazole | 20662-84-4 | lab scale only |
2-Ethyl-4,5-dimethyloxazole | 53833-30-0 | lab scale only |
2-Methyl-4-propyl-1,3-oxathiane (50% in TEC) | 67715-80-4 | lab scale only |
2,4-Dimethyl-6-butyl-1,3-oxathiane | - | lab scale only |
2-Methoxy-4-vinylphenol | 7786-61-0 | lab scale only |
2-Methoxy-4-vinylphenol (10% in PG) | 7786-61-0 | lab scale only |
2-Methoxy-4-vinylphenol (10% in Triacetin) | 7786-61-0 | lab scale only |
2-Methoxy-4-vinylphenol 50% in Triethyl citrate | 7786-61-0 | lab scale only |
4-Allyl-2,6-dimethoxyphenol | 6627-88-9 | lab scale only |
4-Vinylphenol (10% in PG) | 2628-17-3 | lab scale only |
4-Vinylphenol (10% in Triacetin) | 2628-17-3 | lab scale only |
2-(3-Phenylpropyl)pyridine | 2110-18-1 | lab scale only |
2-Hexylpyridine | 1129-69-7 | lab scale only |
3-Ethylpyridine | 536-78-7 | lab scale only |
3-Isobutylpyridine | 14159-61-6 | lab scale only |
2-Pentylpyridine | 2294-76-0 | lab scale only |
2-(2-Methylpropyl)pyridine | 6304-24-1 | lab scale only |
3-Hexylpyridine | 6311-92-8 | lab scale only |
1-(2-Furanylmethyl)-1h-pyrrole | 1438-94-4 | lab scale only |
2-Propionylpyrrole | 1073-26-3 | lab scale only |
2-Acetylpyrrole | 1072-83-9 | lab scale only |
2-Acetylpyrazine | 22047-25-2 | lab scale only |
2,3-Dimethylpyrazine | 5910-89-4 | lab scale only |
2-Ethyl-3-methylpyrazine | 15707-23-0 | lab scale only |
2,3,5-Trimethylpyrazine | 14667-55-1 | lab scale only |
2-Ethyl-3,5(6)-dimethylpyrazine | 55031-15-7 | lab scale only |
5-Methyl-6,7-dihydrocyclopentapyrazine | 23747-48-0 | lab scale only |
2-Methoxy-3(5/6)-methylpyrazine | 68378-13-2 | lab scale only |
2-Methylpyrazine | 109-08-0 | lab scale only |
2-Methylthio-3(5/6)-methylpyrazine | 67952-65-2 | lab scale only |
2-Methyl-3-propylpyrazine | 15986-80-8 | lab scale only |
2,3-Diethyl-5-methylpyrazine | 18138-04-0 | lab scale only |
2,3-Diethylpyrazine | 15707-24-1 | lab scale only |
Cocoa pyrazine base, neat | - | lab scale only |
Cocoa pyrazine base (10% in PG) | - | lab scale only |
2-Acetyl-3-ethylpyrazine | 32974-92-8 | lab scale only |
2-Acetyl-3,5(6)-dimethylpyrazine | 72797-17-2 | lab scale only |
2-Ethylpyrazine | 13925-00-3 | lab scale only |
2-Methoxy-3-sec-butylpyrazine | 24168-70-5 | lab scale only |
2-Isobutyl-3-methoxypyrazine | 24683-00-9 | lab scale only |
2-Ethyl-3-methoxypyrazine | 25680-58-4 | lab scale only |
2-Isopropyl-3-methoxypyrazine | 25773-40-4 | lab scale only |
2,5-Dimethyl pyrazine | 123-32-0 | lab scale only |
2,6-Dimethylpyrazine | 108-50-9 | lab scale only |
2-Ethoxy-3(6)-methylpyrazine | 65504-94-1 | lab scale only |
2(3)-5-Dimethyl-6,7-dihydro-5h-cyclopentapyrazine | 38917-61-2 | lab scale only |
4-Acetyl-2-methylpyrimidine | 67860-38-2 | lab scale only |
2-Methyl quinoxaline | 7251-61-8 | lab scale only |
2,3-Dimethylquinoxaline | 2379-55-7 | lab scale only |
5,6,7,8-Tetrahydroquinoxaline | 34413-35-9 | lab scale only |
Trithioacetone | 828-26-2 | lab scale only |
2-Methyl-1,3-dithiolane | 5616-51-3 | lab scale only |
4-Butyrothiolactone | 1003-10-7 | lab scale only |
Diallyl disulphide | 2179-57-9 | lab scale only |
Diallyl sulphide | 592-88-1 | lab scale only |
Dipropyl disulphide | 629-19-6 | lab scale only |
Dipropyl sulphide | 111-47-7 | lab scale only |
Di-n-amyl sulphide | 872-10-6 | lab scale only |
Di-n-hexyl disulphide | 10496-15-8 | lab scale only |
Bis(2-methyl-3-furyl) disulphide | 28588-75-2 | lab scale only |
Di-isopropyl sulphide | 625-80-9 | lab scale only |
Allyl methyl sulphide | 10152-76-8 | lab scale only |
n-Heptyl methyl sulphide | 20291-61-6 | lab scale only |
Dipropyl trisulphide (technical grade) | 6028-61-1 | lab scale only |
Diallyl polysulphide | 72869-75-1 | lab scale only |
Ethyl methyl sulphide | 624-89-5 | lab scale only |
Dibutyl sulphide | 544-40-1 | lab scale only |
Benzyl methyl sulphide | 766-92-7 | lab scale only |
Onion oil extender | - | lab scale only |
Difurfuryl disulphide | 4437-20-1 | lab scale only |
Diethyl disulphide | 110-81-6 | lab scale only |
Furfuryl methyl sulphide | 1438-91-1 | lab scale only |
Bis(2-methyl-3-tetrahydrofuryl) disulphide | - | lab scale only |
Di-isopropyl disulphide | 4253-89-8 | lab scale only |
Furfuryl isopropyl sulphide | 1883-78-9 | lab scale only |
Dimethyl sulphide "a" grade | 75-18-3 | lab scale only |
Benzyl methyl disulphide | 699-10-5 | lab scale only |
2-Thienyl disulphide | 6911-51-9 | lab scale only |
2,4,6-Trithiaheptane | 6540-86-9 | lab scale only |
Methyl octyl sulphide | 3698-95-1 | lab scale only |
4-((-2-Methyl-3-furyl)thio)-5-nonanone | 61295-50-9 | lab scale only |
Dimethyl disulphide | 624-92-0 | lab scale only |
Dimethyl trisulphide | 3658-80-8 | lab scale only |
Methyl propyl trisulphide | 17619-36-2 | lab scale only |
Methyl furfuryl disulphide | 57500-00-2 | lab scale only |
Difurfuryl monosulphide | 13678-67-6 | lab scale only |
Methyl (2-methyl-3-furyl) disulphide | 65505-17-1 | lab scale only |
Methyl 1-propenyl sulphide | 10152-77-9 | lab scale only |
Di-(1-propenyl) sulphide | 33922-80-4 | lab scale only |
3-[(2-Mercapto-1-methylpropyl)thio]-2-butanol | 54957-02-7 | lab scale only |
Dicyclohexyl disulphide | 2550-40-5 | lab scale only |
Methyl thioacetate | 1534-08-3 | lab scale only |
3-(Acetylthio)hexyl acetate | 136954-25-1 | lab scale only |
Ethyl thiopropionate | 2432-42-0 | lab scale only |
Propyl thioacetate | 2307-10-0 | lab scale only |
Ethyl thioacetate | 625-60-5 | lab scale only |
S-Methyl thiopropionate | 5925-75-7 | lab scale only |
S-Methyl 2-methylthiobutyrate | 42075-45-6 | lab scale only |
S-Isopropyl 3-methylbut-2-enethioate | 34365-79-2 | lab scale only |
Methyl thiobutyrate | 2432-51-1 | lab scale only |
S-Methyl thiohexanoate | 2432-77-1 | lab scale only |
p-Mentha-8-thiol-3-one acetate | 94293-57-9 | lab scale only |
S-Methyl thioisovalerate | 23747-45-7 | lab scale only |
S-Methyl 4-methylpentanethioate | 61122-71-2 | lab scale only |
sec-Butyl thioisovalerate | 2432-91-9 | lab scale only |
Furfuryl thioacetate | 13678-68-7 | lab scale only |
2-Furanmethanethiol formate | 59020-90-5 | lab scale only |
2-Methyltetrahydrofuran-3-thiol acetate | 252736-41-7 | lab scale only |
Furfuryl thiopropionate | 59020-85-8 | lab scale only |
s-Methyl 2-methylpropanethioate | 42075-42-3 | lab scale only |
2-Methyl-3-furanthiol acetate | 55764-25-5 | lab scale only |
2-Methyl-1-butanethiol | 1878-18-8 | lab scale only |
2-Methyl-1-butanethiol | 1878-18-8 | lab scale only |
p-Mentha-8-thiol-3-one (90% grade) | 38462-22-5 | lab scale only |
p-Mentha-8-thiol-3-one | 38462-22-5 | lab scale only |
2-Methyltetrahydrofuran-3-thiol | 57124-87-5 | lab scale only |
2-Methyltetrahydrofuran-3-thiol (1% in PG) | 57124-87-5 | lab scale only |
1-Pentanethiol | 110-66-7 | lab scale only |
3-Mercapto-2-pentanone (stabilised with 0.1% Calcium carbonate) | 67633-97-0 | lab scale only |
3-Mercapto-2-pentanone (10% in PG) | 67633-97-0 | lab scale only |
3-Mercapto-2-pentanone 10 % in Triacetin | 67633-97-0 | lab scale only |
p-1-Menthene-8-thiol | 71159-90-5 | lab scale only |
Grapefruit mercaptan 1.0% in grapefruit terpenes | 71159-90-5 | lab scale only |
Grapefruit compound 0.1% in grapefruit terpenes | 71159-90-5 | lab scale only |
Grapefruit mercaptan 1% in Triethyl citrate | 71159-90-5 | lab scale only |
Grapefruit terpenes | 71159-90-5 | lab scale only |
Grapefruit mercaptan 1.0% in d-Limonene | 71159-90-5 | lab scale only |
Grapefruit mercaptan 10% in Triethyl citrate | 71159-90-5 | lab scale only |
3-Mercapto-2-butanone (stabilised 0.1% in Calcium carbonate) | 40789-98-8 | lab scale only |
3-Mercaptobutan-2-one (10% in Triacetin) stabilised | 40789-98-8 | lab scale only |
3-Mercaptobutan-2-one (10% in Triacetin) | 40789-98-8 | lab scale only |
3-Methyl-2-butanethiol | 2084-18-6 | lab scale only |
o-Thiocresol | 137-06-4 | lab scale only |
1,5-Pentanedithiol | 928-98-3 | lab scale only |
Thiophene-2-thiol | 7774-74-5 | lab scale only |
2,6-Dimethylthiophenol | 118-72-9 | lab scale only |
Furfuryl mercaptan PG acetal | 98-02-2 | lab scale only |
3-Mercapto-3-methylbutyl formate | 50746-10-6 | lab scale only |
Methyl mercaptan (10% in Triethylcitrate) | 74-93-1 | lab scale only |
Methyl mercaptan (10% in Triacetin) | 74-93-1 | lab scale only |
Methyl mercaptan (5% in PG) | 74-93-1 | lab scale only |
Methyl mercaptan (1% in PG) | 74-93-1 | lab scale only |
Methyl mercaptan 1% in Ethanol | 74-93-1 | lab scale only |
Methyl mercaptan 1% in Miglyol | 74-93-1 | lab scale only |
3-Mercapto-1-hexanol | 51755-83-0 | lab scale only |
Furfuryl mercaptan | 98-02-2 | lab scale only |
4-Mercapto-4-methylpentan-2-one | 19872-52-7 | lab scale only |
4-Mercapto-4-methylpentan-2-one (1% in PG) | 19872-52-7 | lab scale only |
4-Mercapto-4-methylpentan-2-one (1ppm in TEC) | 19872-52-7 | lab scale only |
4-Mercapto-4-methylpentan-2-on (1% in TEC) | 19872-52-7 | lab scale only |
2-Mercapto-3-butanol | 37887-04-0 | lab scale only |
2-Methyl-3-furanthiol | 28588-74-1 | lab scale only |
2-Methyl-3-furanthiol (0.1% in PG) | 28588-74-1 | lab scale only |
2-Methyl-3-furanthiol (1% in PG) | 28588-74-1 | lab scale only |
2-Mercaptopropionic acid | 79-42-5 | lab scale only |
1-Mercaptopropanone (dimer) | 55704-78-4 | lab scale only |
2-Pentanethiol | 2084-19-7 | lab scale only |
2-Pentanethiol 10% in Triacetin | 2084-19-7 | lab scale only |
3-Mercaptohexyl acetate | 136954-20-6 | lab scale only |
3-Mercaptohexyl acetate (5% in Triacetin) | 136954-20-6 | lab scale only |
3-Mercaptohexyl butyrate | 136954-21-7 | lab scale only |
4-Methoxy-2-methyl-2-butanethiol | 94087-83-9 | lab scale only |
4-Methoxy-2-methyl-2-butanethiol (1% in TEC) | 94087-83-9 | lab scale only |
4-Methoxy-2-methyl-2-butanethiol (1ppm in DPG) | 94087-83-9 | lab scale only |
4-Methoxy-2-methyl-2-butanethiol (0.1% in PG) | 94087-83-9 | lab scale only |
4-Methoxy-2-methyl-2-butanethiol (0.1% in TEC) | 94087-83-9 | lab scale only |
3-Mercaptohexyl hexanoate | 136954-22-8 | lab scale only |
1,6-Hexanedithiol | 1191-43-1 | lab scale only |
2-Heptanethiol | 628-00-2 | lab scale only |
2-(Methoxy)benzenethiol | 7217-59-6 | lab scale only |
Prenyl mercaptan 1% in Triacetin | 5287-45-6 | lab scale only |
3-Mercapto-3-methyl-1-hexanol | 307964-23-4 | lab scale only |
1,8-Octanedithiol | 1191-62-4 | lab scale only |
Ethyl 2-mercaptopropionate | 19788-49-9 | lab scale only |
3-Mercapto-3-methylbutan-1-ol | 34300-94-2 | lab scale only |
Cyclopentanethiol | 1679-07-8 | lab scale only |
3-Mercapto-2-methylpentanol | 227456-27-1 | lab scale only |
3-Mercaptobutyl acetate | 89534-38-3 | lab scale only |
3-Mercapto-3-methylbutyl acetate | 50746-09-3 | lab scale only |
4-Mercapto-4-methylpentan-2-ol | 31539-84-1 | lab scale only |
4-Mercapto-4-methylpentan-2-ol (1% in TEC) | 31539-84-1 | lab scale only |
Dodecane-1-thiol | 112-55-0 | lab scale only |
3-(Methylthio)propyl mercaptoacetate | 852997-30-9 | lab scale only |
1-Hexanethiol | 111-31-9 | lab scale only |
3-Mercaptothiophene | 7774-73-4 | lab scale only |
Methyl 2-mercaptopropionate | 53907-46-3 | lab scale only |
Propyl 2-mercaptopropionate | 19788-50-2 | lab scale only |
2,3-Butanedithiol | 4532-64-3 | lab scale only |
Pentane-3-thiol | 616-31-9 | lab scale only |
Mercapto-p-menthan-3-one | 29725-66-4 | lab scale only |
2-Ethylthiophene | 872-55-9 | lab scale only |
2,5-Dimethylthiophene | 638-02-8 | lab scale only |
2-Acetyl-5-methylthiophene | 13679-74-8 | lab scale only |
2-Methyl-5-ethylthiophene | 40323-88-4 | lab scale only |
2-Pentylthiophene | 4861-58-9 | lab scale only |
2-n-Butylthiophene | 1455-20-5 | lab scale only |
2-Octylthiophene | 880-36-4 | lab scale only |
2-Hexylthiophene | 18794-77-9 | lab scale only |
2-Butyl-5-methylthiophene | 11510-96-4 | lab scale only |
2-Butyl-5-ethylthiophene | 54411-06-2 | lab scale only |
2-Butanoylthiophene | 5333-83-5 | lab scale only |
2-Methyl-3-ketotetrahydrothiophene | 13679-85-1 | lab scale only |
Tetrahydrothiophen-3-one | 1003-04-9 | lab scale only |
2-Propionyl thiophene | 13679-75-9 | lab scale only |
5-Methylthiophene-2-carboxaldehyde | 13679-70-4 | lab scale only |
2,4-Dimethylthiazole | 541-58-2 | lab scale only |
4,5-Dimethylthiazole | 3581-91-7 | lab scale only |
2-Isopropyl-4-methylthiazole | 15679-13-7 | lab scale only |
4-Methyl-5-vinylthiazole | 1759-28-0 | lab scale only |
5,6-Dihydro-2,4,6-trimethyl-4h-1,3,5-dithiazine | 638-17-5 | lab scale only |
2-Isobutylthiazole | 18640-74-9 | lab scale only |
2-Ethyl-4-methylthiazole | 15679-12-6 | lab scale only |
2,4,5-Trimethylthiazole | 13623-11-5 | lab scale only |
2-sec-Butylthiazole | 18277-27-5 | lab scale only |
4-Methylthiazole | 693-95-8 | lab scale only |
2,4-Dimethyl-5-acetylthiazole | 38205-60-6 | lab scale only |
2-Propionylthiazole | 43039-98-1 | lab scale only |
2-Isobutyl-4,5-dimethylthiazole | 53498-32-1 | lab scale only |
2-Acetylthiazole | 24295-03-2 | lab scale only |
2,4,6-Triethyldihydro-4h-1,3,5-dithiazine | 54717-17-8 | lab scale only |
4,5-Dimethyl-2-ethyl-3-thiazoline | 76788-46-0 | lab scale only |
2-Methyl-2-thiazoline | 2346-00-1 | lab scale only |
2-Isobutyl-4,5-dimethyl-3-thiazoline | 65894-83-9 | lab scale only |
Sulphurol acetate | 656-53-1 | lab scale only |
1,3,5-Tris-t-butylcyclopentadiene | 125735-41 | lab scale only |
1-Methoxy-2-methyl-2-propanol | 3587-64-2 | lab scale only |
2-Methyl-2-octanol | 628-44-4 | lab scale only |
12-Methyltridecanol | 21987-21-3 | lab scale only |
N,N-Dimethylformamide diisopropyl acetal | 18503-89-4 | lab scale only |
2,2-Dimethyl-1,3-dioxolane | 2916-31-6 | lab scale only |
6-Bromo-1,3-benzodioxole-5-carboxaldehyde | 15930-53-7 | lab scale only |
5-tert-Butylsalicylaldehyde | 2725-53-3 | lab scale only |
1,1-Dimethylbenzylamine | 585-32-0 | lab scale only |
1,3-Di-BOC-2-methylisothiourea | 107819-90-9 | lab scale only |
Piperazin-2-one | 5625-67-2 | lab scale only |
Pyridine-2-carboxamidine hydrochloride | 51285-26-8 | lab scale only |
4-Pyridine carboxamidine hydrochloride | 6345-27-3 | lab scale only |
N-Nitrosodiisononylamine | 643014-99-7 | lab scale only |
Pent-4-enylamine | 22537-07-1 | lab scale only |
4-hydroxybenzamidine.hcl | 38148-63-9 | lab scale only |
4-Chloro-1H-indazol-3-amine | 20925-60-4 | lab scale only |
Di-isononylamine | 28454-70-8 | lab scale only |
Thiodiglycolic anhydride | 3261-87-8 | lab scale only |
(Ethylthio)acetic acid | 627-04-3 | lab scale only |
2-(Methylthio)thiophene | 5780-36-9 | lab scale only |
(Methylthio)acetonitrile | 35120-10-6 | lab scale only |
4-(Methylthio)phenol | 1073-72-9 | lab scale only |
(Methylthio) acetic acid | 2444-37-3 | lab scale only |
Bis-(phenylthio)methane | 3561-67-9 | lab scale only |
Methyl thiomethyl acetate | 16437-69-7 | lab scale only |
1,2-Bis(phenylthio)ethane | 622-20-8 | lab scale only |
5-Bromo-2-(methylthio)pyridine | 51933-78-9 | lab scale only |
4-Pentynoic acid | 6089-09-4 | lab scale only |
3-(4-Bromothiophenoxy)propionic acid | 13735-04-1 | lab scale only |
5-Methylisoxazole-3-carboxylic acid | 3405-77-4 | lab scale only |
2-Ethylheptanoic acid | 3274-29-1 | lab scale only |
2,2,6,6-Tetramethyl-3,5-heptanedione | 1118-71-4 | lab scale only |
6-Methylheptane-2,4-dione | 3002-23-1 | lab scale only |
3-(4-Fluorobenzoyl)-1,1,1-trifluoroacetone | 582-65-0 | lab scale only |
(4R,8RS)-Limonene-8,9-epoxide | 28098-67-1 | lab scale only |
Allyl phenyl ether | 1746-13-0 | lab scale only |
2-Propionyl furan | 3194-15-8 | lab scale only |
2-Hexylfuran | 3777-70-6 | lab scale only |
Furfural dimethyl hydrazone | 14064-21-2 | lab scale only |
2-Methyl-1-tetralone | 1590-08-5 | lab scale only |
4-Bromononan-5-one | 42330-11-0 | lab scale only |
3-Bromoheptan-4-one | 42330-10-9 | lab scale only |
Nonanophenone | 6008-36-2 | lab scale only |
Allyl phenyl sulphone | 16212-05-8 | lab scale only |
Ammonium o,o-dimethylphosphorodithioate | 1066-97-3 | lab scale only |
1-Methyl-4-(methylsulphinyl)benzene | 934-72-5 | lab scale only |
L-Rhamnose diethyl mercaptal | 6748-70-5 | lab scale only |
Triethylsulfonium iodide | 1829-92-1 | lab scale only |
N,S-Dimethylisothiouronium hydriodide | 41306-45-0 | lab scale only |
3-(Thiocarbamoyl)dithiocarbazic acid, potassium salt | 73771-62-7 | lab scale only |
3-(Maleimido)propionic acid n-hydroxysuccinimide ester | 55750-62-4 | lab scale only |
Cyclohexyl p-toluenesulphonate | 953-91-3 | lab scale only |
2-(Methylsulphonyl)ethanol | 15205-66-0 | lab scale only |
2-Cyanothioacetamide | 7357-70-2 | lab scale only |
Methylsulphonylacetonitrile | 2274-42-2 | lab scale only |
Tetrahydro-4h-pyran-4-one | 29943-42-8 | lab scale only |
(4-Pyridyl)acetone | 6304-16-1 | lab scale only |
Dimethyl 2,6-pyridinedicarboxylate | 5453-67-8 | lab scale only |
2-Mercaptonicotinic acid | 38521-46-9 | lab scale only |
4-Methylpyrazole | 7554-65-6 | lab scale only |
5-Chloro-1,3-dimethylpyrazole | 54454-10-3 | lab scale only |
2-Mercapto-4-methylpyrimidine hydrochloride | 6959-66-6 | lab scale only |
N,N-Bis (2-chloroethyl)-p-toluenesulphonamide | 42137-88-2 | lab scale only |
1,3,5-Trithiane | 291-21-4 | lab scale only |
2-Methyl-1,3-dithiane | 6007-26-7 | lab scale only |
6-Bromothiochroman-4-one | 13735-13-2 | lab scale only |
2,6-Dithiaheptane | 24949-35-7 | lab scale only |
tert-Butyl methyl sulphide | 6163-64-0 | lab scale only |
Tetrahydrothiopyran-4-one | 1072-72-6 | lab scale only |
Methyl(methylsulphinyl)methyl sulphide | 33577-16-1 | lab scale only |
Pentamethylene sulphide | 1613-51-0 | lab scale only |
Trimethylene sulphide | 287-27-4 | lab scale only |
Di-n-hexyl sulphide | 6294-31-1 | lab scale only |
Di-n-octyl sulfide | 2690-08-6 | lab scale only |
Allyl phenyl sulphide | 5296-64-0 | lab scale only |
Methyl p-tolyl sulfide | 623-13-2 | lab scale only |
3-Chloro-4-dodecyloxybenzenethiol disulphide | - | lab scale only |
Dibutyl sulphoxide | 2168-93-6 | lab scale only |
Bis-(4-fluorophenyl) disulphide | 405-31-2 | lab scale only |
2,2'-Dithiodipyridine | 2127-03-9 | lab scale only |
Bis(phenylacetyl) disulfide | 15088-78-5 | lab scale only |
2-Phenylethanethioamide | 645-54-5 | lab scale only |
2,6-Dichlorobenzenecarbothioamide | 1918-13-4 | lab scale only |
2-(4-Methylphenyl)ethanethioamide | 97426-53-4 | lab scale only |
4-Hydroxythiobenzamide | 25984-63-8 | lab scale only |
2-(3-Chlorophenyl)thioacetamide | 834861-72-2 | lab scale only |
4-Fluoro-thiobenzamide | 22179-72-2 | lab scale only |
Pyridine-2-carbothioamide | 5346-38-3 | lab scale only |
(2-Thiocarbamoylethyl)carbamic acid tert-butyl ester | 77152-97-7 | lab scale only |
Thionicotinamide | 4621-66-3 | lab scale only |
3-(Trifluoromethoxy)benzenecarbothioamide | - | lab scale only |
(5-Chloropyridin-2-yl)thiourea | 31430-27-0 | lab scale only |
(5-Bromo-pyridin-2-yl)thiourea | 31430-38-3 | lab scale only |
(4-Methyl-pyridin-2-yl)thiourea | 21242-21-7 | lab scale only |
(3-Bromo-5-methyl-pyridin-2-yl)thiourea | - | lab scale only |
(5-Methyl-pyridin-2-yl)thiourea | - | lab scale only |
(6-Methyl-pyridin-2-yl)thiourea | 49600-34-2 | lab scale only |
(3,5-Dibromo-pyridin-2-yl)thiourea | 32545-35-4 | lab scale only |
(6-Bromo-pyridin-2-yl)thiourea | 439578-83-3 | lab scale only |
(5-Bromo-6-methyl-pyridin-2-yl)thiourea | 1823232-26-3 | lab scale only |
(6-Chloro-pyridin-2-yl)thiourea | 1310420-68-8 | lab scale only |
(4,6-Dimethyl-pyridin-2-yl)thiourea | 49600-35-3 | lab scale only |
(6-Methoxy-pyridin-3-yl)thiourea | 420130-44-5 | lab scale only |
(6-Chloro-pyridin-3-yl)thiourea | 125117-97-7 | lab scale only |
(6-Bromo-pyridin-3-yl)thiourea | 1415233-80-5 | lab scale only |
(4-Methoxy-6-methyl-pyrimidin-2-yl)thiourea | 93744-72-0 | lab scale only |
Trifluorothioacetic acid s-ethyl ester | 383-64-2 | lab scale only |
4-Methoxybenzylmercaptan | 6258-60-2 | lab scale only |
4-Isopropylthiophenol | 4946-14-9 | lab scale only |
4-(Trifluoromethyl)benzene-1-thiol | 825-83-2 | lab scale only |
2-Bromobenzyl mercaptan | 143888-85-1 | lab scale only |
4-Bromobenzyl mercaptan | 19552-10-4 | lab scale only |
3-Bromobenzyl mercaptan | 886497-84-3 | lab scale only |
4-Methoxybenzenethiol | 696-63-9 | lab scale only |
2,4-Dichlorobenzyl mercaptan | 59293-67-3 | lab scale only |
11-Mercaptoundecanoic acid | 71310-21-9 | lab scale only |
2-Mercaptoethyl sulphide | 3570-55-6 | lab scale only |
3,4-Dichlorobenzyl mercaptan | 36480-40-7 | lab scale only |
1-Nonanethiol | 1455-21-6 | lab scale only |
2-Mercaptothiazole | 82358-09-6 | lab scale only |
1-Decanethiol | 143-10-2 | lab scale only |
4-Fluorobenzylmercaptan | 15894-04-9 | lab scale only |
1,10-Decanedithiol | 1191-67-9 | lab scale only |
3-Mercapto-3-methyl-1-hexanol | 307964-23-4 | lab scale only |
2,3-Dimercaptopropanol | 59-52-9 | lab scale only |
6-Mercaptohexanoic acid | 17689-17-7 | lab scale only |
2,4-Dibromothiophene | 3140-92-9 | lab scale only |
Methyl-3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate | 129332-45-2 | lab scale only |
Ethyl 4-cyano-5-(methylthio)thiophene-2-carboxylate | 116170-84-4 | lab scale only |
2,3-Dimethylthiophene | 632-16-6 | lab scale only |
Methyl 4,5-dibromothiophene-2-carboxylate | 62224-24-2 | lab scale only |
2-(Trimethylsilyl)thiazole | 79265-30-8 | lab scale only |
Thiazolidine | 504-78-9 | lab scale only |
2-Thiazole carboxaldehyde | 10200-59-6 | lab scale only |
2-Chloro-6-fluorobenzothiazole | 399-74-6 | lab scale only |
4-Bromo-2,1,3-benzothiadiazole | 22034-13-5 | lab scale only |
1-(1,3-Benzothiazol-2-yl)-2-bromo-1-ethanone | 54223-20-0 | lab scale only |
n-Propyl bromide (1-bromopropane) | 106-94-5 | |
n-Butyl bromide | 109-65-9 | |
n-Pentyl bromide | 110-53-2 | |
n-Hexyl bromide | 111-25-1 | |
n-Heptyl bromide | 629-04-9 | |
n-Octyl bromide | 111-83-1 | |
n-Nonyl bromide | 693-58-3 | |
n-Decyl bromide (1-bromodecane) | 112-29-8 | |
n-Dodecyl bromide (lauryl bromide) | 143-15-7 | |
n-Tetradecyl bromide (myristyl bromide) | 121-71-0 | |
n-Hexadecyl bromide (cetyl bromide) | 112-82-3 | |
n-Octadecyl bromide (stearyl bromide) | 112-89-0 | |
Isopropyl bromide (2-bromopropane) | 75-26-3 | |
Isobutyl bromide (1-Bromo-2-methyl propane) | 78-77-3 | |
Isoamyl bromide (3-methylbutyl bromide) | 107-82-4 | |
2-Ethyl hexyl bromide | 18908-66-2 | |
Cyclohexyl bromide | 108-85-0 | |
Benzyl bromide | 100-39-0 | |
4-bromobenzyl bromide | 589-15-1 | |
4-bromobenzaldehyde | 1122-91-4 | |
2-bromophenylacetonitrile | 19472-74-3 | |
4-cyanobenzyl bromide | 17201-43-3 | |
4-bromofluorobenzene | 460-00-4 | |
2-bromo-2-phenylacetic acid | 4870-65-9 | |
n-(4-bromobutyl) phthalimide | 5394-18-3 | |
5-bromoindole | 10075-50-0 | |
2-bromoacetic acid | 79-08-3 | |
2-bromopropionic acid | 598-72-1 | |
2-bromobutyric acid | 80-58-0 | |
2-bromopentanoic acid (valeric acid) | 584-93-0 | |
2-bromohexanoic acid | 616-05-7 | |
2,3-dibromosuccinic acid | 526-78-3 | |
3-dimethylaminopropane-1,2-diol | 623-57-4 | |
3-diethylaminopropane-1,2-diol | 621-56-7 | |
n-propyl chloride | 540-54-5 | |
cyclohexyl chloride | 542-18-7 | |
3-chloropropan-2-ol | 96-23-1 | |
ethylene glycol diglycidyl ether | 2224-15-9 | |
guaiacol glycidyl ether | 2210-74-4 | |
Synhydrid (Sodium bis(2-methoxyethoxy)aluminium hydride) | 22722-98-1 | |
Pyridin | 110-86-1 | |
Aluminium Citrate | 31142-56-0 | |
Aluminium Hydroxide dried gel | 21645-51-2 | |
Aluminium Hydroxide Acetate | 142-03-0 | |
Aluminium Lactate | 18917-91-4 | |
Aluminium Sulfate | 10043-01-3(anh.) | |
Ammonium Acetate | 631-61-8 | |
Ammonium Adipate | 3385-41-9 | |
Monoammonium Citrate | 4450-94-6 | |
Diammonium Citrate | 3012-65-5 | |
Triammonium Citrate | 3458-72-8 | |
Ammonium Formate | 540-69-2 | |
Ammonium Formate solution | 540-69-2 | |
Ammonium Lactate solution | 515-98-0 | |
Diammonium Oxalate 1-hydrate | 6009-70-7 | |
Diammonium Tartrate | 3164-29-2 | |
Calamine BP | 8011-96-9 | |
Calamine USP | 8011-96-9 | |
Calcium Acetate | 62-54-4(anh.) | |
Calcium Acetate solution | 62-54-4(anh.) | |
Calcium Bisglycinate | 35947-07-0 | |
Calcium Carbonate DC 97 GA | - | |
Calcium Carbonate DC 90S | - | |
Calcium Carbonate DC 95S | - | |
Calcium Carbonate DC 90M | - | |
Calcium Carbonate DC 95M | - | |
Calcium Carbonate DC 97P | - | |
Calcium Carbonate, heavy | 471-34-1 | |
Calcium Carbonate, light (precipitated) | 471-34-1 | |
Calcium Chloride 2-hydrate | 10035-04-8 | |
Monocalcium Citrate 1-hydrate | 7693-13-2(anh.) | |
Tricalcium Citrate, anhydrous | 813-94-5 | |
Tricalcium Citrate 4-hydrate | 5785-44-4 | |
Tricalcium Citrate 4-hydrate DC 100 | 5785-44-4 | |
Calcium Citrate Malate | 142606-53-9 | |
Calcium Disodium EDTA | 62-33-9 | |
Calcium Formate | 544-17-2 | |
Calcium Fumarate 3-hydrate | 19855-56-2(anh.) | |
Calcium Gluconate 1-hydrate | 299-28-5 | |
Calcium Glycerophosphate | 27214-00-2 | |
Calcium Glycerophosphate solution | 27214-00-2 | |
Calcium Hydroxide | 1305-62-0 | |
Calcium Lactate | 814-80-2(anh.) | |
Calcium Lactate DC 100 | - | |
Calcium Lactate PLUS | 814-80-2 | |
Calcium Lactate Gluconate | 11116-97-5 | |
Calcium Malate | 5743-31-7 | |
Calcium Nitrate 4-hydrate | 13477-34-4 | |
Calcium Nitrate solution | 13477-34-4 | |
Calcium Oxalate 1-hydrate | 563-72-4(anh.) | |
Monocalcium Phosphate 1-hydrate | 7758-23-8(anh.) | |
Calcium Hydrogen Phosphate, anhydrous | 7757-93-9 | |
Calcium Hydrogen Phosphate 2-hydrate | 7789-77-7 | |
Calcium Hydrogen Phosphate 2-hydrate DC 100 | 7789-77-7 | |
Tricalcium Phosphate, light | 12167-74-7 | |
Tricalcium Phosphate, heavy | 12167-74-7 | |
Calcium Phospholactate | - | |
Calcium Propionate | 4075-81-4 | |
Calcium Hydroxide saccharated | 5793-88-4 | |
Calcium Stearate | 1592-23-0 | |
Calcium Tartrate | 3164-34-9(anh.) | |
Chromium(III) Chloride 6-hydrate | 10060-12-5 | |
Chromium(III) Chloride 6-hydrate in Calcium Carbonate 1 % | - | |
Chromium(III) Chloride 6-hydrate in Calcium Carbonate 5 % | - | |
Chromium(III) Chloride 6-hydrate in Calcium Carbonate 10 % | - | |
Chromium(III) Chloride 6-hydrate in Maltodextrin 1 % | - | |
Citric Acid, anhydrous | 77-92-9 | |
Citric Acid 1-hydrate | 5949-29-1 | |
Copper(II) Acetate 1-hydrate | 6046-93-1 | |
Copper(II) Bisglycinate | 13479-54-4 | |
Copper(II) Hydroxide Carbonate | 12069-69-1 | |
Copper(II) Citrate 2.5-hydrate | 866-82-0(anh.) | |
Copper(II) Sodium Citrate | 38218-87-0 | |
Copper(II) Calcium EDTA 2-hydrate | 66317-91-7 | |
Copper(II) Formate 4-hydrate | 544-19-4(anh.) | |
Copper(II) Gluconate | 527-09-3 | |
Copper(II) Gluconate, microencapsulated | - | |
Copper(II) Glycerophosphate | 85187-41-3(anh.) | |
Copper(II) Oxalate | 814-91-5(anh.) | |
Copper(II) Sulfate, basic | 1332-14-5 | |
Copper(II) Sulfate, anhydrous | 7758-98-7 | |
Copper(II) Sulfate 1-hydrate | 10257-54-2 | |
Copper(II) Sulfate 1-hydrate, microencapsulated | - | |
Copper(II) Sulfate 5-hydrate | 7758-99-8 | |
Copper(II) Tartrate | 815-82-7(anh.) | |
Ferric Ammonium Citrate, green | 1185-57-5 | |
Ferric Ammonium Citrate, brown | 1185-57-5 | |
Ferric Ammonium Citrate solution | 1185-57-6 | |
Ferric Ammonium Oxalate 3-hydrate | 13268-42-3 | |
Ferrous Ammonium Sulfate 6-hydrate | 7783-85-9 | |
Ferric Ammonium Sulfate 12-hydrate | 7783-83-7 | |
Ferric Albuminate | 8001-11-4 | |
Ferrous L-Ascorbate | 24808-52-4 | |
Ferrous Bisglycinate | 20150-34-9 | |
Ferrous Carbonate saccharated | 8001-10-3 | |
Ferric Subcarbonate | 1309-37-1(anh.) | |
Ferric Citrate | 3522-50-7(anh.) | |
Ferrous Citrate | 23383-11-1(anh.) | |
Ferric Choline Citrate | 1336-80-7 | |
Ferric Manganese(II) Citrate | - | |
Ferric Sodium Citrate | 52031-09-1 | |
Ferrous Sodium Citrate | - | |
Ferric Sodium EDTA 3-hydrate | 15708-41-5 | |
Ferrous Fumarate | 141-01-5 | |
Ferrous Fumarate DC 90S | - | |
Ferrous Fumarate, microencapsulated (ingredient 60 %) | - | |
Ferrous Fumarate, microencapsulated (ingredient 50 %) | - | |
Ferrous Gluconate 2-hydrate | 299-29-6(anh.) | |
Ferric Glycerophosphate | 1301-70-8(anh.) | |
Ferrous Lactate 2-hydrate | 5905-52-2 | |
Ferrous Lactate 3-hydrate | 5905-52-2 | |
Ferric Sodium Oxalate 3-hydrate | 555-34-0(anh.) | |
Ferrous Oxalate 2-hydrate | 6047-25-2 | |
Ferric Peptonate | - | |
Ferric Phosphate | 10045-86-0(anh.) | |
Ferric Phosphate, soluble with Sodium Citrate | 85338-28-9 | |
Ferrous Phosphate | 14940-41-1 | |
Ferric Polymaltose Complex | - | |
Ferric Pyrophosphate | 10058-44-3(anh.) | |
Ferric Pyrophosphate Micro2 | 10058-44-3(anh.) | |
Ferric Pyrophosphate, soluble with Ammonium Citrate | 85338-23-4 | |
Ferric Pyrophosphate, soluble with Sodium Citrate | 85338-24-5 | |
Ferric Sodium Pyrophosphate | 35725-46-3(anh.) | |
Ferric Saccharate | 8047-67-4 | |
Ferric Saccharate solution | 8047-67-4(anh.) | |
Ferrous Succinate | 10030-90-7 | |
Ferric Sulfate | 10028-22-5 | |
Ferric Sulfate solution | 10028-22-5 | |
Ferrous Sulfate, dried | 13463-43-9 | |
Ferrous Sulfate, dried, microencapsulated | - | |
Ferrous Sulfate, dried Micro2 | - | |
Ferrous Sulfate 7-hydrate | 7782-63-0 | |
Ferric Subsulfate 10-hydrate | 1310-45-8(anh.) | |
Ferric Subsulfate solution | 1310-45-8(anh.) | |
Ferric Tartrate 1-hydrate | 2944-68-5(anh.) | |
Ferrous Tartrate 2.5-hydrate | 2944-65-2(anh.) | |
Glycerophosphoric Acid | 27082-31-1 | |
Potassium Iodate in Calcium Carbonate 1 % | - | |
Potassium Iodate in Tricalcium Phosphate 5 % | - | |
Potassium Iodide in Maltodextrin 1 % | - | |
Potassium Iodide in Sodium Citrate 8.5 % - 11.5 % | - | |
Iron, carbonylic | 7439-89-6 | |
Iron, electrolytic | 7439-89-6 | |
Iron, reduced | 7439-89-6 | |
Lithium Acetate 2-hydrate | 6108-17-4 | |
Trilithium Citrate 4-hydrate | 6080-58-6 | |
Lithium Sulfate | 10377-48-7 | |
LomaSalt® RS 100 | - | |
LomaSalt® RS 50 Classic | - | |
LomaSalt® RS 50 Classic with Iodine | - | |
LomaSalt® RS 50 Extra | - | |
LomaSalt® RS 50 Extra with Sodium Nitrite | - | |
LomaSalt® RS 50 Neutral | - | |
LomaSalt® 2.0 | - | |
Magnesium Acetate, anhydrous | 142-72-3 | |
Magnesium Acetate 4-hydrate | 16674-78-5 | |
Magnesium Acetate solution | 16674-78-5 | |
Magnesium L-Ascorbate 2-hydrate | 15431-40-0 | |
Magnesium Aspartate PLUS | 2068-80-6 | |
Magnesium DL-Hydrogen Aspartate 4-hydrate | 7018-07-7 | |
Magnesium L-Hydrogen Aspartate 2-hydrate | 2068-80-6 | |
Magnesium Bisglycinate | 14783-68-7 | |
Magnesium Carbonate | 12125-28-9/39409-82-0 | |
Magnesium Carbonate DC 90S | - | |
Magnesium Carbonate DC 90S/C | - | |
Magnesium Carbonate DC 90S/F | - | |
Magnesium Chloride 6-hydrate | 7791-18-6 | |
Magnesium Citrate | 7779-25-1(anh.) | |
Magnesium Citrate, acidic | 7779-25-1(anh.) | |
Magnesium Citrate Malate | 1259381-40-2 | |
Magnesium Hydrogen Citrate | 7779-25-1(anh.) | |
Magnesium Potassium Citrate | 137590-34-2 | |
Trimagnesium Dicitrate, anhydrous | 3344-18-1 | |
Trimagnesium Dicitrate, anhydrous DC 100 | 3344-18-1 | |
Trimagnesium Dicitrate, anhydrous DC 95M | - | |
Trimagnesium Dicitrate 9-hydrate | 153531-96-5 | |
Trimagnesium Dicitrate 9-hydrate DC 100 | 153531-96-5 | |
Trimagnesium Dicitrate 9-hydrate DC 95CA | - | |
Trimagnesium Dicitrate 9-hydrate DC 95M | - | |
Trimagnesium Dicitrate 12-hydrate | 3344-18-1(anh.) | |
Magnesium Formate 2-hydrate | 557-39-1(anh.) | |
Magnesium Fumarate 4-hydrate | 7704-71-4(anh.) | |
Magnesium Gluconate | 3632-91-5(anh.) | |
Magnesium L-Glutamate 4-hydrate | 18543-68-5 | |
Magnesium Glycerophosphate | 927-20-8(anh.) | |
Magnesium Glycerophosphate solution | 927-20-8(anh.) | |
Magnesium Hydroxide | 1309-42-8 | |
Magnesium Hydroxide DC 90S | - | |
Magnesium Hydroxide paste | 1309-42-8(anh.) | |
Magnesium Lactate, anhydrous | 18917-93-6(anh.) | |
Magnesium Lactate 2-hydrate | 18917-93-6(anh.) | |
Magnesium Lactate 2-hydrate DC 100 | 18917-93-6(anh.) | |
Magnesium Nitrate solution | 10377-60-3(anh.) | |
Magnesium Oxalate 2-hydrate | 547-66-0(anh.) | |
Magnesium Oxide | 1309-48-4 | |
Magnesium Oxide, microencapsulated | - | |
Magnesium Peroxide | 1335-26-8 | |
Magnesium Hydrogen Phosphate 3-hydrate | 7782-75-4 | |
Trimagnesium Phosphate | 7757-87-1(anh.) | |
Trimagnesium Phosphate 5-hydrate | 7757-87-1(anh.) | |
Trimagnesium Phosphate 8-hydrate | 7757-87-1(anh.) | |
Magnesium Propionate | 557-27-7(anh.) | |
Magnesium Trisilicate | 14987-04-3(anh.) | |
Magnesium Trisilicate DC 90S | - | |
Magnesium Stearate | 557-04-0 | |
Magnesium Sulfate dried | 22189-08-8 | |
Magnesium Sulfate 7-hydrate | 10034-99-8 | |
Magnesium Tartrate 2.5-hydrate | 20752-56-1(anh.) | |
Manganese(II) Carbonate | 598-62-9(anh.) | |
Manganese(II) Citrate, soluble | 85169-06-8 | |
Manganese(II) Gluconate 2-hydrate | 6485-39-8(anh.) | |
Manganese(II) Glycerophosphate | 1320-46-3 | |
Manganese(II) Lactate 3-hydrate | 16039-56-8(anh.) | |
Manganese(II) Phosphate | 14154-09-7(anh.) | |
Manganese(II) Pyrophosphate 5-hydrate | 13446-44-1(anh.) | |
Manganese(II) Sulfate 1-hydrate | 10034-96-5 | |
Manganese(II) Sulfate 1-hydrate, microencapsulated | - | |
Sodium Molybdate 2-hydrate in Calcium Carbonate 1 % | - | |
Sodium Molybdate 2-hydrate in Maltodextrin 1 % | - | |
Potassium Acetate | 127-08-2 | |
Potassium Acetate solution | 127-08-2 | |
Potassium Adipate | 19147-16-1 | |
Potassium DL-Hydrogen Aspartate 0.5-hydrate | 923-09-1(anh.) | |
Potassium L-Aspartate | 1115-63-5 | |
Potassium Benzoate | 582-25-2 | |
Potassium Carbonate | 584-08-7 | |
Potassium Bicarbonate | 298-14-6 | |
Potassium Chloride | 7447-40-7 | |
Monopotassium Citrate, anhydrous | 866-83-1 | |
Dipotassium Citrate | 3609-96-9 | |
Tripotassium Citrate, anhydrous | 866-84-2 | |
Tripotassium Citrate 1-hydrate | 6100-05-6 | |
Potassium Formate | 590-29-4 | |
Potassium Formate solution | 590-29-4 | |
Potassium Gluconate | 299-27-4 | |
Potassium Glycerophosphate solution | 1319-69-3(anh.) | |
Potassium Lactate solution | 996-31-6 | |
Potassium Malate solution | 585-09-1 | |
Dipotassium Oxalate 1-hydrate | 6487-48-5 | |
Monopotassium Phosphate | 7778-77-0 | |
Dipotassium Phosphate | 7758-11-4 | |
Potassium Sulfate | 7778-80-5 | |
Potassium Aluminium Sulfate 12-hydrate | 7784-24-9 | |
Monopotassium Tartrate | 868-14-4 | |
Dipotassium Tartrate 0.5-hydrate | 6100-19-2 | |
Dipotassium Tartrate solution | 6100-19-2 | |
Potassium Sodium Tartrate 4-hydrate | 6381-59-5 | |
Sodium Acetate, anhydrous | 127-09-3 | |
Sodium Acetate 3-hydrate | 6131-90-4 | |
Sodium Acetate solution | 127-09-3 | |
Sodium Diacetate | 126-96-5 | |
Sodium Benzoate | 532-32-1 | |
Sodium Carbonate, anhydrous | 497-19-8 | |
Sodium Carbonate 1-hydrate | 5968-11-6 | |
Sodium Carbonate 10-hydrate | 6132-02-1 | |
Sodium Bicarbonate | 144-55-8 | |
Monosodium Citrate, anhydrous | 18996-35-5 | |
Disodium Citrate 1.5-hydrate | 6132-05-4 | |
Trisodium Citrate, anhydrous | 68-04-2 | |
Trisodium Citrate 2-hydrate | 6132-04-3 | |
Trisodium Citrate 5.5-hydrate | 6858-44-2 | |
Sodium Calcium EDTA | - | |
Sodium Formate | 141-53-7 | |
Monosodium Fumarate | 5873-57-4 | |
Disodium Fumarate | 17013-01-3 | |
Sodium Gluconate | 527-07-1 | |
Sodium Glycerophosphate | 1334-74-3(anh.) | |
Sodium Glycerophosphate solution | 1334-74-3(anh.) | |
Sodium beta-Glycerophosphate 5-hydrate | 13408-09-8 | |
Sodium Lactate solution | 72-17-3 | |
Disodium Oxalate | 62-76-0 | |
Monosodium Phosphate, anhydrous | 7558-80-7 | |
Monosodium Phosphate 2-hydrate | 13472-35-0 | |
Disodium Phosphate, anhydrous | 7558-79-4 | |
Disodium Phosphate 2-hydrate | 10028-24-7 | |
Disodium Phosphate 12-hydrate | 10039-32-4 | |
Sodium Propionate | 137-40-6 | |
Sodium Propionate solution | 137-40-6 | |
Sodium Selenite anhydrous | 10102-18-8 | |
Sodium Selenite in Calcium Carbonate (Selohvita) 0.9 % - 0.99 % | - | |
Sodium Selenite in Calcium Carbonate 0.1 % | - | |
Sodium Selenite in Sodium Citrate 0.85 % - 0.99 % | - | |
Sodium Succinate 6-hydrate | 6106-21-4 | |
Sodium Sulfate, anhydrous | 7757-82-6 | |
Sodium Sulfate 10-hydrate | 7727-73-3 | |
Disodium Tartrate 2-hydrate | 6106-24-7 | |
Monosodium Tartrate, anhydrous | 526-94-3 | |
Monosodium Tartrate 1-hydrate | 526-94-3(anh.) | |
Strontium Acetate | 543-94-2(anh.) | |
Strontium Hydrogen Citrate | 813-97-8 | |
Strontium Lactate | 29870-99-3(anh.) | |
Strontium Oxalate 1-hydrate | 814-95-9(anh.) | |
Tartaric Acid | 87-69-4 | |
Zinc Acetate, anhydrous | 5970-45-6 | |
Zinc Acetate 2-hydrate | 5970-45-6 | |
Zinc L-Ascorbate | 151728-40-4 | |
Zinc DL-Hydrogen Aspartate | - | |
Zinc L-Hydrogen Aspartate | 36393-20-1 | |
Zinc Bisglycinate | 14281-83-5 | |
Zinc Hydroxide Carbonate | 51839-25-9 | |
Zinc Citrate 3-hydrate | 546-46-3(anh.) | |
Zinc Citrate, microencapsulated | - | |
Zinc Gluconate | 4468-02-4(anh.) | |
Zinc Glycerophosphate | 1300-26-1 | |
Zinc Lactate 2-hydrate | 16039-53-5(anh.) | |
Zinc Lactate 3-hydrate | 16039-53-5(anh.) | |
Zinc Oxalate 2-hydrate | 547-68-2(anh.) | |
Zinc Oxide | 1314-13-2 | |
Zinc Oxide, microencapsulated | - | |
Zinc Peroxide | 1314-22-3 | |
Zinc Pyrophosphate | 7446-26-6(anh.) | |
Zinc Stearate | 557-05-1 | |
Zinc Sulfate 1-hydrate | 7446-19-7 | |
Zinc Sulfate 1-hydrate DC 100 | 7446-19-7 | |
Zinc Sulfate 7-hydrate | 7446-20-0 | |
1,3-Propanediol-di-p-tosylate | 5469-66-9 | |
1-Phenyl-1-cyclopentanecarboxylic acid | 77-55-4 | |
1-Diazo-2-naphthol-4-sulfonic acid | 887-76-3 | |
1-Aminopyridinium iodide | 6295-87-0 | |
2-Iodophenol | 533-58-4 | |
2-Acetylthiophene | 88-15-3 | |
2-Acetamidophenol | 614-80-2 | |
2-Nitrothiophene | 609-40-5 | |
2-Iodothiophene | 3437-95-4 | |
2,2,2-Triphenylacetophenone | 466-37-5 | |
2-Iodobenzoic acid | 88-67-5 | |
Ethyl n-diphenylmethylene glycinate | 69555-14-2 | |
2,4-Dimethylpyrrole | 625-82-1 | |
2,6-Diamino toluene | 823-40-5 | |
2-Amino-4-chlorobenzonitrile | 38487-86-4 | |
2-(4-Chloro-3-nitrobenzoyl) benzoic acid | 85-54-1 | |
2,6-Dichloroisonicotinic acid (2,6-Dichloropyridine-4-carboxylic acid) | 5398-44-7 | |
Homophthalic Acid | 89-51-0 | |
Pentaerythritol tetrabenzoate | 4196-86-5 | |
5-Ethyl pyridine-2-ethanol | 5223-06-3 | |
Anthranilamide | 88-68-6 | |
Alpha-d-glucofuranose,1,2-0-(2,2,2-trichloroethylidene)-,(r) | 15879-93-3 | |
Camphorquinone | 10373-78-1 | |
1,1-Diphenylacetone | 781-35-1 | |
6-Nitro-7-chloro-4-hydroxy quinazoline | 53449-14-2 | |
3-Chlorobenzonitrile | 766-84-7 | |
4-Aminoaceatnilide | 122-80-5 | |
3-Bromo-2-(bromomethyl) propionic acid | 41459-42-1 | |
3-Methyl-1-phenyl-2-pyrazolin-5-one | 89-25-8 | |
3,4-Dimethyl benzophenone | 2571-39-3 | |
3,5-Dinitroaniline | 618-87-1 | |
3,5-Dinitrosalicylic acid | 609-99-4 | |
3-Bromoacetylpyridine HBr | 17694-68-7 | |
3-Iodoaniline | 626-01-7 | |
4-Methoxybenzylamine | 2393-23-9 | |
4-(Dimethylamino) benzaldehyde | 100-10-7 | |
4-Benzoylbutyric acid | 1501-05-9 | |
4,4-Methylenebis (2,6-dimethylaniline) | 4073-98-7 | |
4-Aminobenzoic acid | 150-13-0 | |
4-Acetylbenzonitrile | 1443-80-7 | |
4-(2-Chloroethyl) morpholine HCl | 3647-69-6 | |
4-Chloro-2-nitro benzonitrile | 34662-32-3 | |
4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide (TFMSAA) | 654-62-6 | |
Benzoic Hydrazide | 613-94-5 | |
Benzophenoneimine | 1013-88-3 | |
Cyano acetic acid | 372-09-8 | |
Diphenyl Diselenide | 1666-13-3 | |
Diphenic Acid (Biphenyl-2,2'dicarboxylic Acid) | 482-05-3 | |
Diphenylamine | 122-39-4 | |
4-Iodoaniline | 540-37-4 | |
Methyl 4-(bromomethyl) benzoate | 2417-72-3 | |
n-Heptylamine | 111-68-2 | |
Pyridinium p-toluenesulfonate | 24057-28-1 | |
Pentaerythrityl Tetraacetate | 597-71-7 | |
Propyl Gallate | 121-79-9 | |
Rhodanine | 141-84-4 | |
Sodium Nitroprusside | 13755-38-9 | |
Sulphapyridine | 144-83-2 | |
Fmoc-b-Ala-OH | 35737-10-1 | |
Fmoc-L-Ala-OH | 35661-39-3 | |
Fmoc-D-Arg(Pbf)-OH | 187618-60-6 | |
Fmoc-L-Arg(Pbf)-OH | 154445-77-9 | |
Fmoc-L-Asn(Trt)-OH | 132388-59-1 | |
Fmoc-L-Asp(OtBu)-OH | 71989-14-5 | |
Fmoc-L-Cys(Trt)-OH | 103213-32-7 | |
Fmoc-L-Cys(Acm)-OH | 86060-81-3 | |
Fmoc-D-Cys(Trt)-OH | 167015-11-4 | |
Fmoc-L-Gln(Trt)-OH | 132327-80-1 | |
Fmoc-L-Glu(OtBu)-OH | 71989-18-9 | |
H-L-Glu-OtBu | 45120-30-7 | |
Fmoc-Gly-OH | 29022-11-5 | |
Fmoc-L-Har(Et)2-OH | 1386327-04-3 | |
Fmoc-D-Har(Et)2-OH | 1386327-10-1 | |
Boc-L-His(Trt)-OH | 32926-43-5 | |
Fmoc-L-His(Trt)-OH | 109423-51-6 | |
Fmoc-L-Ile-OH | 71989-23-6 | |
Fmoc-D-Leu-OH | 114360-54-2 | |
Fmoc-L-Lys(Boc)-OH | 71989-26-9 | |
Fmoc-D-Lys(Boc)-OH | 92122-45-7 | |
Fmoc-L-Met-OH | 71989-28-1 | |
Fmoc-L-Nle-OH | 77284-32-3 | |
Boc-D-Phe-OH | 18942-49-9 | |
Fmoc-D-Phe-OH | 86123-10-6 | |
Fmoc-L-Phe-OH | 35661-10-6 | |
Fmoc-L-Thr(tBu)-OH * | 71989-35-0 | |
Fmoc-L-Thr(tBu)-ol | 189337-28-8 | |
H-L-Thr(OtBu)-OtBu.HOAc | 5854-77-3 | |
Fmoc-D-Trp(Boc)-OH | 163619-04-3 | |
Fmoc-L-Trp(Boc)-OH* | 143824-78-6 | |
Fmoc-L-Tyr(tBu)-OH | 71989-38-3 | |
Fmoc-L-Val-OH | 6885-20-8 | |
Boc-L-HomoPhe-OH | 100564-78-1 | |
Boc-L-Leu-OH | 13139-15-6 | |
H-L-Leu-OtBu * HCl | 2748-02-9 | |
Fmoc-Gly-Thr{(psi,Me,Me)pro}-OH | 1262308-49-5 | |
Fmoc-Thr(tBu)-Ser{(psi,Me,Me)pro}-OH | 1425938-63-1 | |
Fmoc-Tyr(tBu)-Ser{(psi,Me,Me)pro}-OH | 878797-09-2 | |
Fmoc-Asp(OtBu)-Ser{(psi,Me,Me)pro}-OH | 955048-92-7 | |
Fmoc-Phe-Thr{(psi,Me,Me)pro}-OH | 1196703-48-6 | |
Fmoc-Val-Ser{(psi,Me,Me)pro}-OH | 186023-49-4 | |
Fmoc-Ser(tBu)-Ser{(psi,Me,Me)pro}-OH | 1000164-43-1 | |
Fmoc-Arg(Pbf)-Pro-OH | - | |
Fmoc-His(Trt)-Ser(tBu)-Gln(Trt)-Gly-OH | - | |
Boc-His(Boc)-Ser(tBu)-Gln(Trt)-Gly-OH | - | |
Boc-Ser(Ala-Fmoc)-OH | 944283-07-2 | |
Boc-Ser(Ile-Fmoc)-OH | 944283-10-7 | |
Boc-Ser(Leu-Fmoc)-OH | 944283-09-4 | |
Boc-Ser(Val-Fmoc)-OH | 944283-08-3 | |
Boc-Thr(Ala-Fmoc)-OH | 909115-21-5 | |
Boc-Thr(Gly-Fmoc)-OH | 944283-25-4 | |
Boc-Thr(Leu-Fmoc)-OH | 944283-26-5 | |
Boc-Thr(Val-Fmoc)-OH | 887707-95-1 | |
Boc-Thr(Ile-Fmoc)-OH | 944283-27-6 | |
Fmoc-L-Lys(Boc)(iPr)-OH | 201003-48-7 | |
Fmoc-L-Leu-OH | 35661-60-0 | |
Fmoc-L-Pro-OH * H2O | 71989-31-6 | |
Fmoc-L-Ser(tBu)-OH | 71989-33-8 | |
Fmoc-D-Ala-OH | 79990-15-1 | |
Fmoc-D-Nal-OH | 138774-94-4 | |
Fmoc-D-Phe(4-Cl)-OH | 142994-19-2 | |
Fmoc-D-Aph(Cbm)-OH | 324017-22-3 | |
Fmoc-D-Pal-OH | 142994-45-4 | |
Fmoc-Phe(NO2)-OH | 95753-55-2 | |
Fmoc-Hyp(tBu)-OH | 122996-47-8 | |
Fmoc-Thi-OH | 130309-35-2 | |
Fmoc-D-Tic-OH | 130309-33-0 | |
Fmoc-L-Oic-OH | 130309-37-4 | |
Fmoc-Aib-OH | 94744-50-0 | |
Fmoc-Gly-Gly-OH | 35665-38-4 | |
Fmoc-(Tmb)Gly-OH | 166881-43-2 | |
Fmoc-(Dmb)Gly-OH | 166881-42-1 | |
Fmoc-Lys-(Pal-Glu-OtBu)-OH | 1491158-62-3 | |
Fmoc-Lys(Mmt)-OH | 167393-62-6 | |
Pal-Glu(OH)-OtBu | 536721-25-2 | |
Ac-D-Nal-OH | 37440-01-0 | |
L-Dihydroorotic acid | 5988-19-2 | |
Boc-Pyr-OH | 53100-44-0 | |
BOP reagent, 99% min∙ | 56602-33-6 | |
BOP-Cl | 68641-49-6 | |
CDI | 530-62-1 | |
Cl-HOBt | 26198-19-6 | |
DCC | 538-75-0 | |
DEPBT | 165534-43-0 | |
DIC | 693-13-0 | |
EDC•HCl | 25952-53-8 | |
HATU | 148893-10-1 | |
HBTU | 94790-37-1 | |
HCTU | 330645-87-9 | |
HOAt | 39968-33-7 | |
HOBt (anhydrous) | 2592-95-2 | |
HOBt (hydrate) | - | |
HOOBt | 28230-32-2 | |
PyAOP | 156311-83-0 | |
PyBOP | 128625-52-5 | |
PyBrOP | 132705-51-2 | |
TATU | - | |
TBTU | 125700-67-6 | |
TCFH | 94790-35-9 | |
TDBTU | 125700-69-8 | |
TOTU | 136849-72-4 | |
TPTU | 125700-71-2 | |
TSTU | 105832-38-0 | |
9-Fluorenylmethanol | 24324-17-2 | |
Boc Anhydride | 24424-99-5 | |
Boc-ON | 58632-95-4 | |
CBZ-Cl (Z-Cl) | 501-53-1 | |
CBZ-OSu (Z-OSu) | 13139-17-8 | |
DMT-Cl | 40615-36-9 | |
DSC | 74124-79-1 | |
Fmoc-Cl | 28920-43-6 | |
Fmoc-NH2 | 84418-43-9 | |
Fmoc-OSu | 82911-69-1 | |
Trityl Chloride | 76-83-5 | |
Z(2-Br)-OSu | 128611-93-8 | |
5-Ethyltio-1H-Tetrazole | 89797-68-2 | |
AMC | 26093-31-2 | |
D-Biotin | 58-85-5 | |
DBU | 6674-22-2 | |
Diethyl Acetamidomalonate | 1068-90-2 | |
DMAP | 1122-58-3 | |
HOSu | 6066-82-6 | |
Tetrazole | 288-94-8 | |
Trifluoro Ethanol | 75-89-8 | |
Ac-Ala-OH | 97-69-8 | |
Ac-β-Ala-OH∙DCHA | - | |
H-Ala-OBzl∙TosOH | 42854-62-6 | |
H-Ala-OH | 56-41-7 | |
H-Ala-OiPr∙HCl | 39825-33-7 | |
H-Ala-OMe•HCl | 2491-20-5 | |
H-Ala-OtBu•HCl | 13404-22-3 | |
H-Ala-pNA·HCl | 31796-55-1 | |
H-ß-Ala-OEt•HCl | 4244-84-2 | |
H-ß-Ala-OH | 107-95-9 | |
Ac-Arg-OH∙2H2O | 155-84-0 | |
Bz-Arg-OEt•HCl (BAEEt•HCl) | 2645-08-1 | |
Bz-Arg-OH | 154-92-7 | |
H-Arg(Mtr)-OH•1/2H2O | 80745-10-4 | |
H-Arg(NO2)-OH | 2149-70-4 | |
H-Arg(NO2)-OMe•HCl | 51298-62-5 | |
H-Arg(Pbf)-OH | 200115-86-2 | |
H-Arg(Tos)-OH | 4353-32-6 | |
H-Arg-NH2∙2HCl | 14975-30-5 | |
H-Arg-OEt·2HCl | 36589-29-4 | |
H-Arg-OH∙HCl | 627-75-8 | |
H-Arg-OMe·2HCl | 26340-89-6 | |
H-Arg-OtBu·2HCl | 87459-72-1 | |
H-Arg-pNA·2HCl | 40127-11-5 | |
Tos-Arg-OH | 1159-15-5 | |
Tos-Arg-OMe•HCl | 1784-03-8 | |
H-Asn(Trt)-OH | 132388-58-0 | |
H-Asn-OH | 70-47-3 | |
H-Asn-OMe•HCl | 57461-34-4 | |
H-Asn-OtBu | 25456-86-4 | |
Ac-Asp(OtBu)-OH | 117833-18-8 | |
Ac-Asp-OtBu | - | |
H-Asp(Bzl)-OBzl·HCl | - | |
H-Asp(OBzl)-OBzl•TosOH | 2886-33-1 | |
H-Asp(OBzl)-OH | 2177-63-1 | |
H-Asp(OcHex)-OH | 112259-66-2 | |
H-Asp(OEt)-OEt∙HCl | 16115-68-7 | |
H-Asp(OMe)-OH•HCl | 16856-13-6 | |
H-Asp(OMe)-OMe•HCl | 32213-95-9 | |
H-Asp(OtBu)-OH | 3057-74-7 | |
H-Asp(OtBu)-OMe·HCl | 673-19-0 | |
H-Asp(OtBu)-OtBu·HCl | 1791-13-5 | |
H-Asp-OBzl | 7362-93-8 | |
H-Asp-OBzl∙HCl | - | |
H-Asp-OMe | 17812-32-7 | |
H-Asp-OtBu | - | |
H-Val-pNA | 52084-13-6 | |
(H-Cys-OMe)2·2HCl | 32854-09-4 | |
H-Cys(Acm)-NH2·HCl | - | |
H-Cys(Acm)-OH· H2O | - | |
H-Cys(Acm)-OH·HCl | 28798-28-9 | |
H-Cys(Bzl)-OH | 3054-01-1 | |
H-Cys(Bzl)-OMe·HCl | 16741-80-3 | |
H-Cys(Me)-OH | 1187-84-4 | |
H-Cys(pMeOBzl)-OH | 2544-31-2 | |
H-Cys(tBu)-OH•HCl | 2481-09-6 | |
H-Cys(Trt)-NH2 | 166737-85-5 | |
H-Cys(Trt)-OH | 2799-07-7 | |
H-Cys(Z)-OH•HCl | - | |
H-Cys-OEt·HCl | 868-59-7 | |
H-Cys-OMe∙HCl | 18598-63-5 | |
(H-Cys-OH)2 | 56-89-3 | |
H-Gln(Trt)-OH | 102747-84-2 | |
H-Gln-OtBu•HCl | 39741-62-3 | |
H-Gln-pNA | - | |
Ac-Glu(OtBu)-OH | 84192-88-1 | |
Bz-Glu-OH | 6094-36-6 | |
H-Glu(OBzl)-OBzl∙HCl | 4561-10-8 | |
H-Glu(OBzl)-OBzl•TosOH | 2791-84-6 | |
H-Glu(OBzl)-OH | 1676-73-9 | |
H-Glu(OBzl)-OH·HCl | - | |
H-Glu(OcHex)-OBzl•HCl | - | |
H-Glu(OcHex)-OH | 112471-82-6 | |
H-Glu(OEt)-OEt·HCl | 1118-89-4 | |
H-Glu(OEt)-OH | 1119-33-1 | |
H-Glu(OMe)-OH | 1499-55-4 | |
H-Glu(OMe)-OMe•HCl | 23150-65-4 | |
H-Glu(OtBu)-OBzl∙HCl | - | |
H-Glu(OtBu)-OH | 2419-56-9 | |
H-Glu(OtBu)-OtBu•HCl | 32677-01-3 | |
H-Glu-OBzl | 13030-09-6 | |
H-Glu-OMe | 6384-08-3 | |
H-Glu-OtBu | - | |
H-Glu-pNA | 24032-35-7 | |
H-Glu(OtBu)-OMe·HCl | 6234-01-1 | |
Ac-Gly-OEt | 1906-82-7 | |
Ac-Gly-OH | 543-24-8 | |
Bz-Gly-OH·HCl | 7689-50-1 | |
H-Gly-NH2·HCl | 1668-10-6 | |
H-Gly-OBzl•HCl | 1738-68-7 | |
H-Gly-OBzl•TosOH | 1738-76-7 | |
H-Gly-OEt·HCl | 623-33-6 | |
H-Gly-OMe•HCl | 5680-79-5 | |
H-Gly-OtBu•HCl | 27532-96-3 | |
Ac-His(Trt)-OH | - | |
Ac-His-OH·H2O | 39145-52-3 | |
H-His(Nτ-Me)-OMe·2HCl | 57519-09-2 | |
H-His(Trt)-OH | - | |
H-His(Trt)-OMe·HCl | - | |
H-His-NH2∙2HCl | 71666-95-0 | |
H-His-OMe•2HCl | 7389-87-9 | |
Nτ-Methyl-His-OH | 332-80-9 | |
H-Ile-NH2•HCl | 10466-56-5 | |
H-Ile-OAll•TosOH | 88224-05-9 | |
H-Ile-OEt∙HCl | 15366-32-3 | |
H-Ile-OMe•HCl | 18598-74-8 | |
H-Ile-OtBu•HCl | 69320-89-4 | |
Ac-Leu-OH | 1188-21-2 | |
H-Leu-CMK∙HCl | 54518-92-2 | |
H-Leu-OAll∙TosOH | 88224-03-7 | |
H-Leu-OBzl•TosOH | 1738-77-8 | |
H-Leu-OH | 61-90-5 | |
H-Leu-OMe•HCl | 7517-19-3 | |
H-Leu-OtBu•HCl | 2748-02-9 | |
H-Leu-pNA·HCl | 4178-93-2 | |
Aloc-Lys(Fmoc)-OH | - | |
H-Lys(Ac)-OH∙HCl | - | |
H-Lys(Boc)-OH | 2418-95-3 | |
H-Lys(Boc)-OMe•HCl | 2389-48-2 | |
H-Lys(Boc)-OtBu∙HCl | - | |
H-Lys(Fmoc)-OH | 84624-28-2 | |
H-Lys(Tfa)-OH | 10009-20-8 | |
H-Lys(Z)-NH2∙HCl | - | |
H-Lys(Z)-OBzl•HCl | 6366-70-7 | |
H-Lys(Z)-OBzl•TosOH | - | |
H-Lys(Z)-OH | 1155-64-2 | |
H-Lys(Z)-OMe·HCl | 27894-50-4 | |
H-Lys-OEt •2HCl | 3844-53-9 | |
H-Lys-OH·2HCl | 657-26-1 | |
H-Lys-OH•HCl | 657-27-2 | |
H-Lys-OMe •2HCl | 26348-70-9 | |
Ac-Met-OH | 65-82-7 | |
For-Met-OH | 4289-98-9 | |
H-Met-NH2 | 4510-08-1 | |
H-Met-OAll∙TosOH | - | |
H-Met-OH | 63-68-3 | |
H-Met-OiPr·HCl | - | |
H-Met-OMe• HCl | 2491-18-1 | |
H-Met-OtBu·HCl | 91183-71-0 | |
H-Orn(2-Cl-Z)-OH | 118553-99-4 | |
H-Orn(Z)-OH | 3304-51-6 | |
H-Orn-OH• HCl | 3184-13-2 | |
H-Orn-OMe·2HCl | 40216-82-8 | |
Ac-Phe-OH | 2018-61-3 | |
H-Phe-NH2 | 5241-58-7 | |
H-Phe-NH2·HCl | - | |
H-Phe-NHNH2 | - | |
H-Phe-OBzl•HCl | 2462-32-0 | |
H-Phe-OEt∙HCl | 3182-93-2 | |
H-Phe-OH | 63-91-2 | |
H-Phe-OMe•HCl | 7524-50-7 | |
H-Phe-OtBu•HCl | 15100-75-1 | |
H-Phe-pNA | 2360-97-6 | |
N-Phthaloyl-Phe-OH | 5123-55-7 | |
Ac-Pro-OH | 68-95-1 | |
H-Pro-NH2 | 7531-52-4 | |
H-Pro-NMe2 | 29802-22-0 | |
H-Pro-OBzl•HCl | 16652-71-4 | |
H-Pro-OH | 147-85-3 | |
H-Pro-OMe•HCl | 2133-40-6 | |
H-Pro-OtBu | 2812-46-6 | |
H-Ser(Bzl)-OH | 4726-96-9 | |
H-Ser(Bzl)-OH∙HCl | - | |
H-Ser(Bzl)-OMe·HCl | - | |
H-Ser(tBu)-OBzl∙HCl | - | |
H-Ser(tBu)-OH | 18822-58-7 | |
H-Ser(tBu)-OMe•HCl | 17114-97-5 | |
H-Ser-OBzl·HCl | 60022-62-0 | |
H-Ser-OMe•HCl | 5680-80-8 | |
H-Ser-OtBu·HCl | - | |
H-Thr(Bzl)-OBzl∙oxalate | 15260-11-4 | |
H-Thr(Bzl)-OBzl·HCl | - | |
H-Thr(Me)-OH | - | |
H-Thr(tBu)-OH | 4378-13-6 | |
H-Thr(tBu)-OMe∙HCl | 71989-43-0 | |
H-Thr-OBzl | - | |
H-Thr-OBzl·oxalate | 201274-07-9 | |
H-Thr-OMe | - | |
H-Thr-OMe•HCl | 39994-75-7 | |
Trt-Thr-OH•DEA | - | |
Ac-Trp-OEt | 2382-80-1 | |
Ac-Trp-OH | 1218-34-4 | |
H-Trp(Boc)-OH | 146645-63-8 | |
H-Trp-NH2·HCl | 5022-65-1 | |
H-Trp-OBzl∙HCl | 35858-81-2 | |
H-Trp-OMe•HCl | 7524-52-9 | |
H-D-Trp-OEt•HCl | - | |
Ac-Tyr-OEt·H2O | 36546-50-6 | |
Bz-Tyr-OEt | 3483-82-7 | |
H-Tyr(Bzl)-OBzl•HCl | 52142-01-5 | |
H-Tyr(Bzl)-OH | 16652-64-5 | |
H-Tyr(Bzl)-OMe | - | |
H-Tyr(Bzl)-OMe•HCl | 34805-17-9 | |
H-Tyr(tBu)-OH | 18822-59-8 | |
H-Tyr(Tos)-OH | - | |
H-Tyr-OBzl•TosOH | 53587-11-4 | |
H-Tyr-OEt•HCl | 4089-07-0 | |
H-Tyr-OMe | 1080-06-4 | |
H-Tyr-OMe•HCl | 3417-91-2 | |
H-Tyr-OtBu | 16874-12-7 | |
H-Tyr-pNA | - | |
H-Val-NH2·HCl | 3014-80-0 | |
H-Val-OBzl·TosOH | 16652-76-9 | |
H-Val-OEt·HCl | 17609-47-1 | |
H-Val-OMe·HCl | 6306-52-1 | |
H-Val-OtBu·HCl | 13518-40-6 | |
H-DL-Ala-OMe∙HCl | 13515-97-4 | |
H-DL-Asp(OMe)-OMe·HCl | 14358-33-9 | |
H-DL-Asp-OMe | - | |
H-DL-Pro-NH2 | 115630-49-4 | |
H-DL-Pro-OH | 609-36-9 | |
H-DL-Ser-OMe·HCl | 5619-04-5 | |
H-DL-Ser-OtBu·HCl | - | |
H-DL-Trp-NH2 | - | |
Formyl-DL-Trp-OH | 16108-03-5 | |
H-DL-Val-OMe·HCl | - | |
Ac-D-Ala-OH | 19436-52-3 | |
H-D-Ala-OBzl·TosOH | 41036-32-2 | |
H-D-Ala-OH | 338-69-2 | |
H-D-Ala-OMe•HCl | 14316-06-4 | |
H-D-Ala-OtBu•HCl | 59531-86-1 | |
H-D-Ala-NH2·HCl | 71810-97-4 | |
H-D-Arg(NO2)-OH | 66036-77-9 | |
H-D-Arg(Pbf)-OH | 200116-81-0 | |
H-D-Arg-NH2·2HCl | 203308-91-2 | |
H-D-Arg-OH | 157-06-2 | |
H-D-Arg-OH∙HCl | 627-75-8 | |
H-D-Asn-OH•H2O | 2058-58-4 | |
H-D-Asp(OBzl)-OBzl∙HCl | - | |
H-D-Asp(OBzl)-OBzl·TosOH | 4079-64-5 | |
H-D-Asp(OtBu)-OH | 64960-75-4 | |
H-D-Asp(OMe)-OMe∙HCl | 69630-50-8 | |
H-D-Asp(OtBu)-OtBu·HCl | 1791-13-5 | |
H-D-Asp-OBzl | 6367-42-6 | |
H-D-Asp-OH | 1783-96-6 | |
H-D-Asp-OMe | 65414-78-0 | |
H-D-Asp-OtBu·HCl | - | |
H-D-Cys(Trt)-OH | 25840-82-8 | |
H-D-Cys-OMe∙HCl | - | |
H-D-Cys-OH·H2O·HCl | 32443-99-5 | |
H-D-Gln-OH | 5959-95-5 | |
Ac-D-Glu(OtBu)-OH | - | |
H-D-Glu(OBzl)-OH | 2578-33-8 | |
H-D-Glu(OMe)-OH | 6461-04-7 | |
H-D-Glu(OMe)-OMe·HCl | 27025-25-8 | |
H-D-Glu(OtBu)-OH | 45125-00-6 | |
H-D-Glu(OtBu)-OMe·HCl | - | |
H-D-Glu-OBzl | 79338-14-0 | |
H-D-Glu-OH | 6893-26-1 | |
H-D-Glu-OtBu | 25456-76-2 | |
H-D-His-OH | 351-50-8 | |
H-D-allo-Ile-OH | 1509-35-9 | |
Ac-DL-Leu-OH | 99-15-0 | |
H-D-Leu-OBzl∙TosOH | 17664-93-6 | |
H-D-Leu-OH | 328-38-1 | |
H-D-Leu-OtBu•HCl | - | |
H-D-Lys(Boc)-OMe•HCl | - | |
H-D-Lys-OH•HCl | 7274-88-6 | |
H-D-Lys-OBzl•HCl•TosOH | - | |
Ac-DL-Met-OH | 1115-47-5 | |
H-D-Met-OH | - | |
H-D-Met-OMe·HCl | 69630-60-0 | |
H-D-Orn-OH• HCl | 16682-12-5 | |
H-D-Phe-OH | 673-06-3 | |
H-D-Phe-OMe·HCl | 13033-84-6 | |
H-D-Phe-OtBu•HCl | 3403-25-6 | |
H-D-Phe-pNA | 14235-18-8 | |
H-D-Pro-NH2 | 62937-45-5 | |
H-D-Pro-OBzl∙HCl | - | |
H-D-Pro-OH | 344-25-2 | |
H-D-Pro-OMe∙HCl | 65365-28-8 | |
H-D-Pro-OtBu•HCl | - | |
H-D-Ser(Bzl)-OH·HCl | - | |
H-D-Ser(tBu)-OMe·HCl | 78537-14-1 | |
H-D-Ser-OBzl·HCl | 151651-44-4 | |
H-D-Ser-OMe·HCl | 5874-57-7 | |
H-D-Thr-OBzl | - | |
Ac-D-Trp-OH | 2280-01-5 | |
H-D-Trp-OBzl∙HCl | - | |
H-D-Trp-OH | 153-94-6 | |
H-D-Trp-OMe∙HCl | 14907-27-8 | |
H-D-Tyr(tBu)-OH | 186698-58-8 | |
H-D-Tyr-OH | 556-02-5 | |
H-D-Tyr-OMe·HCl | 3728-20-9 | |
H-D-Tyr-OtBu | 87553-74-0 | |
H-D-Val-OBzl·TosOH | - | |
H-D-Val-OH | 640-68-6 | |
H-D-Val-OMe·HCl | 7146-15-8 | |
H-D-Val-OtBu·HCl | 104944-18-5 | |
H-D-Thr-OH | 632-20-2 | |
Boc-Ala-NH2 | 85642-13-3 | |
Boc-Ala-OH | 15761-38-3 | |
Boc-Ala-OSu | 3392-05-0 | |
Boc-β-Ala-OH | 3303-84-2 | |
Boc-β-iodo-Ala-OMe | 93267-04-0 | |
Boc-Arg(Mts)-OH | 102185-38-6 | |
Boc-Arg(Mts)-OH•CHA | 68262-71-5 | |
Boc-Arg(NO2)-OH | 2188-18-3 | |
Boc-Arg(Pbf)-OH | 200124-22-7 | |
Boc-Arg(Tos)-OH | 13836-37-8 | |
Boc-Arg(Z)-OH | 51219-18-2 | |
Boc-Arg-OH•HCl•H2O | 35897-34-8 | |
Boc-Asn(Trt)-OH | 132388-68-2 | |
Boc-Asn(Xan)-OH | 65420-40-8 | |
Boc-Asn-OH | 7536-55-2 | |
Boc-Asn-ONp | 4587-33-1 | |
Boc-Asp(OBzl)-ONp | 26048-69-1 | |
Boc-Asp(OcHex)-OH | 73821-95-1 | |
Boc-Asp(Ofm)-OH | 117014-32-1 | |
Boc-Asp(OMe)-OH·DCHA | 59768-74-0 | |
Boc-Asp(OtBu)-OH | 1676-90-0 | |
Boc-Asp(OtBu)-OH·DCHA | 1913-12-8 | |
Boc-Asp-OBzl | 30925-18-9 | |
Boc-Asp-OMe | - | |
Boc-Asp-OtBu | 34582-32-6 | |
Boc-Cys(Acm)-OH | 19746-37-3 | |
Boc-Cys(Bzl)-OH | 5068-28-0 | |
Boc-Cys(pMeBzl)-OH | 61925-77-7 | |
Boc-Cys(pMeOBzl)-OH | 18942-46-6 | |
Boc-Cys(tBu)-OH | 56976-06-8 | |
Boc-Cys(Trt)-OH | 21947-98-8 | |
Boc-Cys(Acm)-ONp | 58651-76-6 | |
Boc-Gln(Trt)-OH | 132388-69-3 | |
Boc-Gln(Xan)-OH | 55260-24-7 | |
Boc-Gln-OH | 13726-85-7 | |
Boc-Gln-ONp | 15387-45-8 | |
Boc-Glu(OBzl)-OH | 13574-13-5 | |
Boc-Glu(OcHex)-OH | 73821-97-3 | |
Boc-Glu(Ofm)-OH | 123417-18-5 | |
Boc-Glu(OMe)-OH | - | |
Boc-Glu(OtBu)-OH | 13726-84-6 | |
Boc-Glu(OtBu)-ONp | 69876-58-0 | |
Boc-Glu-NH2 | 18800-74-3 | |
Boc-Glu-OBzl·DCHA | - | |
Boc-Glu-OH | 2419-94-5 | |
Boc-Glu-OtBu | 24277-39-2 | |
Boc-Gly-N(OMe)Me | - | |
Boc-Gly-OH | 4530-20-5 | |
Boc-Gly-OSu | 3392-07-2 | |
Boc-His(Boc)-OH | 20866-46-0 | |
Boc-His(Bom)-OH | 79950-65-5 | |
Boc-His(Dnp)-OH | 25024-53-7 | |
Boc-His(Tos)-OH | 35899-43-5 | |
Boc-His(Trt)-OH | 32926-43-5 | |
Boc-His(Z)-OH | 50305-43-6 | |
Boc-His-OH | 17791-52-5 | |
Boc-Ile-OH•1/2H2O | 13139-16-7 | |
Boc-Leu-OH•H2O | 13139-15-6 | |
Boc-Lys(2-Cl-Z)-OH | 54613-99-9 | |
Boc-Lys(Ac)-OH | 6404-26-8 | |
Boc-Lys(Boc)-OH | 2483-46-7 | |
Boc-Lys(Boc)-OH·DCHA | 15098-69-8 | |
Boc-Lys(Boc)-ONp | 2592-19-0 | |
Boc-Lys(Boc)-OSu | 30189-36-7 | |
Boc-Lys(Fmoc)-OH | 84624-27-1 | |
Boc-Lys(Z)-OH | 2389-45-9 | |
Boc-Lys(Z)-OSu | 34404-36-9 | |
Boc-Lys(Z)-pNA | 51078-31-0 | |
Boc-Lys-OH | 13734-28-6 | |
Boc-Lys-OMe•HCl | 55757-60-3 | |
Boc-Lys-OSu | - | |
Boc-Met(O)-OH | 34805-21-5 | |
Boc-Met-OH | 2488-15-5 | |
Boc-Orn(2-Cl-Z)-OH | 118554-00-0 | |
Boc-Orn(Fmoc)-OH | 150828-96-9 | |
Boc-Orn(Z)-OH | 2480-93-5 | |
Boc-Orn-OH | 21887-64-9 | |
Boc-Phe-OH | 13734-34-4 | |
Boc-4-oxo-Pro-OH | - | |
Boc-4-oxo-Pro-OMe | 102195-80-2 | |
Boc-Pro-OH | 15761-39-4 | |
Boc-Pro-OMe | - | |
Boc-Ser(Bzl)-OH | 23680-31-1 | |
Boc-Ser(Me)-OH | - | |
Boc-Ser(PO3Bzl2)-OH | 90013-45-9 | |
Boc-Ser(tBu)-OH | 13734-38-8 | |
Boc-Ser(tBu)-OH·DCHA | 18942-50-2 | |
Boc-Ser(Tos)-OMe | 56926-94-4 | |
Boc-Ser-OBzl | 59524-02-6 | |
Boc-Ser-OH | 3262-72-4 | |
Boc-Ser-OMe | 2766-43-0 | |
Boc-Thr(Bzl)-OH | 15260-10-3 | |
Boc-Thr(tBu)-OH | 13734-40-2 | |
Boc-Thr-OH | 2592-18-9 | |
Boc-Thr-OMe | - | |
Boc-Thr-OSu | 63076-44-8 | |
Boc-Tle-OH | 62965-35-9 | |
Boc-Trp(Boc)-OH | - | |
Boc-Trp(For)-OH | 47355-10-2 | |
Boc-Trp-OH | 13139-14-5 | |
Boc-Tyr(2-Br-Z)-OH | 47689-67-8 | |
Boc-Tyr(Bzl)-OH | 2130-96-3 | |
Boc-Tyr(tBu)-OH | 47375-34-8 | |
Boc-Tyr-OEt | - | |
Boc-Tyr-OH | 3978-80-1 | |
Boc-Tyr-OMe | 4326-36-7 | |
Boc-Tyr-OtBu | - | |
Boc-Val-OH | 13734-41-3 | |
Boc-DL-Ala-OH | 3744-87-4 | |
Boc-DL-Leu-OH∙H2O | - | |
Boc-DL-Phe-OH | 4530-18-1 | |
Boc-DL-Pro-OH | - | |
Boc-D-Ala-NH2 | - | |
Boc-D-Ala-OH | 7764-95-6 | |
Boc-D-Arg(Tos)-OH | 61315-61-5 | |
Boc-D-Arg-OH•HCl•H2O | 113712-06-4 | |
Boc-D-Asn-OH | 75647-01-7 | |
Boc-D-Asp(OcHex)-OH | 112898-18-7 | |
Boc-D-Asp(OtBu)-OH·DCHA | 200334-95-8 | |
Boc-D-Asp-OBzl | 92828-64-3 | |
Boc-D-Asp(OBzl)-OH | 51186-58-4 | |
Boc-D-Asp-OH | - | |
Boc-D-Cys(Trt)-OH | 87494-13-1 | |
Boc-D-Gln(Trt)-OH | - | |
Boc-D-Glu(OtBu)-OH | 104719-63-3 | |
Boc-D-Glu-OBzl•DCHA | - | |
Boc-D-Glu(OBzl)-OSu | - | |
Boc-D-Glu-OBzl | 34404-30-3 | |
Boc-D-His(Tos)-OH | 69541-68-0 | |
Boc-D-His(DNp)-OH∙IPA | - | |
Boc-D-Ile-OH | 55721-65-8 | |
Boc-D-Leu-OH•H2O | 16937-99-8 | |
Boc-D-Lys(2-Cl-Z)-OH | 57096-11-4 | |
Boc-D-Lys(Boc)-OH | - | |
Boc-D-Lys(Fmoc)-OH | 115186-31-7 | |
Boc-D-Lys(Z)-OH | 106719-44-2 | |
Boc-D-Lys-OH | 106719-44-2 | |
Boc-D-Met-OH | 5241-66-7 | |
Boc-D-Orn(Z)-OH | 16937-92-1 | |
Boc-D-Phe-OH | 18942-49-9 | |
Boc-D-Pro-OH | 37784-17-1 | |
Boc-D-Pro-OSu | 102185-34-2 | |
Boc-D-Ser(Bzl)-OH | 47173-80-8 | |
Boc-D-Ser(tBu)-OH | - | |
Boc-D-Ser-OH | 6368-20-3 | |
Boc-D-Ser-OMe | - | |
Boc-D-Thr(Bzl)-OH | 69355-99-3 | |
Boc-D-Thr-OH | 55674-67-4 | |
Boc-D-Trp-OH | 5241-64-5 | |
Boc-D-Tyr(2-Br-Z)-OH | 81189-61-9 | |
Boc-D-Tyr(tBu)-OH | - | |
Boc-D-Tyr-OH | 70642-86-3 | |
Boc-D-Val-OH | 22838-58-0 | |
Fmoc-Ala-OH | 35661-39-3 | |
Fmoc-Ala-OMe | - | |
Fmoc-Ala-OPfp | 86060-86-8 | |
Fmoc-ß-Ala-OH | 35737-10-1 | |
Fmoc-Arg(Mtr)-OH | 98930-01-9 | |
Fmoc-Arg(Mts)-OH | 88743-97-9 | |
Fmoc-Arg(Pbf)-OH | 154445-77-9 | |
Fmoc-Arg(Pbf)-OPfp | - | |
Fmoc-Arg(Tos)-OH | 83792-47-6 | |
Fmoc-Arg-OH | 91000-69-0 | |
Fmoc-Arg-OH·HCl | - | |
Fmoc-Asn(Trt)-OH | 132388-59-1 | |
Fmoc-Asn(Trt)-OPfp | 132388-64-8 | |
Fmoc-Asn-OH | 71989-16-7 | |
Fmoc-Asn-OPfp | 86060-99-3 | |
Fmoc-Asp(OAll)-OH | 146982-24-3 | |
Fmoc-Asp(OBzl)-OH | 86060-84-6 | |
Fmoc-Asp(OcHex)-OH | 130304-80-2 | |
Fmoc-Asp(OMe)-OH | 145038-53-5 | |
Fmoc-Asp(OtBu)-OH | 71989-14-5 | |
Fmoc-Asp(OtBu)-OPfp | 86061-01-0 | |
Fmoc-Asp-OAll | 144120-53-6 | |
Fmoc-Asp-OBzl | 86060-83-5 | |
Fmoc-Asp-OFm | 187671-16-5 | |
Fmoc-Asp-OH | 119062-05-4 | |
Fmoc-Asp-OMe | - | |
Fmoc-Asp-OtBu | 129460-09-9 | |
Fmoc-Cys(Acm)-OH | 86060-81-3 | |
Fmoc-Cys(Acm)-OPfp | 86060-96-0 | |
Fmoc-Cys(Bzl)-OH | 53298-33-2 | |
Fmoc-Cys(MMt)-OH | 177582-21-7 | |
Fmoc-Cys(pMeBzl)-OH | 136050-67-4 | |
Fmoc-Cys(pMeOBzl)-OH | 141892-41-3 | |
Fmoc-Cys(tBu)-OH | 67436-13-9 | |
Fmoc-Cys(Trt)-OH | 103213-32-7 | |
Fmoc-Cys(Trt)-Opfp | 115520-21-3 | |
Fmoc-Gln(Trt)-OH | 132327-80-1 | |
Fmoc-Gln(Trt)-OPfp | 132388-65-9 | |
Fmoc-Gln-OH | 71989-20-3 | |
Fmoc-Gln-OPfp | 86061-00-9 | |
Fmoc-Glu(Edans)-OH | 193475-66-0 | |
Fmoc-Glu(OAll)-OH | 133464-46-7 | |
Fmoc-Glu(OBzl)-OH | 123639-61-2 | |
Fmoc-Glu(Odmab)-OH | - | |
Fmoc-Glu(OMe)-OH | - | |
Fmoc-Glu(OtBu)-OH | 71989-18-9 | |
Fmoc-Glu(OtBu)-OPfp | 86061-04-3 | |
Fmoc-Glu-OAll | 144120-54-7 | |
Fmoc-Glu-OH | 121343-82-6 | |
Fmoc-Glu-OMe | - | |
Fmoc-Glu-OtBu | 4793-07-7 | |
Fmoc-Gly(allyl)-OH | 146549-21-5 | |
Fmoc-Gly-OH | 29022-11-5 | |
Fmoc-Gly-OPfp | 86060-85-7 | |
Fmoc-His(Fmoc)-OH | 98929-98-7 | |
Fmoc-His(MMt)-OH | 133367-33-6 | |
Fmoc-His(Trt)-OH | 109425-51-6 | |
Fmoc-His(Trt)-OPfp | 109434-24-4 | |
Fmoc-Ile-OH | 71989-23-6 | |
Fmoc-Ile-OPfp | 86060-89-1 | |
Fmoc-Leu-OH | 35661-60-0 | |
Fmoc-Leu-OPfp | 86060-88-0 | |
Fmoc-Lys(2-Cl-Z)-OH | 133970-31-7 | |
Fmoc-Lys(Ac)-OH | 159766-56-0 | |
Fmoc-Lys(Aloc)-OH | 146982-27-6 | |
Fmoc-Lys(Biotin)-OH | 146987-10-2 | |
Fmoc-Lys(Boc)-OH | 71989-26-9 | |
Fmoc-Lys(Boc)-OPfp | 86060-98-2 | |
Fmoc-Lys(Dadcyl)-OH | - | |
Fmoc-Lys(Dde)-OH | 150629-67-7 | |
Fmoc-Lys(Dnp)-OH | 148083-64-1 | |
Fmoc-Lys(Fmoc)-OH | 78081-87-5 | |
Fmoc-Lys(Fmoc)-OPfp | 132990-14-8 | |
Fmoc-Lys(ivDde)-OH | 204777-78-6 | |
Fmoc-Lys(Mtt)-OH | 167393-62-6 | |
Fmoc-Lys(Tfa)-OH | 76265-69-5 | |
Fmoc-Lys(Trt)-OH | - | |
Fmoc-Lys(Z)-OH | 86060-82-4 | |
Fmoc-Lys-OH | - | |
Fmoc-Lys-OH·HCl | 139262-23-0 | |
Fmoc-Met(O)-OH | 76265-70-8 | |
Fmoc-Met(O2)-OH | 163437-14-7 | |
Fmoc-Met-OH | 71989-28-1 | |
Fmoc-Met-OPfp | 86060-94-8 | |
Fmoc-Orn(Boc)-OH | 109425-55-0 | |
Fmoc-Orn(Dde)-OH | 269062-80-8 | |
Fmoc-Phe-OH | 35661-40-6 | |
Fmoc-Phe-OPfp | 86060-92-6 | |
Fmoc-Pro-OH | 71989-31-6 | |
Fmoc-Pro-OPfp | 86060-90-4 | |
Fmoc-Ser(Bzl)-OH | 83792-48-7 | |
Fmoc-Ser(HPO3Bzl)-OH | 158171-14-3 | |
Fmoc-Ser(tBu)-OH | 71989-33-8 | |
Fmoc-Ser(tBu)-OPfp | 105751-13-1 | |
Fmoc-Ser(Trt)-OH | 111061-56-4 | |
Fmoc-Ser-OH | 73724-45-5 | |
Fmoc-Ser-OPAC | - | |
Fmoc-Thr(Bzl)-OH | 117872-75-0 | |
Fmoc-Thr(HPO3Bzl)-OH | 175291-56-2 | |
Fmoc-Thr(tBu)-OH | 71989-35-0 | |
Fmoc-Thr(tBu)-OPfp | 117088-31-0 | |
Fmoc-Thr(Trt)-OH | 133180-01-5 | |
Fmoc-Thr-OH | 73731-37-0 | |
Fmoc-Thr-OPAC | - | |
Fmoc-Trp(Boc)-OH | 143824-78-6 | |
Fmoc-Trp-OH | 35737-15-6 | |
Fmoc-Trp-OPfp | 86069-87-6 | |
Fmoc-Tyr(Bzl)-OH | 71989-40-7 | |
Fmoc-Tyr(HPO3Bzl)-OH | 191348-16-0 | |
Fmoc-Tyr(PO3Bzl2)-OH | 134150-51-9 | |
Fmoc-Tyr(tBu)-OH | 71989-38-3 | |
Fmoc-Tyr(tBu)-OPfp | 86060-93-7 | |
Fmoc-Tyr-OH | 92954-90-0 | |
Fmoc-Tyr-OtBu | - | |
Fmoc-Val-OH | 68858-20-8 | |
Fmoc-Val-OPfp | 86060-87-9 | |
Fmoc-Val-OSu | 130878-68-1 | |
Fmoc-O-Phospho-Tyr-OH | 147762-53-6 | |
Fmoc-DL-Phe-OH | - | |
Fmoc-D-Ala-OPfp | 125043-04-1 | |
Fmoc-D-Arg(Mtr)-OH | 120075-24-3 | |
Fmoc-D-Asn(Trt)-OH | 180570-71-2 | |
Fmoc-D-Asn-OH | 108321-39-7 | |
Fmoc-D-Asp(OtBu)-OH | 112883-39-3 | |
Fmoc-D-Asp(OtBu)-Opfp | 200335-75-7 | |
Fmoc-D-Asp-OH | - | |
Fmoc-D-Asp-OMe | - | |
Fmoc-D-Asp-OtBu | 34098-70-7 | |
Fmoc-D-Cys(Acm)-OH | - | |
Fmoc-D-Cys(Trt)- OPfp | 200395-72-8 | |
Fmoc-D-Gln(Trt)-OH | 200623-62-7 | |
Fmoc-D-Gln-OPfp | 200622-33-9 | |
Fmoc-D-isoGln-OH | - | |
Fmoc-D-Glu(OtBu)-OH | 104091-08-9 | |
Fmoc-D-Glu(OtBu)-OPfp | 200616-21-3 | |
Fmoc-D-Glu-OH | - | |
Fmoc-D-Glu-OtBu | - | |
Fmoc-D-His(Trt)-OH | 135610-90-1 | |
Fmoc-D-Ile-OPfp | - | |
Fmoc-D-Allo-Ile-OH | 118904-37-3 | |
Fmoc-D-Leu-OPfp | - | |
Fmoc-D-Lys(Boc)-OPfp | 133083-36-0 | |
Fmoc-D-Lys(Dde)-OH | 150629-67-7 | |
Fmoc-D-Lys(Fmoc)-OH | 75932-02-4 | |
Fmoc-D-Lys-OH·HCl | 201002-47-3 | |
Fmoc-D-Met-OH | 112883-40-6 | |
Fmoc-D-Met-OPfp | - | |
Fmoc-D-Phe-OH | 86123-10-6 | |
Fmoc-D-Phe-OPfp | - | |
Fmoc-D-Pro-OH | 101555-62-8 | |
Fmoc-D-Pro-OPfp | - | |
Fmoc-D-Ser(tBu)-OH | 128107-47-1 | |
Fmoc-D-Ser(tBu)-OPfp | - | |
Fmoc-D-Ser-OH | 116861-26-8 | |
Fmoc-D-Ser-OMe | - | |
Fmoc-D-Thr(tBu)-OH | 138797-71-4 | |
Fmoc-D-Thr(tBu)-OPfp | - | |
Fmoc-D-Thr-OH·H2O | 118609-38-4 | |
Fmoc-D-Trp-OH | 86123-11-7 | |
Fmoc-D-Trp-OPfp | 136554-94-4 | |
Fmoc-D-Tyr(tBu)-OH | 118488-18-9 | |
Fmoc-D-Tyr(tBu)-OPfp | - | |
Fmoc-D-Val-OH | 84624-17-9 | |
Fmoc-D-Val-OPfp | - | |
Z-Ala-OH | 1142-20-7 | |
Z-Ala-OMe | 28819-05-8 | |
Z-Ala-OSu | 3401-36-3 | |
Z-β-Ala-OH | 2304-94-1 | |
Z-Arg(Mtr)-OH·CHA | 80745-09-1 | |
Z-Arg(NO2)-OH | 2034-98-5 | |
Z-Arg(Pbf)-OH·CHA | 200190-89-2 | |
Z-Arg(Z)2-OH | 14611-34-8 | |
Z-Arg-OH | 1234-35-1 | |
Z-Arg-OH∙HCl | 56672-63-0 | |
Z-Asn-OH | 2304-96-3 | |
Z-Asp(OBzl)-OH | 3479-47-8 | |
Z-Asp(OMe)-OH | 3160-47-2 | |
Z-Asp(OtBu)-OH·DCHA | 5545-52-8 | |
Z-Asp(OtBu)-OH·H2O | 5545-52-8 | |
Z-Asp(OtBu)-OSu | 3338-32-7 | |
Z-Asp-OH | 1152-61-0 | |
Z-Asp-OMe | 4668-42-2 | |
Z-Asp-OtBu | - | |
(Z-Cys-OH)2 | 6968-11-2 | |
Z-Cys(pMeOBzl)-OH | - | |
Z-Cys(Z)-OH | 57912-35-3 | |
Z-Gln(Trt)-OH | 132388-60-4 | |
Z-Gln-OH | 2650-64-8 | |
Z-Glu(OBzl)-OH | 5680-86-4 | |
Z-Glu(OBzl)-OH·DCHA | - | |
Z-Glu(OtBu)-OBzl | - | |
Z-Glu(OtBu)-OH | 3886-08-6 | |
Z-Glu(OtBu)-OH∙DCHA | - | |
Z-Glu-OBzl | 3705-42-8 | |
Z-Glu-OH | 1155-62-0 | |
Z-Glu-OMe | 5672-83-3 | |
Z-Glu-OtBu | 5891-45-2 | |
Z-Gly-NH2 | 949-90-6 | |
Z-Gly-OH | 1138-80-3 | |
Z-Gly-OSu | - | |
Z-His(Dnp)-OH | - | |
Z-His-OH | 14997-58-1 | |
Z-Leu-OH | 2018-66-8 | |
Z-Leu-OH•DCHA | 53363-87-4 | |
Z-Lys(Boc)(IPA)-OH·DCHA | - | |
Z-Lys(Boc)-OH | 2389-60-8 | |
Z-Lys(Z)-OH | 405-39-0 | |
Z-Lys-OH | 2212-75-1 | |
Z-Met-OH | 1152-62-1 | |
Z-Orn-OH | 2640-58-6 | |
Z-Orn-OH∙HCl | - | |
Z-Phe-OH | 1161-13-3 | |
Z-Pro-NH2 | 34079-31-7 | |
Z-Pro-OH | 1148-11-4 | |
Z-Phg-OH | 53990-33-3 | |
Z-Ser(Bzl)-OH | 20806-43-3 | |
Z-Ser(tBu)-OH | 1676-75-1 | |
Z-Ser(Tos)-OMe | 1492-52-0 | |
Z-Ser-OH | 1145-80-8 | |
Z-Ser-OMe | - | |
Z-Sar-OH | 39608-31-6 | |
Z-Thr-NH2 | 49705-98-8 | |
Z-Thr-OBzl | 16597-50-5 | |
Z-Thr-OH | 19728-63-3 | |
Z-Trp(Boc)-OH·DCHA | 218938-57-9 | |
Z-Trp-OBzl | - | |
Z-Trp-OH | 7432-21-5 | |
Z-Trp-OMe | - | |
Z-Tyr(Bzl)-OH | 16677-29-5 | |
Z-Tyr(tBu)-OH·DCHA | 16879-90-6 | |
Z-Tyr-OH | 1164-16-5 | |
Z-Tyr-OMe | 13512-31-7 | |
Z-Tyr-OtBu·H2O | - | |
Z-Val-OEt | - | |
Z-Val-OH | 1149-26-4 | |
Z-Val-OSu | 3496-11-5 | |
Z-DL-Met-OH | 4434-61-1 | |
Z-D-Ala-OH | 26607-51-2 | |
Z-D-Arg(Mtr)-OH·CHA | - | |
Z-D-Arg(Pbf)-OH·CHA | - | |
Z-D-Arg-OH | 6382-93-0 | |
Z-D-Arg-OH∙HCl | - | |
Z-D-Asp-OH | 78663-07-7 | |
Z-D-Asp-OMe | - | |
Z-D-Glu(OBzl)-OH | 59486-73-6 | |
Z-D-Glu(OtBu)-OH | 51644-83-8 | |
Z-D-Glu-OBzl | 65706-99-2 | |
Z-D-Glu-OH | 63648-73-7 | |
Z-D-Glu-OMe | 26566-11-0 | |
Z-D-Glu-OEt | - | |
Z-D-His-OH | 67424-93-5 | |
Z-D-Asp(OtBu)-OH·H2O | 71449-08-6 | |
Z-D-Leu-OH·DCHA | - | |
Z-D-Lys-OH | 70671-54-4 | |
Z-D-Met-OH | 28862-80-8 | |
Z-D-Phe-OH | 2448-45-5 | |
Z-D-Pro-OH | 6404-31-5 | |
Z-D-Ser(tBu)-OH | 65806-90-8 | |
Z-D-Thr-OH | 80384-27-6 | |
Z-D-Trp-OH | 2279-15-4 | |
Z-D-Trp(Boc)-OH | - | |
Z-D-Tyr(tBu)-OH·DCHA | 198828-72-7 | |
Z-D-Val-OH | 1685-33-2 | |
Boc-ß-HoAla-OH | 158851-30-0 | |
Fmoc-ß-HoAla-OH | 193954-26-6 | |
H-ß-HoAla-OH·HCl | 58610-41-6 | |
Boc-HoArg(NO2)-OH | - | |
Boc-ß-HoArg(Tos)-OH | 136271-81-3 | |
Fmoc-HoArg(Pbf)-OH | - | |
Fmoc-HoArg-OH | 776277-76-0 | |
Fmoc-ß-HoArg(Pbf)-OH | - | |
H-HoArg-OH | 156-86-5 | |
Z-HoArg-OH | - | |
Boc-Aib-OH | 30992-29-1 | |
Fmoc-Aib-OH | 94744-50-0 | |
H-Aib-OH | 62-57-7 | |
H-Aib-OtBu·HCl | 4512-32-7 | |
Z-Aib-OH | 15030-72-5 | |
Boc- ß-HoAsn-OH | - | |
Boc-ß-HoAsp(OBzl)-OH | 254101-10-5 | |
Fmoc- ß-HoAsp(OtBu)-OH | 209252-17-5 | |
Fmoc-ß-HoAsn(Trt)-OH | 283160-20-3 | |
H-ß-HoAsp∙HCl | - | |
Boc-Abu-OH·DCHA | 34306-42-8 | |
H-Abu-OH | 1492-24-6 | |
Z-Abu-OH | 42918-86-5 | |
Boc-ε-Acp-OH | 6404-29-1 | |
Fmoc-2-Abz-OH | 150256-42-1 | |
Fmoc-ε-Acp-OH | 88574-06-5 | |
H-HoCys-OH | 626-72-2 | |
Fmoc-Cha-OH | 135673-97-1 | |
Boc-Chg-OH | 109183-71-3 | |
Fmoc-Chg-OH | 161321-36-4 | |
H-Chg-OH | 14328-51-9 | |
Z-Chg-OH | - | |
Fmoc-Cit-OH | 133174-15-9 | |
H-Cit-OH | 372-75-8 | |
H-Dab•HBr | - | |
Fmoc-Dap-OH | 181954-34-7 | |
Fmoc-Dap(Boc)-OH | 162558-25-0 | |
Fmoc-Dap(Z)-OH | - | |
H-Dap-OH·HBr | - | |
H-Dap-OH•HCl | 1482-97-9 | |
Boc-ß-HoGln-OH | - | |
Fmoc-ß-HoGln(Trt)-OH | 401915-55-7 | |
H-ß-HoGln-OH·HCl | - | |
Boc-ß-HoGlu(OBzl)-OH | 218943-30-7 | |
Fmoc-ß-HoGlu(OtBu)-OH | 203854-49-3 | |
H- ß-HoGlu-OH·HCl | 61884-74-0 | |
Boc-Hyp(Bzl)-OH·DCHA | 54631-81-1 | |
Boc-Hyp-OEt | - | |
Boc-Hyp-OH | 13726-69-7 | |
Boc-Hyp-OMe | 74844-91-0 | |
Fmoc-Hyp(Bzl)-OH | 174800-02-3 | |
Fmoc-Hyp(tBu)-OH | 122996-47-8 | |
Fmoc-Hyp-OH | 88050-17-3 | |
H-Hyp(tBu)-OH | 79775-07-8 | |
H-Hyp(tBu)-OtBu∙HCl | - | |
H-Hyp-OH | 51-35-4 | |
H-Hyp-OMe·HCl | 40216-83-9 | |
Z-Hyp(tBu)-OMe | - | |
Z-Hyp-OH | 13504-85-3 | |
Z-Hyp-OMe | 64187-48-0 | |
Boc- ß-HoIle-OH | 218608-82-3 | |
Fmoc- ß-HoIle-OH | 193954-27-7 | |
H-ß-HoIle-OH·HCl | 219310-10-8 | |
Fmoc-Inp-OH | 148928-15-8 | |
Fmoc-ß-HoLeu-OH | 193887-44-4 | |
H-ß-HoLeu-OH•HCl | 96386-92-4 | |
Fmoc-Lys(Me)3-OH ·HCl | - | |
Fmoc-Lys(Me)3-OH·HCl | - | |
Fmoc-β-HoMet-OH | 266359-48-2 | |
Boc-1-Nal-OH | 55447-00-2 | |
Boc-2-Nal-OH | 58438-04-3 | |
Fmoc-1-Nal-OH | 96402-49-2 | |
Fmoc-2-Nal-OH | 112883-43-9 | |
H-1-Nal-OH | 55516-54-6 | |
H-2-Nal-OH·HCl | 58438-03-2 | |
Z-2-Nal-OH | 143218-10-4 | |
Boc-Nle-OH | 6404-28-0 | |
Boc-Nle-OH·DCHA | 21947-32-0 | |
Fmoc-Nle-OH∙ | 77284-32-3 | |
H-Nle-OH | 327-57-1 | |
Boc-Nva-OH·DCHA | - | |
Fmoc-Nva-OH | 135112-28-6 | |
Fmoc-Oic-OH | 130309-37-4 | |
Boc-Phe(2-F)-OH | 114873-00-6 | |
Boc-Phe(4-Br)-OH | 62129-39-9 | |
Boc-Phe(4-Cl)-OH | 68090-88-0 | |
Boc-Phe(4-F)-OH | 41153-30-4 | |
Boc-Phe(4-I)-OH | 62129-44-6 | |
Boc-Phe(4-NH2)-OH | 55533-24-9 | |
Boc-Phe(4-NO2)-OH | 33305-77-0 | |
Fmoc-Phe(4-Cl)-OH | 175453-08-4 | |
Fmoc-Phe(4-F)-OH | 169243-86-1 | |
Fmoc-Phe(4-I)-OH | 82565-68-2 | |
Fmoc-Phe(4-NH2)-OH | 95753-56-3 | |
Fmoc-Phe(4-NO2)-OH | 95753-55-2 | |
Fmoc-β-HoPhe-OH | 193954-28-8 | |
H-Phe(2-Cl)-OH | 103616-89-3 | |
H-Phe(2-F)-OH | 19883-78-4 | |
H-Phe(3,4-DiCl)-OH | 52794-99-7 | |
H-Phe(3,4-DiCl)-OMe·HCl | - | |
H-Phe(3-Cl)-OH | 80126-51-8 | |
H-Phe(3-CN)-OH | 57213-48-6 | |
H-Phe(4-Br)-OH | 24250-84-8 | |
H-Phe(4-Cl)-OH | 14173-39-8 | |
H-Phe(4-F)-OH | 1132-68-9 | |
H-Phe(4-I)-OH | 24250-85-9 | |
H-Phe(4-Me)-OH | 1991-87-3 | |
H-Phe(4-NH2)-OH | 943-80-6 | |
H-Phe(4-NO2)-OH | 949-99-5 | |
H-Phe(4-NO2)-OH·H2O | 207591-86-4 | |
H-Phe(4-NO2)-OMe·HCl | 17193-40-7 | |
H-β-HoPhe-OH | 138165-77-2 | |
Z-Phe(4-F)-OH | 17543-58-7 | |
H-D-HoPhe-OH | 82795-51-5 | |
Boc-β-HoPro-OH | - | |
Fmoc -β-HoPro-OH | - | |
Boc-2-Pal-OH | 71239-85-5 | |
Boc-3-Pal-OH | 117142-26-4 | |
Boc-4-Pal-OH | 37535-57-2 | |
Fmoc-3-Pal-OH·HCl | 175453-07-3 | |
Fmoc-4-Pal-OH | 169555-95-7 | |
H-2-Pal-OH·HCl | 37535-51-6net | |
H-3-Pal-OH·HCl | 64090-98-8 | |
H-3-Pal-OMe·2HCl | - | |
H-4-Pal-OH | 37535-49-2 | |
Ac-Phg(4-OAc)-OH | - | |
Ac-Phg(4-OH)-OEt | - | |
Boc-Phg-OH | 2900-27-8 | |
Fmoc-Phg-OH | 102410-65-1 | |
H-Phg(4-OH)-OEt | - | |
H-Phg(4-OH)-OH | - | |
H-Phg-OH | 2935-35-5 | |
Boc-Pen(pMeBzl)-OH | 198474-61-2 | |
Fmoc-Pen(Trt)-OH | 201531-88-6 | |
H-Pyr-OH | 98-79-3 | |
Z- Pyr-OH | 32159-21-0 | |
Boc-HoSer(Bzl)-OH | 59408-74-1 | |
Boc-β-HoSer(Bzl)-OH | - | |
Fmoc-β-HoSer(Bzl)-OH | - | |
Fmoc-β-HoSer(tBu)-OH | - | |
H-HoSer-OH | 672-15-1 | |
Fmoc-Sar-OH | 77128-70-2 | |
H-Sar-NH2·HCl | 5325-64-4 | |
H-Sar-OEt·HCl | 52605-49-9 | |
H-Sar-OMe·HCl | 13515-93-0 | |
H-Sar-OtBu·HCl | 5616-81-9 | |
Boc-Sar-OH | 13734-36-6 | |
Fmoc-β-HoTrp(Boc)-OH | - | |
Ac-Tyr(3,5-NO2)-OH*H2O | 17360-11-1 | |
Ac-Tyr(3,5-NO2)-OH | 20767-00-4 | |
Boc-HoTyr-OH | - | |
Boc-Tyr(3-Cl)-OH | - | |
Boc-Tyr(Me)-OH | 53267-93-9 | |
Fmoc-D-Tyr(4-Et)-OH | - | |
Fmoc-HoTyr-OH•DCHA | - | |
Fmoc-Tyr(3,5-I2)-OH | 103213-31-6 | |
Fmoc-Tyr(3-NO2)-OH | 136590-09-5 | |
Fmoc-Tyr(Me)-OH | - | |
Fmoc-β- D-HoTyr(tBu)-OH | - | |
Fmoc-β-HoTyr(tBu)-OH | - | |
H-HoTyr-OH•HBr | 141899-12-9 | |
H-Tyr(3,5-I2)-OH | 300-39-0 | |
H-Tyr(3-Cl)-OH | - | |
H-Tyr(3-I)-OH | 70-78-0 | |
H-Tyr(3-NO2)-OH | 621-44-3 | |
H-Tyr(Me)-OH | 6230-11-1 | |
m-NH2-Tyr-OH·2HCl | 23279-22-3 | |
Fmoc-Tic-OH | 136030-33-6 | |
Fmoc-β-HoVal-OH | 172695-33-9 | |
Allo-Thr-OH | 28954-12-3 | |
Fmoc-β-HoThr(tBu)-OH | - | |
H-DL-Dab•2HCl | - | |
H-DL-Nip-OH | 498-95-3 | |
H-DL-Nle-OH | 616-06-8 | |
H-DL-Nva-OH | 760-78-1 | |
Z-DL-Nva-OH | 21691-44-1 | |
H-DL-Phe(4-NO2)-OH | 2922-40-9 | |
H-DL-Phe(4-Cl)-OMe·HCl | 14173-40-1 | |
Boc-DL-Phg-OH | - | |
H-DL-HoSer-OH | 1927-25-9 | |
H-D-Aib-OH | 2623-91-8 | |
H-D-Abu-OH | 2623-91-8 | |
Fmoc-D-Abu-OH | 170642-27-0 | |
Fmoc-D-Cha-OH | 144701-25-7 | |
Fmoc-D-Cit-OH | 200344-33-8 | |
H-D-Dab-OH·2HCl | 26908-94-1 | |
Boc-D-Glu(OMe)-OH∙DCHA | - | |
Boc-D-1-Nal-OH | 76932-48-4 | |
Boc-D-2-Nal-OH | 76985-10-9 | |
Fmoc-D-1-Nal-OH | 138774-49-3 | |
Fmoc-D-2-Nal-OH | 138774-94-4 | |
H-D-1-Nal-OH | 78306-92-0 | |
H-D-2-Nal-OH·HCl | 76985-09-6 | |
Fmoc-D-Nle-OH | 112883-41-7 | |
Boc-D-Phe(4-Cl)-OH | 57292-44-1 | |
Boc-D-Phe(4-F)-OH | 57292-45-2 | |
Boc-D-Phe(4-NH2)-OH | 164332-89-2 | |
Boc-D-Phe(4-NO2)-OH | 61280-75-9 | |
Fmoc-D-Phe(4-I)-OH | 205526-29-0 | |
Fmoc-D-Phe(4-NO2)-OH | 177966-63-1 | |
H-D-Phe(2-Cl)-OH | 80126-50-7 | |
H-D-Phe(2-F)-OH∙HCl | - | |
H-D-Phe(3,4-DiCl)-OH | 52794-98-6 | |
H-D-Phe(3-Cl)-OH | 80126-52-9 | |
H-D-Phe(4-Br)-OH | 62561-74-4 | |
H-D-Phe(4-Cl)-OH·HCl | - | |
H-D-Phe(4-F)-OH ·HCl | 122839-52-5 | |
H-D-Phe(4-Me)-OH | 49759-61-7 | |
H-D-Phe(4-NO2)-OH | 56613-61-7 | |
Boc-D-Phe(3-Cl)-OH | 80102-25-6 | |
H-D-Phe(4-Cl)-OMe·HCl | 33965-47-8 | |
Boc-D-Phe(4-CN)-OH | 146727-62-0 | |
Fmoc-D-Phe(3-Cl)-OH | 205526-23-4 | |
H-D-2-Pal-OH·2HCl | 37535-52-7net | |
H-D-3-Pal-OH·HCl | 70702-47-5 | |
H-D-4-Pal-OH·2HCl | - | |
H-D-1-Pal·2HCl | - | |
Boc-D-Phg-OH | 33125-05-2 | |
Fmoc-D-Phg-OH | 111524-95-9 | |
H-D-Phg-OH | 875-74-1 | |
H-D-Phg-OMe·HCl | 19883-41-1 | |
H-D-Phg-NH2 | - | |
Boc-D-Pen(pMeBzl)-OH•DCHA | 198470-36-9 | |
Fmoc-D-Pen(Trt)-OH | 201532-01-6 | |
H-D-Pen-OH | 52-67-5 | |
H-D-HoSer-OH | 6027-21-0 | |
Fmoc-D-Tyr(Me)-OH | 201335-88-8 | |
H-D-Tyr(3-Cl)-OH | - | |
H-D-Tyr(3-I)-OH | - | |
Boc-Ala-OL | 79069-13-9 | |
Fmoc-Ala-OL | 161529-13-1 | |
H-Ala-OL | 2749-11-3 | |
Fmoc-Arg(Tos)-OL | - | |
Boc-Asn-OL | - | |
Fmoc-Asn-OL | - | |
Fmoc-Asn(trt)-OL | - | |
Fmoc-Asp(OtBu)-OL | - | |
Boc-Cys(Bzl)-OL | 139428-96-9 | |
Boc-Cys(pMeBzl)-OL | 129397-85-9 | |
Fmoc-Cys(Acm)-OL | - | |
Fmoc-Cys(trt)-OL | - | |
H-Cys(4-MeBzl)-OL | - | |
H-Cys(Bzl)-OL | - | |
Boc-Glu-OL | 133565-42-1 | |
Boc-Glu(OBzl)-OL | - | |
Fmoc-Glu-OL | - | |
Fmoc-Glu(tBu)-OL | - | |
Boc-Gly-OL | 26690-80-2 | |
Fmoc-Gly-OL | 105496-31-9 | |
Z-Gly-OL | - | |
Boc-His(Tos)-OL | - | |
Boc-Ile-OL | 106946-74-1 | |
Fmoc-Ile-OL | - | |
H-Ile-OL | 24629-25-2 | |
Boc-Leu-OL | 82010-31-9 | |
Fmoc-Leu-OL | - | |
H-Leu--OL | 7533-40-6 | |
H-Leu-OL | 7533-40-6 | |
Boc-Lys(2-Cl-Z)-OL | - | |
Boc-Lys(Z)-OL | - | |
Fmoc-Lys(Boc)-OL | - | |
Boc-Met-OL | 51372-93-1 | |
H-Met-OL | 2899-37-8 | |
Boc-Phe-OL | 66605-57-0 | |
Fmoc-Phe-OL | 129397-83-7 | |
Z-Phe-OL | 6372-14-1 | |
Fmoc-Pro-OL | 148625-77-8 | |
H-Pro-OL | 23356-96-9 | |
Z-Pro-OL | 6216-63-3 | |
Boc-D-Pro-OL | 83435-58-9 | |
H-Phg-OL | 20989-17-7 | |
Boc-Ser(Bzl)-OL | 79069-15-1 | |
Fmoc-Ser(tBu)-OL | - | |
H-Ser(Bzl)-OL | - | |
Boc-Thr(Bzl)-OL | 133565-43-2 | |
Fmoc-Thr-OL | 176380-53-3 | |
Fmoc-Thr(tBu)-OL | - | |
H-Thr-OL | 3228-51-1 | |
H-Thr(Bzl)-OL | - | |
H-Thr(Bzl)-OL.HCL | - | |
Z-Thr-OL | - | |
Boc-Tyr-OL | - | |
Fmoc-Tyr(tBu)-OL | 187526-99-4 | |
H-Tyr-OL | 87745-27-5 | |
Boc-Val-OL | 79069-14-0 | |
Fmoc-Val-OL | 160885-98-3 | |
H-Val-OL | 2026-48-4 | |
Boc-Trp-OL | 82689-19-8 | |
Fmoc-Trp-OL | 153815-60-2 | |
H-Trp-OL | 2899-29-8 | |
Boc-D-Ala-OL | 106391-86-0 | |
H-D-Ala-OL | 35320-23-1 | |
Fmoc-D-Asp(OtBu)-OL | - | |
Boc-D-Cys(Bzl)-OL | - | |
Boc-D-Cys(pMeBzl)-OL | - | |
Boc-D-Leu-OL | 106930-51-2 | |
H-D-Leu-OL | - | |
Boc-D-Lys(Z)-OL | - | |
H-D-Met-OL | - | |
Boc-D-Phe-OL | 106454-69-7 | |
H-D-Phe-OL | 5267-64-1 | |
Z-D-Phe-OL | 58917-85-4 | |
H-D-Pro-OL | 68832-13-3 | |
H-D-Phg-OL | 56613-80-0 | |
Boc-D- Phg-OL | 102089-74-7 | |
Boc-D-Ser(Bzl)-OL | - | |
Boc-D-Thr(Bzl)-OL | 168034-31-9 | |
Fmoc-D-Thr-OL | 252049-02-8 | |
H-D-Thr-OL | - | |
Boc-D-Val-OL | 106391-87-1 | |
H-D-Val-OL | 4276-09-9 | |
Boc-D-Trp-OL | 158932-00-4 | |
Fmoc-D-Trp-OL | - | |
H-D-Trp-OL | 52485-52-6 | |
Boc-N-Me-Ala-OH | 16948-16-6 | |
Fmoc-N-Me-Ala-OH | 84000-07-7 | |
H-N-Me-Ala-OH∙HCl | - | |
Z-N-Me-Ala-OH | 21691-41-8 | |
Fmoc-N-Me-Asp(OtBu)-OH | 152548-66-8 | |
Fmoc-N-Me-Glu(OtBu)-OH | 200616-40-6 | |
Fmoc-N-Me-Ile-OH | 138775-22-1 | |
Fmoc-N-Me-Leu-OH | 103478-62-2 | |
H-N-Me-Leu-OBzl∙TosOH | 42807-66-9 | |
Fmoc-N-Me-Nle-OH | 112883-42-8 | |
Boc-N-Me-Phe•DCHA | 40163-88-0 | |
Z-N-Me-Phe-OH | 2899-07-2 | |
H-N-Me-Pro-OH | 475-11-6 | |
Boc-N-Me-Phg-OH | 30925-11-2 | |
Boc-N-Me-Ser(tBu)-OH | - | |
Fmoc-N-Me-Ser(tBu)-OH | 197632-77-2 | |
H-N-Me-Ser-OH∙HCl | 2480-26-4 | |
Fmoc-N-Me-Thr(tBu)-OH | 117106-20-4 | |
Boc-N-Me-Val-OH | 45170-31-8 | |
Fmoc-N-Me-Val-OH | 84000-11-3 | |
Boc-N-Me-Tyr(Bzl)-OH | 64263-81-6 | |
Boc-N-Me-Tyr-OH•DCHA | 95105-25-2 | |
Fmoc-N-Me-Tyr(tBu)-OH | - | |
Boc-D-N-Me-Ala-OH | 19914-38-6 | |
H-N-Me-D-Ala-OH | - | |
Fmoc-D-N-Me-Leu-OH | 103478-63-3 | |
H-D-N-Me-Leu-OBzl∙TosOH | - | |
Boc-D-N-Me-Phe•DCHA | 102185-45-5 | |
Boc-D-N-Me-Phg-OH | - | |
Fmoc-D-N- Me-Val-OH | 103478-58-6 | |
H-N-Me-D-Val-OH·HCl | - | |
Z-D-N-Me-Val-OH | - | |
DHP Linker | 3749-36-8 | |
HMBA Linker | 3006-96-0 | |
HMP Linker | 68858-21-9 | |
Ramage Linker, Fmoc-Suberol | 212783-75-0 | |
Rink Amide Linker | 145069-56-3 | |
Sieber Linker | 3722-51-8 | |
Weinreb Linker | - | |
Fmoc-Ala-Wang resin | - | |
H-Ala-2-Chlorotrityl Resin | - | |
Fmoc-Arg(Pbf)-Wang resin | - | |
H-Arg(Pbf)-2-Chlorotrityl Resin | - | |
Fmoc-Asn(Trt)-Wang resin | - | |
H-Asn(Trt)-2-Chlorotrityl Resin | - | |
H-Asn-2-Chlorotrityl Resin | - | |
Fmoc-Asp(OtBu)-Wang resin | - | |
H-Asp(OtBu)-2-Chlorotrityl Resin | - | |
AminOMethyl Polystyrene Resin | - | |
Fmoc-Cys(Acm)-Wang resin | - | |
Fmoc-Cys(Trt)-Wang resin | - | |
H-Cys(Acm)-2-Chlorotrityl Resin | - | |
H-Cys(Trt)-2-Chlorotrityl Resin | - | |
2-Chlorotrityl Chloride Resin | - | |
DHP HM Resin | - | |
Fmoc-Gln(Trt)-Wang resin | - | |
H-Gln(Trt)-2-Chlorotrityl Resin | - | |
H-Gln-2-Chlorotrityl Resin | - | |
Fmoc-Glu(OtBu)-Wang resin | - | |
H-Glu(OtBu)-2-Chlorotrityl Resin | - | |
H-Glu-2-Chlorotrityl Resin | - | |
Fmoc-Gly-Wang resin | - | |
H-Gly-2-Chlorotrityl Resin | - | |
Fmoc-His(Trt)-Wang resin | - | |
H-His(Trt)-2-Chlorotrityl Resin | - | |
HMPA-AM Resin | - | |
Hydroxymethyl Resin | - | |
Fmoc-Ile-Wang resin | - | |
H-Ile-2-Chlorotrityl Resin | - | |
Knorr-2-Chlorotrityl Resin | - | |
Fmoc-Leu-Wang resin | - | |
H-Leu-2-Chlorotrityl Resin | - | |
Fmoc-Lys(Boc)-Wang resin | - | |
H-Lys(Boc)-2-Chlorotrityl Resin | - | |
Fmoc-Met-Wang resin | - | |
H-Met-2-Chlorotrityl Resin | - | |
MBHA Resin | - | |
Merrifield Resin | 70024-51-0 | |
Fmoc-1-Nal-Wang resin | - | |
Fmoc-2-Nal-Wang resin | - | |
Oxime Resin | - | |
Fmoc-Phe(4-Cl)-Wang resin | - | |
Fmoc-Phe(4-F)-Wang resin | - | |
Fmoc-Phe(4-NO2)-Wang resin | - | |
Fmoc-Phe-Wang resin | - | |
H-Phe-2-Chlorotrityl Resin | - | |
Fmoc-Pro-Wang resin | - | |
H-Pro-2-Chlorotrityl Resin | - | |
Pam Resin | - | |
Polystyrene Resin | - | |
Rink Amide-AM Resin | - | |
Rink Amide-MBHA Resin | - | |
Fmoc-Ser(tBu)-Wang resin | - | |
H-Ser(tBu)-2-Chlorotrityl Resin | - | |
H-Ser(Trt)-2-Chlorotrityl Resin | - | |
Sieber Amide Resin | - | |
Fmoc-Thr(tBu)-Wang resin | - | |
Fmoc-Threoninol(tBu) DHP HM Resin | - | |
Fmoc-Thr-Wang Resin | - | |
H-Thr(tBu)-2-Chlorotrityl Resin | - | |
H-Thr(Trt)-2-Chlorotrityl Resin | - | |
Fmoc-Trp(Boc)-Wang resin | - | |
Fmoc-Trp-Wang resin | - | |
H-Trp(Boc)-2-Chlorotrityl Resin | - | |
H-Trp-2-Chlorotrityl Resin | - | |
Fmoc-Tyr(tBu)-Wang resin | - | |
H-Tyr(tBu)-2-Chlorotrityl Resin | - | |
H-Tyr(Trt)-2-Chlorotrityl Resin | - | |
Fmoc-Val-Wang resin | - | |
H-Val-2-Chlorotrityl Resin | - | |
Wang Resin | - | |
Weinreb AM Resin | - | |
Fmoc-D-Ala-Wang resin | - | |
Fmoc-D-His(Trt)-Wang resin | - | |
Fmoc-D-Ile-Wang resin | - | |
DMT-T | 40615-39-2 | |
5-Bromosalicylic acid | 89-55-4 | |
3-Bromobenzaldehyde | 3132-99-8 | |
N-Bromosuccinimide (NBS) | 128-08-5 | |
Oxalic acid, anhydrous | 144-62-7 | |
2-Thiopheneacetic acid chloride (2-Thiopheneacetyl chloride) | 39098-97-0 | |
tert-Butyl bromoacetate | 5292-43-3 | |
2'-Chloroacetophenone | 2142-68-9 | |
N,N-Dichlorobenzenesulfonamide | 473-29-0 | |
4-Acetylbiphenyl | 92-91-1 | |
2,5-Dichlorothiophene | 3172-52-9 | |
Trichloroacetyl chloride (TCAC) | 76-02-8 | |
(2-Bromoethyl)benzene (Phenethyl bromide) 2-Phenylethylbromide | 103-63-9 | |
1,6-Dibromohexane | 629-03-8 | |
Methyl 2-chloropropionate (ACPA Me) | 17639-93-9 | |
2-Cyanopyridine (Picolinonitrile) | 100-70-9 | |
3-Cyanopyridine (Nicotinonitrile) | 100-54-9 | |
3,5-Lutidine (3,5-Dimethylpyridine) | 591-22-0 | |
3-Picoline (Beta-Picoline, 3-Methylpyridine) | 108-99-6 | |
2-Picolinic acid (Pyridine-2-carboxylic acid) | 98-98-6 | |
2-Chloroethylamine HCl | 870-24-6 | |
L-Alanyl-L-proline | 13485-59-1 | |
Magnesium Ascorbate PCA [VITACEDONE®] | 150409-23-7 | |
N,N-Diisopropylethylenediamine (2-(Diisopropylamino)ethylamine] | 121-05-1 | |
D(-)-Ribose | 50-69-1 | |
2-Thiopheneacetonitrile | 20893-30-5 | |
Chlorodifluoroacetyl chloride (CDFAC) | 354-24-5 | |
6-Hydroxynicotinic acid | 5006-66-6 | |
Ciclopirox Olamin | 41621-49-2 | |
Benzyl bromoacetate | 5437-45-6 | |
Dimethylamine HCl | 506-59-2 | |
2-Chloro-3-aminopyridine | 6298-19-7 | |
alpha-Pinene epoxide | 1686-14-2 | |
D-(+)-Galactose | 59-23-4 | |
2-Bromo-2-methylpropionyl bromide | 20769-85-1 | |
Ethyl 2-bromolaurate (Ethyl 2-bromododecanoate) | 6974-87-4 | |
1-Phenylethyl bromide | 585-71-7 | |
3-Chloro-1-propanol | 627-30-5 | |
2-Acetylbenzofurane | 1646-26-0 | |
Anthranilic acid n-butyl ester | 7756-96-9 | |
Benzilic acid | 76-93-7 | |
4-Bromoacetophenone | 99-90-1 | |
3-Bromobenzoic acid | 585-76-2 | |
4-Bromobenzoic acid | 586-76-5 | |
4-Bromobenzonitrile | 623-00-7 | |
4-Bromo-2-propylthiophene | 36155-79-0 | |
5-Bromofuroic acid | 585-70-6 | |
3-Bromo-4-hydroxybenzonitrile | 2315-86-8 | |
3'-Bromopropiophenone | 19829-31-3 | |
4'-Chloropropiophenone | 6285-05-8 | |
4-Chloro-alpha-cyanoacetanilide | 17722-17-7 | |
Citronellalnitrile | 51566-62-2 | |
Cinchophen | 132-60-5 | |
Cinnamonitrile | 1885-38-7 | |
3,5-Dibromo-4-hydroxybenzoic acid | 3337-62-0 | |
3,5-Dibromoanthranilic acid methyl ester | 606-00-8 | |
N-(2-Chlorobenzyloxycarbonyloxy)succinimide [Z(2-Cl)-ONSu] | 65853-65-8 | |
3,4-Dihydroxybenzaldehyde (Protocatechuic aldehyde) | 139-85-5 | |
3,4-Dimethoxyacetophenone | 1131-62-0 | |
3,3-Diphenylpropionitrile | 2286-54-6 | |
2-Ethylbenzofuran | 3131-63-3 | |
4-Ethylbenzophenone | 18220-90-1 | |
Ethylglycol bromoacetate | 56521-73-4 | |
Fenofibrate | 49562-28-9 | |
2-Furanacrylic acid [3-(2-Furyl)acrylic acid] | 539-47-9 | |
2-Furoic acid (Furan-2-carboxylic acid) | 88-14-2 | |
3-Hydroxyacetophenone | 121-71-1 | |
4-Hydroxybenzophenone | 1137-42-4 | |
2-Hydroxypropiophenone | 610-99-1 | |
4-Hydroxyvalerophenone | 2589-71-1 | |
Lauryl nitrile | 2437-25-4 | |
2-Chloro-3-cyanopyridine (2-Chloronicotinonitrile) | 6602-54-6 | |
3-Methoxyacetophenone | 586-37-8 | |
4-Methoxypropiophenone | 121-97-1 | |
3,4-Methylenedioxybenzonitrile (Piperonyl nitrile) | 4421-09-4 | |
4-Methylacetophenone | 122-00-9 | |
N-Methylanthranilic acid methyl ester | 85-91-6 | |
3-Methylvaleric acid | 105-43-1 | |
2-Phenylbutyronitrile | 69350-73-8 | |
5-Phenylvaleric acid | 2270-20-4 | |
Piperonyl acetone [4-(3,4-Methylenedioxyphenyl)-2-butanone] | 55418-52-5 | |
Piperonylic acid | 94-53-1 | |
Methylsuccinic acid | 498-21-5 | |
2-Thienylacetic acid (Thiophene-2-acetic acid) | 1918-77-0 | |
Thiophene-2-carbonitrile | 1003-31-2 | |
Tiglic acid | 80-59-1 | |
p-Tolyl nitrile | 104-85-8 | |
alpha-Methyl cyclopentenolone (Maple Lactone) | 80-71-7 | |
N-(4-Hydroxyphenyl)-glycine | 122-87-2 | |
Arbutin | 497-76-7 | |
2,3-Lutidine (2,3-Dimethylpyridine) | 583-61-9 | |
Sodium bromide | 7647-15-6 | |
3-Carbomethoxypropionyl chloride | 1490-25-1 | |
Phenoxyethyl chloride | 622-86-6 | |
2-Bromo-3,3-diethoxy-1-propene | 17592-40-4 | |
3-Hydroxypyridine | 109-00-2 | |
3-(Aminomethyl)pyridine (3-Picolylamine) | 3731-52-0 | |
2-(Aminomethyl)pyridine (2-Picolylamine) | 3731-51-9 | |
3-(Chloromethyl)pyridine HCl (3-Picolyl chloride HCl) | 6959-48-4 | |
3-Hydroxy-2-nitropyridine | 15128-82-2 | |
4-Aminophenylacetic acid | 1197-55-3 | |
Indole-3-carboxaldehyde | 487-89-8 | |
3S-3-Methylmorpholine | 350595-57-2 | |
2-Amino-3-methylpyridine | 1603-40-3 | |
2-Amino-5-methylpyridine | 1603-41-4 | |
Pyridine-2-carboxaldehyde | 1121-60-4 | |
2-(Hydroxymethyl)pyridine | 586-98-1 | |
2-(Chloromethyl)pyridine HCl | 6959-47-3 | |
3-(Hydroxymethyl)pyridine | 100-55-0 | |
Pyridine-3-carboxaldehyde | 500-22-1 | |
4-Aminopyridine | 504-24-5 | |
4-Chloropyridine HCl | 7379-35-3 | |
Xanthene 9-carboxylic acid | 82-07-5 | |
Methyl trans-3-(4-methoxyphenyl)glycidate | 42245-42-1 | |
(R)-(+)-1-(3-Methoxyphenyl)ethylamine | 88196-70-7 | |
Lithium diisopropylamide in ethylbenzene | 4111-54-0 | |
S(+)-2,2-Dimethyl-1,3-dioxolane-4-methanol [S(+) SOLKETAL] | 22323-82-6 | |
N-Boc-4-(trifluoromethyl)-L-phenylalanine (Boc-Phe (4-CF3)-OH) | 114573-07-3 | |
3-Cyanopropionaldehyde propyleneglycol acetal (1,3-Dioxane-2-propanenitrile) | 80692-35-9 | |
2-Bromo-4-chloroaniline | 873-38-1 | |
3-Chloropropiophenone | 34841-35-5 | |
gamma-Chlorobutyrophenone | 939-52-6 | |
1,2,4-Trihydroxybenzene | 533-73-3 | |
Triisopropyl phosphite | 116-17-6 | |
"2,6-Dimethylpiperidine; 2,6-Lupeptidine" | 504-03-0 | |
Boc-2-Aminoisobutyric Acid-D-Tryptophan (Boc-Aib-D-Trp-OH) | 159634-94-3 | |
2-Chloronicotinic acid | 2942-59-8 | |
2-Chloro-4-nitrobenzoic acid | 99-60-5 | |
N-Methyl-N-[2-(2-pyridyl)ethyl]amine 2HCl | 5638-76-6 | |
2-Propylpentanoic acid | 99-66-1 | |
(R)-N-Acetyl-3,4-dimethoxyphenylalanine | 33043-37-7 | |
(R,S)-N-Acetyl-3,4-dimethoxyphenylalanine | 27313-65-1 | |
(N-Benzyl-N-methyl)-3-aminopropyl chloride HCl | 5814-44-8 | |
1-[4-[2-(Dimethylamino)ethoxy]phenyl]-2-phenylbutanone (DMA Dipone) | 68047-07-4 | |
Indole-3-carboxylic acid | 771-50-6 | |
N-Methylindole-3-carboxylic acid | 32387-21-6 | |
D-Cyclohexylalanine | 58717-02-5 | |
Sodium phenolsulfonate (4-Hydroxybenzenesulfonic acid sodium salt dihydrate) | 10580-19-5 | |
Disodium 5'-Inosinate | 4691-65-0 | |
Disodium 5'-Guanylate | - | |
6B-Base (3-Hydroxy-4'-methyldiphenylamine) | 61537-49-3 | |
6-Chloro-3-cyanopyridine (6-Chloronicotinonitrile) | 33252-28-7 | |
Bromoacetyl bromide | 598-21-0 | |
Phenylhydrazine | 100-63-0 | |
5-Nitroindole-2-carboxylic acid ethyl ester | 16732-57-3 | |
D-2-Thienylalanine [3-(2-Thienyl-D-alanine] | 139-86-6 | |
L-3-Pyridylalanine.2HCl [3-(3-Pyridyl)-L-alanine.2HCl] | - | |
L-2-Thienylalanine [3-(2-Thienyl)-L-alanine] | 22951-96-8 | |
Nervanaid FF (Diethanolglycine sodium salt solution) | - | |
Butyryl chloride | 141-75-3 | |
2-Ethylhexanoyl chloride | 760-67-8 | |
Neodecanoyl chloride | 40292-82-8 | |
Pivaloyl chloride | 3282-30-2 | |
Cinnamoyl chloride | 102-92-1 | |
2-Methylbutyric acid | 116-53-0 | |
4-Nitrophthalic acid | 610-27-5 | |
4-Nitrophthalic acid anhydride | 5466-84-2 | |
Ethyl butyrylacetate | 3249-68-1 | |
5-Aminoisophthalic acid | 99-31-0 | |
1,5-Hexadiene (siehe Bemerkungen) | 592-42-7 | |
Trimethylsilylmethyllithium (TMSMLi) in Hexane | 1822-00-0 | |
Cholesteryl chloride | 910-31-6 | |
Fmoc-3-(2-pyridyl)-L-alanine (Fmoc-L-3-PAL) | 185379-40-2 | |
2,4-Dichloropyrimidine | 3934-20-1 | |
4-Aminobutyric acid (= H-GABA-OH) | 56-12-2 | |
n-Butylboronic acid | 4426-47-5 | |
4-Carboxybenzaldehyde | 619-66-9 | |
4-Carboxyphenylboronic acid | 14047-29-1 | |
4-Chlorophenylboronic acid | 1679-18-1 | |
4-Fluorophenylboronic acid | 1765-93-1 | |
4-Methoxyphenylboronic acid | 5720-07-0 | |
1-Naphthylboronic acid | 13922-41-3 | |
Phenylboronic acid | 98-80-6 | |
4-Tolylboronic acid | 5720-05-8 | |
4-Chloro-2,6-dinitrophenol | 88-87-9 | |
Diethyl 2-ethyl-2-sec-butylmalonate | 76-71-1 | |
Dimethyl maleate | 624-48-6 | |
m-Phenylenedimaleimide | 3006-93-7 | |
p-Toluic acid | 99-94-5 | |
o-Tolylboronic acid | 16419-60-6 | |
2-Thiopheneboronic acid | 6165-68-0 | |
Methylamine HCl | 593-51-1 | |
Phenylacetic acid ethyl ester | 101-97-3 | |
2-Bromoisobutyric acid isopropyl ester | 51368-55-9 | |
4-Bromopyridine HCl | 19524-06-2 | |
Pyridine-4-carboxaldehyde | 872-85-5 | |
2-Chloro-3-nitropyridine | 5470-18-8 | |
Various Amino Acids | - | |
4-Amino-3-hydroxybutyric acid (H-GABOB-OH) | 924-49-2 | |
4-Picoline-N-oxide | 1003-67-4 | |
3-Hydroxy-6-methyl-2-nitropyridine | 15128-90-2 | |
(+)-Pseudoephedrine HCl | 345-78-8 | |
Ethyl isovalerate | 108-64-5 | |
Ethyl anthranilate | 87-25-2 | |
(R)-(+)-1-(4-Bromophenyl)ethylamine | 45791-36-4 | |
(R)-(+)-1-(4-Bromophenyl)ethylamine HCl | 64265-77-6 | |
(S)-(-)-1-(3-Methoxyphenyl)ethylamine | 82796-69-8 | |
(+)-Bis[(R)-1-phenylethyl)]amine HCl | 23294-41-9 | |
(-)-Bis[(S)-1-phenylethyl)]amine HCl | 56210-72-1 | |
(S)-(-)-1-(4-Bromophenyl)ethylamine | 27298-97-1 | |
2-(1-Cyclohexenyl)ethylamine | 3399-73-3 | |
(R)-(+)-1-Phenylpropylamine | 3082-64-2 | |
Boc-D-valine methyl ester | 106391-85-9 | |
Stearoyl chloride | 112-76-5 | |
Pindolol | 13523-86-9 | |
Acetanilide | 103-84-4 | |
3-Bromo-2,3,4,5-tetrahydro-2-oxo-[1H]-benzazepine (Brom-benzazepinon) | 86499-96-9 | |
Ethyl 3-amino-4,4,4-trifluorocrotonate | 372-29-2 | |
Pyridine hydrochloride | 628-13-7 | |
Chlorodifluoroacetic acid ethyl ester (CDFAEt) | 383-62-0 | |
Chlorodifluoroacetic acid methyl ester (CDFAMe) | 1514-87-0 | |
Propargyl bromide (80 % in Toluene) | 106-96-7 | |
L-Alaninamide HCl | 33208-99-0 | |
3-Picoline-N-oxide | 1003-73-2 | |
Boc-sarcosine methyl ester | 42492-57-9 | |
2-Bromopropionyl bromide | 563-76-8 | |
Bromoacetaldehyde diethyl acetal | 2032-35-1 | |
Fmoc-L-4,4'-Biphenylalanine | - | |
Cacodylic acid | 75-60-5 | |
L-(+)-Rhamnose monohydrate (6-deoxy-L-mannose, Isodulcit) | 10030-85-0 | |
Thiophene | 110-02-1 | |
TCTU O-(1H-6-Chlorobenzotriazole-1-yl)-N,N,N',N'-tetramethyluronium tetrafluoroborate | 330641-16-2 | |
6,7-bis(2-Methoxyethoxy)-4-quinazolinol | 179688-29-0 | |
Lithium tert-butoxide (2 M in THF) | 1907-33-1 | |
Tri-tert-butylphosphine | 13716-12-6 | |
N,N-Dimethylformamide dimethyl acetal | 4637-24-5 | |
trans-4-Hydroxycinnamic acid (p-Coumaric acid) | 501-98-4 | |
D-Cyclohexylglycine | 14328-52-0 | |
Nicotinamide (Niacinamide) | 98-92-0 | |
Decene-1-oxide | 2404-44-6 | |
Ethyl 2-oxo-4-phenylbutyrate (Ethyl 2-oxo-4-phenylbutanoate) | 64920-29-2 | |
Acetobromo-alpha-D-galactose [2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl bromide] | 3068-32-4 | |
2,4-Dimethoxybenzylamine | 20781-20-8 | |
Amantadine hydrochloride (1-Adamantylamine hydrochloride) | 665-66-7 | |
4-(Trifluoromethyl)aniline (4-Aminobenzotrifluoride) | 455-14-1 | |
1,4-Dibromobutane | 110-52-1 | |
Musk moskene cryst, 4,6-Dinitro-1,1,3,3,5-pentamethylindane | 116-66-5 | |
Methyl bromoacetate | 96-32-2 | |
N-Methyl-N-(napht-1-ylmethyl)-ammonium acetate (MENAM acetate) | - | |
1-Methylnaphthalene | 90-12-0 | |
2-Methylnaphthalene | 91-57-6 | |
1,4-Dimethylnaphthalene | 1571-58-4 | |
2-Naphthaldehyde | 66-99-9 | |
1-Naphthaldehyde | 66-77-3 | |
2,3-Dihydroxynaphthalene | 92-44-4 | |
Quinoline | 91-22-5 | |
2-Methylquinoline (Quinaldine) | 91-63-4 | |
Quinoline-2-carboxylic acid (Quinaldic acid) | 93-10-7 | |
2,3-Pyridinedicarboxylic acid | 89-00-9 | |
2,3-Dimethylphenol, 2,3-Xylenol | 526-75-0 | |
3,4-Dimethylphenol (3,4-Xylenol) | 95-65-8 | |
Boc-D-2-Aminobutyric acid | 45121-22-0 | |
2,7-Dimethylnaphthalene | 582-16-1 | |
1,4-Naphthalenedicarboxylic acid | 605-70-9 | |
2,3-Naphthalenedicarboxylic acid | 2169-87-1 | |
2,6-Naphthalenedicarboxylic acid | 1141-38-4 | |
Dimethyl-2,7-naphthalenedicarboxylate | 2549-47-5 | |
2,3-Dicyanonaphthalene | 22856-30-0 | |
2-Bromonaphthalene | 580-13-2 | |
2-Naphthalenethiol | 91-60-1 | |
2-Bromo-6-methylnaphthalene | 37796-78-4 | |
2-Bromo-6-methoxynaphthalene | 5111-65-9 | |
6-Methoxy-2-naphthaldehyde | 3453-33-6 | |
2-Hydroxy-1-naphthaldehyde | 708-06-5 | |
6-Bromo-2-naphthoic acid | 5773-80-8 | |
1,3-Dibromopropane | 109-64-8 | |
1,2,3,4-Tetrahydro-2-naphthoic acid | 53440-12-3 | |
Methyl-1,2,3,4-tetrahydro-1-naphthoate | 17502-86-2 | |
1,1,4,4-Tetramethyl-1,2,3,4-tetrahydronaphthalene | 6683-46-1 | |
2-Naphthyl benzoate | 93-44-7 | |
N-n-Butyl-1,8-naphthalimide | 6914-62-1 | |
4-Methylquinoline (Lepidine) | 491-35-0 | |
trans-4-(4-Bromophenyl)cyclohexyl acetic acid methyl ester | - | |
3-Bromoquinoline | 5332-24-1 | |
5-Nitroquinoline | 607-34-1 | |
1-(1-Ethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | 1029716-44-6 | |
2,3-Dibromosuccinic acid (meso) | 608-36-6 | |
4-Formylphenyl boronic acid | 87199-17-5 | |
8-Quinolinol (8-Hydroxyquinoline) | 148-24-3 | |
5,6,7,8-Tetrahydroquinoline | 10500-57-9 | |
Decahydroquinoline, mixture of cis and trans | 2051-28-7 | |
Quinoline-N-oxide | 1613-37-1 | |
6-Methoxyquinaldine (6-Methoxy-2-methylquinoline) | 1078-28-0 | |
6-Ethoxyquinaldine (6-Ethoxy-2-methylquinoline) | 6628-28-0 | |
7-Chloroquinaldine (7-Chloro-2-methylquinoline) | 4965-33-7 | |
4-Chloromethylquinaldine | - | |
6-Hydroxy-3,4-dihydrocarbostyril | 54197-66-9 | |
Isoquinoline-1-carboxylic acid | 486-73-7 | |
5-Nitroisoquinoline | 607-32-9 | |
5-Aminoisoquinoline | 1125-60-6 | |
5,6,7,8-Tetrahydroisoquinoline | 36556-06-6 | |
Decahydroisoquinoline, mixture of cis and trans | 6329-61-9 | |
1-Methylindole | 603-76-9 | |
2-Methylindole | 95-20-5 | |
Indole-3-methanol | 700-06-1 | |
3-Indolepropionic acid | 830-96-6 | |
7-Nitroindole | 6960-42-5 | |
Boc-D-2-Thienylalanine | 78452-55-8 | |
6-Nitro-1-indanone | - | |
1,2-Indandiol | 4647-43-2 | |
2-Biphenylcarboxylic acid | 947-84-2 | |
4-Cyanobiphenyl | 2920-38-9 | |
Thiophene-3-methanol | 71637-34-8 | |
2,3,6-Trimethylphenol | 2416-94-6 | |
Isobutylboronic acid | 84110-40-7 | |
Phthalazine | 253-52-1 | |
Dimethyl-5-hydroxyisophthalate | - | |
1,3-Dimethyladamantane | 702-79-4 | |
2-Methylfuran | 534-22-5 | |
1,2,3,4-Tetrahydroquinoline | 635-46-1 | |
Methyl 3-oxohexanoate (Methyl butyrylacetate) | 30414-54-1 | |
N-Methylbenzamide | 613-93-4 | |
alpha-Campholenic aldehyde | 4501-58-0 | |
1-Octadecene oxide (1,2-Epoxyoctadecane) | 7390-81-0 | |
1,5-Dihydroxypentane-1,5-disulfonic acid dipotassium salt | 68310-08-7 | |
Phosphorous acid (Phosphonic acid ) | 13598-36-2 | |
Dipotassium hydrogenphosphite | 13492-26-7 | |
Potassium dihydrogenephosphite | 13977-65-6 | |
Acetyl chloride | 75-36-5 | |
Isononanoyl chloride (3,5,5-Trimethylhexanoyl chloride) | 36727-29-4 | |
1-Octene oxide (1,2-Epoxyoctane) | 2984-50-1 | |
Cyclopropyl methyl ketone (CPMK) | 765-43-5 | |
"Hexadecene-1-oxide; (1,2-Epoxyhexadecane)" | 7320-37-8 | |
alpha-Cedreneoxide | 13567-39-0 | |
Linalool oxide (62141) | 60047-17-8 | |
Calcium peroxide hydrate | 1305-79-9 | |
3,5-Bis(trifluoromethyl)bromobenzene | 328-70-1 | |
3,5-Bis(trifluoromethyl)benzoyl chloride | 785-56-8 | |
3',5'-Bis(trifluoromethyl)acetophenone | 30071-93-3 | |
3,5-Bis(trifluoromethyl)benzaldehyde | 401-95-6 | |
3,5-Bis(trifluoromethyl)benzoic acid | 725-89-3 | |
Boc-D-4-Bromophenylalanine (Boc-D-Phe(4-Br)-OH | 79561-82-3 | |
3,5-Bis(trifluoromethyl)benzyl bromide | 32247-96-4 | |
3,5-Bis(trifluoromethyl)phenylacetic acid | 85068-33-3 | |
Ethyl bromoacetate | 105-36-2 | |
1-Amino-4-bromonaphthalene | 2298-07-9 | |
9-Anthraldehyde | 642-31-9 | |
D-3,3-Diphenylalanine | 149597-91-1 | |
Fmoc-L-Lysine(IP/Boc) | - | |
L-tert-Leucinol | 112245-13-3 | |
Fmoc-L-4-Bromophenylalanine (Fmoc-Phe(4-Br)-OH) | 198561-04-5 | |
1-Hydroxybenzotriazole hydrate (HOBT) | 123333-53-9 | |
2-Bromopyridine | 109-04-6 | |
8-Chlorooctanoic acid ethyl ester | 105484-55-7 | |
2,2'-Azobis(2,4-dimethylvaloronitrile) (ADVN) | 4419-11-8 | |
Tetrazolyl-biphenyl-valinesteramide / Valsartan Step 9 | - | |
N,N-Diethylethylenediamine | 100-36-7 | |
1-Phenyl-2-thiourea | 103-85-5 | |
2',5'-Dimethoxyacetophenone | 1201-38-3 | |
4-Chlorophenyl isocyanate | 104-12-1 | |
2,3-Dichloropyrazine | 4858-85-9 | |
Boc-L-3,5-Difluorophenylalanine (Boc-Phe(3,5-F2)-OH) | 205445-52-9 | |
1,3-Difluorobenzene | 372-18-9 | |
Lithium Borohydride | 16949-15-8 | |
PHG-C | - | |
Benzophenone | 119-61-9 | |
Diethyl ketone, 3-Pentanone | 96-22-0 | |
2-Chloro-3',4'-dimethoxybenzil | 56159-70-7 | |
3-Chlorobenzoic acid | 535-80-8 | |
Fmoc-D-4-Aminophenylalanine(t-Butyl-Cbm) (Fmoc-(D)-Aph(tBuCbm)-OH) | - | |
2,4-Dichloro-trifluoromethylbenzene | 320-60-5 | |
1,4-Bis(trifluoromethyl)benzene, p-Xylene hexafluoride | 433-19-2 | |
4-Methylbenzotrifluoride | 6140-17-6 | |
3,4,5-Trichlorobenzotrifluoride | 50594-82-6 | |
2-Chlorobenzotrifluoride | 88-16-4 | |
3,5-Dinitrobenzotrifluoride | 401-99-0 | |
2,4,Dichloro-3,5-dinitrobenzotifluoride | 29091-09-6 | |
3-Nitrobenzotrifluoride | 98-46-4 | |
Methyl phenylacetate | 101-41-7 | |
4-Chloro-3,5-dinitrobenzotrifluoride | 393-75-9 | |
3,5-Bis(trifluoromethyl)phenol | 349-58-6 | |
3-(Trifluoromethyl)benzyl chloride | 705-29-3 | |
2-Nitro-4-(trifluoromethyl)aniline, 4-Amino-3-nitrobenzotrifluoride | 400-98-6 | |
4-Nitro-2-(trifluoromethyl)aniline, 2-Amino-5-nitrobenzotrifluoride | 121-01-7 | |
2-(Trifluoromethyl)benzoic acid | 433-97-6 | |
3-(Trifluoromethyl)benzoic acid | 454-92-2 | |
4-(Trifluoromethyl)benzoic acid | 455-24-3 | |
4-Chloro-1-nitro-2-(trifluoromethyl)benzene, 5-Chloro-2-nitrobenzotrifluoride | 118-83-8 | |
4-Chloro-3-(trifluoromethyl)aniline, 5-Amino-2-chlorobenzotrifluoride | 320-51-4 | |
2,6-Dichloro-4-(trifluoromethyl)aniline | 24279-39-8 | |
2-Nitro-4-trifluoromethylphenol | 400-99-7 | |
2-Fluoro-5-trifluoromethylaniline, 3-Amino-2-fluorobenzotrifluoride | 535-52-4 | |
5-Fluoro-2-nitroanisole | 448-19-1 | |
2-Amino-5-fluorobenzotrifluoride | - | |
4-(Trifluoromethyl)salicylic acid | - | |
3-(Trifluoromethyl)benzyl alcohol | - | |
Ethyl Methyl Disulphide | 20333-39-5 | |
3-(Trifluoromethyl)phenylacetic acid | - | |
5-Bromo-2-chlorobenzotrifluoride | 445-01-2 | |
4-Fluorobenzotrifluoride | - | |
Sulfolane | 126-33-0 | |
4-Chlorobenzhydryl chloride | 134-83-8 | |
1-(Diphenylmethyl)piperazine, 1-Benzhydrylpiperazine | 841-77-0 | |
1-(4'-Chlorodiphenylmethyl)piperazine | - | |
3-Methyl-3-butenoic acid, Senecioic acid | 541-47-9 | |
1-Methylpiperazine | 109-01-3 | |
Boc-L-3-Cyanophenylalanine | 131980-30-8 | |
2-Piperazinoethylamine (1-(2-Aminoethyl)piperazine) | 140-31-8 | |
1-Amino-4-methylpiperazine | 6928-85-4 | |
1-Benzylpiperazine dihydrochloride | 72878-35-7 | |
1-(4-Chlorobenzhydryl)piperazine | 303-26-4 | |
1-(3-Chlorophenyl)piperazine hydrochloride | 65369-76-8 | |
1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride | - | |
1-(2-Methoxyphenyl)piperazine | 35386-24-4 | |
1-Methyl-3-phenylpiperazine | - | |
1-(4-Nitrophenyl)-4-(4-methoxyphenyl)piperazine | - | |
1-(3-Trifluoromethylphenyl)piperazine | - | |
4-(2-Hydroxyethyl)morpholine | 622-40-2 | |
4-Cyano-2-methyl-1-(2-nitrophenylamino)thiophene | 138564-59-7 | |
4-Amino-2-methyl-10H-thieno[2,3B](1,5)benzodiazepine mono HCl | 138561-60-0 | |
2-Hydroxymethyl-4-(3-methoxypropoxy)-3-methyl pyridine HCl | 118175-10-3 | |
2-({[4-(3-Methoxypropoxy)-3-methyl pyridine-2-yl]methyl}thio)1-H-benzimidazole | 117977-21-6 | |
Cbz-L-Leucine-OSu | 3397-35-1 | |
N-[3-(3-Dimethylamino-1-oxo-2-propenyl)phenyl] N-ethylacetamide | 96605-66-2 | |
Furfurylamine | 617-89-0 | |
3-(Methylamino)propylamine | 6291-84-5 | |
N,N-Bis(3-aminopropyl)methylamine (Methyliminobispropylamine) | 105-83-9 | |
4-Chlorobenzhydrol | 119-56-2 | |
Chlorodiphenylmethane | 90-99-3 | |
4'-Chloropropiophenone | 6585-05-8 | |
Benzhydrol (Diphenyl carbinol) | 91-01-0 | |
1-Bromo-4-chlorobenzene | 106-39-8 | |
Diphenhydramine | 58-73-1 | |
Bromoacetaldehyde dimethyl acetal | 7252-83-7 | |
4-Bromobenzophenone | 90-90-4 | |
3-Methoxypropylamine | 5332-73-0 | |
3-Ethoxypropylamine | 6291-85-6 | |
Dicyclohexylamine | 101-83-7 | |
3-(Dimetylamino)propylamine | 109-55-7 | |
(S)-(-)-Cyclohexyl Mandelic Acid (S-CHMA) | - | |
Stearamide | 124-26-5 | |
Propylamine | 107-10-8 | |
N-Methylcyclohexylamine | 100-60-7 | |
3,4-Dimethoxyphenylacetonitrile (Veratryl cyanide) | 93-17-4 | |
Homoveratric acid | 93-40-3 | |
Veratryl alcohol, 3,4-Dimethoxybenzylalcohol | 93-03-8 | |
5-Aminobenzimidazole | 934-22-5 | |
4-Methylcyclohexanone | 589-92-4 | |
1-Aminohydantoin HCl | 2827-56-7 | |
Sodium cyanoborohydride | 25895-60-7 | |
Biphenylaldehyde, 2'-(1H-Tetrazol-5-yl)-1,1'-biphenyl-4-carbaldehyde | 151052-40-3 | |
1-Hydrox-1H-1,2,3-Triazole-4-carboxylate (HOCT) | 137156-41-3 | |
5-(4-Nitrophenyl)furfural | 7147-77-5 | |
2-Dimethylaminoethyl chloride HCl (DMC) | 4584-46-7 | |
Di-tert-Butylphosphine | 819-19-2 | |
Bis-(3,5 di-(trifluoromethyl)phenyl) phosphine | 166172-69-6 | |
Creatine monohydrate | 6020-87-7 | |
Ethyl 3-N-Methylamino-4,4,4-trifluorocrotonate | 121303-76-2 | |
2,6-Pyridinedicarboxylic acid, Dipicolinic acid | 499-83-2 | |
Fmoc-L-t-Hydroxyproline (BCC)-OH | 187223-15-0 | |
(-)-Ephedrine | 299-42-3 | |
(l)-Ephedrine hemihydrate | 50906-05-3 | |
(d)-Pseudoephedrine | 90-82-4 | |
(+)-Ephedrine hydrochloride | 24221-86-1 | |
(d)-Ephedrine Hemihydrate | 144429-10-7 | |
(l)-Pseudoephedrine Hydrochloride | 670-40-6 | |
(l)-Pseudoephedrine | 321-97-1 | |
(l)-Norephedrine hydrochloride | 3198-15-0 | |
L-(-)-Norephedrine | 492-41-1 | |
N-Tetramethylene-(l)-norephedrine hydrochloride | 210558-66-0 | |
D-(+)-Norephedrine hydrochloride | 40626-29-7 | |
N-Tetramethylene-(d)-norephedrine hydrochloride | 123620-80-4 | |
(d)-Norpseudoephedrine hydrochloride | 2153-98-2 | |
(l)-Norpseudoephedrine hydrochloride | 53643-20-2 | |
(4R,5S)-(+)-4-Methyl-5-phenyl-2-oxazolidinone | 77943-39-6 | |
(4S,5R)-(-)-4-Methyl-5-phenyl-2-oxazolidinone | 16251-45-9 | |
(4S,5S)-(+)-4-Methyl-5-phenyl-2-oxazolidinone | 17097-67-5 | |
(4R,5R)-(+)-4-Methyl-5-phenyl-2-oxazolidinone | 125133-96-2 | |
(l)-Etafedrine hydrochloride | 5591-29-7 | |
2-Methyl cinnamic alcohol | 1504-55-8 | |
2-Methyl-3-phenyl-2-propenal (trans) | 101-39-3 | |
4-(4-Methyl-3-penten-1-yl)-3-cyclohexene-1-nitrile, AZURIL | 68084-04-8 | |
2,7-Dimethyloct-5-en-4-one in isopropylmyristate | 68419-46-5 | |
Mellol, 2-Phenylethanol | 60-12-8 | |
(1S)-(-)-Camphanoyl chloride | 39637-74-6 | |
4-Methoxycinnamic acid | 830-09-1 | |
Phenylacetylene | 536-74-3 | |
Sodium borohydride powder 98.5% | 16940-66-2 | |
Sodium borohydride granular 98.5%Min | 16940-66-2 | |
Sodium borohydride solution 12% | 16940-66-2 | |
Sodium borohydride solution 20% | 16940-66-2 | |
Sodium Hydride | 7646-79-7 | |
2-Octanone | 111-13-7 | |
n-Propylmagnesium chloride in diethylether | 2234-82-4 | |
Bis(4-Trifluoromethylphenyl) chlorophosphine (FPCP) | 13685-24-0 | |
Fmoc-D-4-Fluorophenylalanine | 177966-64-2 | |
Iodine | 7553-56-2 | |
N,N-Dibenzylethanolamine | 101-06-4 | |
Tripropylamine | 102-69-2 | |
Tributylamine | 102-82-9 | |
2-Ethyl-1-hexylamine | 104-75-6 | |
N,N-Diethyl-1,3-propanediamine | 104-78-9 | |
Diisopropylamine | 108-18-9 | |
Cyclohexylamine | 108-91-8 | |
Butylamine | 109-73-9 | |
1,3-Diaminopropane | 109-76-2 | |
Diethylamine | 109-89-7 | |
2-Ethoxyethylamine | 110-76-9 | |
N,N,N',N'-Tetramethyl-1,3-propanediamine | 110-95-2 | |
N,N-Dimethylglycine | 1118-68-9 | |
Dibutylamine | 111-92-2 | |
Bis(2-methoxyethyl)amine | 111-95-5 | |
Triethylamine | 121-44-8 | |
Dimethylamine | 124-40-3 | |
N-Ethylbutylamine | 13360-63-9 | |
N,N-Diethyl-m-toluamide (DEET) | 134-62-3 | |
Dipropylamine | 142-84-7 | |
3-Amino-1-propanol | 156-87-6 | |
3-Butoxypropylamine | 16499-88-0 | |
N,N-Diethyl-2-phenylacetamide | 2431-96-1 | |
Trans-4-methylcyclohexylamine | 2523-55-9 | |
N-Ethyl-N-(1,2-dimethylpropyl)amine | 2738-06-9 | |
N,N,N',N'',N''-Pentamethyldiethylenetriamine | 3030-47-5 | |
2-Thiopheneethylamine | 30433-91-1 | |
N,N-Diethylhydroxylamine | 3710-84-7 | |
N,N,N',N',N''-Pentamethyldipropylenetriamine | 3855-32-1 | |
p-Methyl-N,N,dimethylbenzylamine | 4052-88-4 | |
Diisopropylmethylamine | 4083-57-2 | |
3-(2-Ethylhexyloxy)propylamine | 5397-31-9 | |
N-Ethylcyclohexylamine | 5459-93-8 | |
Trimethylamine hydrochloride | 593-81-7 | |
2-Methylresorcinol | 608-25-3 | |
N-Ethylmethylamine | 624-78-2 | |
Dimethylamine hydrochloride | 660-68-4 | |
3,3'-Iminobis(N,N-dimethylpropylamine), | 6711-48-4 | |
N,N'-Dimethylpropylene urea (DMPU) | 7226-23-5 | |
Methylamine | 74-89-5 | |
Ethylamine | 75-04-7 | |
Trimethylamine | 75-50-3 | |
N,N-Diethylcyclohexylamine | 91-65-6 | |
N,N-Dimethylbutylamine | 927-62-8 | |
N,N-Dimethylcyclohexylamine | 98-94-2 | |
N,N-Dimethylisopropylamine, | 996-35-0 | |
Fmoc-L-3-(3-benzothienyl)-alanine (Fmoc-Bta-OH) | 177966-60-8 | |
Boc-N-methyl-L-phenylalanine (Boc-MePhe-OH) | 37553-65-4 | |
L-3-(3-benzothienyl)-alanine (Bta-OH) | 72120-71-9 | |
Trimethylphosphine (TMP) | 594-09-2 | |
Tri-tert-butylphosphonium tetrafluoroborate salt | 131274-22-1 | |
Di-tert-butylchlorophosphine (DTBCP) | 13716-10-4 | |
Di-tert-butylcyclohexylphosphine (DTBCyP) | 436865-11-1 | |
1,5-Dibromopentane | 111-24-0 | |
C24-28-Epoxide | - | |
2-Bromobutyryl bromide | 26074-52-2 | |
4-Nitrosodiphenylamine | 156-10-5 | |
Methyl-2-bromodecanoate | 7357-56-4 | |
Methyl-2-bromododecanoate (..laurate..) | 617-60-7 | |
Methyl 2-bromoisobutyrate | 23426-63-3 | |
Methyl-2-bromooctanoate (..caprylate..) | 5445-22-7 | |
2-Bromo-2-ethylbutyryl bromide | 26074-53-3 | |
2-Bromoisovaleric acid | 565-74-2 | |
Dicyclohexylamine nitrite (Dicyclohexylammonium nitrite) | 3129-91-7 | |
Potassium 2-ethyl hexanaote | 3164-85-0 | |
4-Chlorothiophene-2-carboxylic acid | 59614-95-8 | |
2-Methylnicotinic acid | 3222-56-8 | |
Epoxysuccinic acid disodium salt | 40618-18-6 | |
4-Methyl-2-thiophenecarboxylic acid | 14282-78-1 | |
Methyl-3-chloro-4-methyl-2-thiopene carboxylate | 175137-11-8 | |
5-Bromo-2-thiophenecarboxylic acid | 7311-63-9 | |
Methyl-5-bromo-2-thiophenecarboxylate | - | |
5-Methyl-2-thiophenecarboxylic acid | 1918-79-2 | |
4-Bromo-2-thiophenecarboxylic acid | 16694-18-1 | |
5-Bromo-4-methyl-2-thiophenecarboxylic acid | 54796-53-1 | |
Dimethyl-2,5-thiophenedicarboxylate | 4282-34-2 | |
4'-Ethyl-4-biphenylcarboxylic acid | 731-13-5 | |
4'-N,N-Dimethylamino-4-methoxybenzophenone | 1151-93-5 | |
Acrolein diethyl acetal | 3054-95-3 | |
2-(2-Aminoethyl)-1,3-dioxolane | 5754-35-8 | |
2-(2-Chloroethyl)-1,3-dioxolane | 4362-36-1 | |
5-Norbornene-2-methanol | 95-12-5 | |
Dimethyl 2-hydroxyethylphosphonate | 54731-72-5 | |
Diethyl cyanomethylphosphonate | 2537-48-6 | |
Dimethyl benzylphosphonate | 773-47-7 | |
3,4-Dihydroxybenzonitrile | 17345-61-8 | |
Thiophene-3-carbonitrile | 1691-09-4 | |
Boc-L-3-Nitrophenylalanine (Boc-Phe(3-NO2)-OH) | 131980-29-5 | |
5-Norbornene-2-carbonitrile | 95-11-4 | |
(E)-4-Cyanostilbene | 68331-40-8 | |
2-Methylthiophene | 554-14-3 | |
Ethyl 2-bromobutyrate | 533-68-6 | |
4-Bromo-2-thiophenecarboxaldehyde | 18791-75-8 | |
2-Acetyl-4-methylthiophene | 13679-73-7 | |
3-(Dimethylamino)-1-(2-thienyl)-propanone | 13196-35-5 | |
2,5-Dimethylbenzaldehyde | 5779-94-2 | |
(1-Bromo-allyl)-trimethyl-silane | 94397-40-7 | |
Ethyl 2-bromohexanoate (Ethyl 2-bromocaproate) | 615-96-3 | |
4-Bromophenylhydrazine HCl | 622-88-8 | |
2,4-Difluorophenylhydrazine HCl | 51523-79-6 | |
Ethyl-2-bromoproprionate | 535-11-5 | |
Ethyl 2-bromotetradecanoate (Ethyl 2-bromomyristate) | 14980-92-8 | |
EEC-Acetamidoazide | 204255-06-1 | |
MPA-HM | - | |
PHG-D | - | |
PHG-L | - | |
tert-Butyl cyanoacetate | 59739-05-8 | |
1,3-Dioxolane 2-propane nitrile | 4388-58-3 | |
N-Ethylethylenediamine | 110-72-5 | |
3-(5-Methyl-2-furyl)-propanal-1 | 34756-16-6 | |
N,N'-Diethylthiourea | 105-55-5 | |
1,1,3-Tributylthiourea | 2422-88-0 | |
Ammonium thioglycolate | 5421-46-5 | |
Ethyl isonicotinate | 1570-45-2 | |
Potassium thioacetate | 10387-40-3 | |
Ethyl maltol (2-Ethyl-3-hydroxy-4-pyrone) | 4940-11-8 | |
"Isopropylxanthic polysulfide; Diisopropylxanthogen polysulphide" | 69303-50-0 | |
2-Mercaptopyridine | 2637-34-5 | |
2,2'-Methylene bis cyclohexane-1,3-dione | 54135-60-3 | |
Sodium pyrrolidinedithiocarbamate | 872-71-9 | |
a-Bromo-g-butyrolactone | 5061-21-2 | |
Phenyltribromomethyl sulfone | 17025-47-7 | |
2,3-Dichloro-5-nitropyridine | 23353-40-8 | |
S-Benzylisothiourea hydrochloride | 538-28-3 | |
"l-Ephedrine hydrochloride; L-(-)-Ephedrine hydrochloride" | 50-98-6 | |
L-(-)-Ephedrine sulfate | 134-72-5 | |
D-Pseudoephedrine Sulfate | 7460-12-0 | |
D-Ephedrine anhydrous | 321-98-2 | |
D-Norephedrine | 35577-28-9 | |
"d-N-Methylephedrine; (+)-N-Methylephedrine" | 42151-56-4 | |
"l-N-Methylephedrine; (-)-N-Methylephedrine" | 552-79-4 | |
l-Methamphetamine Base | 33817-09-3 | |
N,N-Diethyl-l-norephedrine Hydrochloride | 37025-58-4 | |
p-Hydroxy-l-norephedrine | 771-91-5 | |
p-Hydroxy-d-norephedrine | 1926-72-3 | |
R-Phenylalaninol | 5667-64-1 | |
"O,O'-Dibenzoyl-d-tartaric acid monohydrate; (-)-O,O'-Dibenzoyl-L-tartaric acid monohydrate" | 62708-56-9 | |
Boc-L-Pentafluorophenylalanine (Boc-pentafluoro-Phe-OH) | 34702-60-8 | |
"-O,O'-Dibenzoyl-l-tartaric acid anhydrous; (+)-O,O'-Dibenzoyl-D-tartaric acid" | 17026-42-5 | |
L-tert-Leucine | 20859-02-3 | |
2,4-Lutidine (2,4-Dimethylpyridine) | 108-47-4 | |
Niacin (Nicotinic acid) | 59-67-6 | |
Fmoc-L-4-Aminophe(L-Hydroorotyl) (Fmoc-Aph(L-Hor)-OH) | - | |
4-Hydrazinobenzenesulphonamide hydrochloride | 17852-52-7 | |
2-(2',6'-Dichlorophenoxy)propionitrile | 78302-27-2 | |
3-Aminobenzylamine | 4403-70-7 | |
3-Aminobenzylmethylamine | 18759-96-1 | |
3-Aminobenzyl-NN-dimethylamine | 27958-77-6 | |
2,5-Dimercapto-1,3,4-thiadiazole | 1072-71-5 | |
2-Chlorothiophene | 96-43-5 | |
2,4,6-Collidine [2,4,6-Trimethylpyridine] | 108-75-8 | |
4-Chloro-(D)-phenylalanine | 14091-08-8 | |
EEC-Epoxide | 204254-96-6 | |
1-Chloro-3-methoxypropane | 36215-07-3 | |
L-Pentalfluorophenylalanine | 3470-25-9 | |
Boc-D-Proline | 37784-17-2 | |
4-Thioanisolmagnesium chloride | 210292-04-9 | |
ED/EP | - | |
1-(2-Chlorophenyl)-1-(4-chlorophenyl)-2,2-dichloroethane | 53-19-0 | |
1,2,4-Triazole | 288-88-0 | |
1,2-Pentanediol | 5343-92-0 | |
2,6-Dichloropyridine | 2402-78-0 | |
2-Amino-5-chlorpyridin | 1072-98-6 | |
2-Dimethylaminopyridine | 5683-33-0 | |
1-(2-Chloroethyl)piperidine HCl | 2008-75-5 | |
2,3,5-Collidine [2,3,5-Trimethylpyridine] | 695-98-7 | |
2,3-Cyclopentenopyridine [6,7-Dihydro-5H-cyclopenta[b]pyridine] | 533-37-9 | |
2,5-Lutidine [2,5-Dimethylpyridine] | 589-93-5 | |
2,6-Dichloro-3-nitropyridine | 16013-85-7 | |
2,6-Lutidine [2,6-Dimethylpyridine] | 108-48-5 | |
2-Acetyl-6-methylpyridine | 6940-57-4 | |
2-Amino-3-hydroxypyridine | 16867-03-1 | |
2-Amino-4-methylpyridine [2-Amino-4-picoline] | 695-34-1 | |
2-Amino-5-nitropyridine | 4214-76-0 | |
2-Bromo-5-nitropyridine | 4487-59-6 | |
2-Chloro-3-hydroxypyridine [2-Chloro-3-pyridinol] | 6636-78-8 | |
2-Chloro-3-picoline [2-Chloro-3-methylpyridine] | 18368-76-8 | |
2-Chloro-4-cyanopyridine | 33252-30-1 | |
5-Bromo-2-chloropyridine | 53939-30-3 | |
2-Chloro-5-(chloromethyl)pyridine | 70258-18-3 | |
2-Chloro-5-picoline [2-Chloro-5-methylpyridine] | 18368-64-4 | |
2-Chloro-6-picoline [6-Chloro-2-picoline] [2-Chloro-6-methylpyridine] | 18368-63-3 | |
2-Chloropyridine-N-oxide | 2402-95-1 | |
2-Cyano-6-methylpyridine [6-Cyano-2-picoline] | 1620-75-3 | |
2-Cyanopyrazine [Pyrazinecarbonitrile] | 19847-12-2 | |
2-Fluoro-4-picoline [2-Fluoro-4-methylpyridine] | 461-87-0 | |
2-Hydrazinopyridine | 4930-98-7 | |
5-Chloro-2-hydroxypyridine | 4214-79-3 | |
2-Methoxypyridine | 1628-89-3 | |
5-Amino-2-methoxypyridine | 6628-77-9 | |
5-Bromo-2-methoxypyridine | 13472-85-0 | |
2-(Methoxymethyl)pyridine | 23579-92-2 | |
2-Methylisonicotinic acid | 4021-11-8 | |
5-Bromo-2-nitropyridine | 39856-50-3 | |
2-Pipecoline [2-Methylpiperidine] | 109-05-7 | |
2-Pyridineethanol [2-(2-Hydroxyethyl)pyridine] | 103-74-2 | |
2-Vinylpyridine | 100-69-6 | |
3,4,5,6-Tetrachloro-2-picolinic acid | 10469-09-7 | |
3,4-Lutidine [3,4-Dimethylpyridine] | 583-58-4 | |
3,5-Dichloro-2,4,6-trifluoropyridine | 1737-93-5 | |
4-Amino-3,5-dichloropyridine | 228809-78-7 | |
3,5-Dimethylpiperidine, mixture of cis and trans [3,5-Lupetidine] | 35794-11-7 | |
3-Aminopiperidine dihydrochloride | 138060-07-8 | |
3-Cyano-5-methylpyridine [5-Cyano-3-picoline] | 42885-14-3 | |
3-Cyanopyridine-N-oxide | 14906-64-0 | |
3-Hydroxy-2-methylpyridine | 1121-25-1 | |
4-Amino-3,5-dichloro-2,6-difluoropyridine | 2840-00-8 | |
4-Amino-3-methylpyridine [4-Amino-3-picoline] | - | |
4-Bromo-2-picoline [4-Bromo-2-methylpyridine] | 22282-99-1 | |
4-Chloro-3-fluoropyridine | 2546-56-7 | |
4-Chloro-3-nitropyridine | 13091-23-1 | |
4-Chloropyridine-3-sulfonamide | 33263-43-3 | |
4-Cyanopiperidine | 4395-98-6 | |
4-Cyanopyridine-N-oxide | 14906-59-3 | |
4-Ethoxy-3-nitropyridine | 1796-84-5 | |
4-Hydroxy-3-nitropyridine | 15590-90-6 | |
4-Hydroxy-3-pyridinesulfonic acid | 51498-37-4 | |
4-Nitropyridine-N-oxide | 1124-33-0 | |
4-Picolylchloride * HCl [4-(Chloromethyl)-pyridinine hydrochloride] | 1822-51-1 | |
4-Pyridineethanol [4-(2-Hydroxyethyl)pyridine] | 5344-27-4 | |
5,6-Dichloro-3-aminopyridine [5-Amino-2,3-dichloropyridine] | - | |
5-Bromo-2,3-dichloropyridine | 97966-00-2 | |
5,6-Dichloronicotinic acid | 41667-95-2 | |
"5-Bromo-3-methylpyridine [5-Bromo-3-picoline; 3-Bromo-5-methylpyridine ]" | 3430-16-8 | |
5-Chloro-6-hydroxynicotinic acid | 54127-63-8 | |
5-Methylnicotinic acid | 3222-49-9 | |
5-Nitro-3-methylpyridine [5-Nitro-3-picoline] | 6960-20-9 | |
6-(N,N-Dimethylamino)-4-methyl-3-pyridineacetonitrile | - | |
6-Methoxynicotinic acid | - | |
4-Methoxy-1,3-Isobenzofurandione | 14963-96-3 | |
6-Methylpicolinic acid | 934-60-1 | |
6-Methyl-2-ethylpicolinate [Ethyl 6-methylpyridine-2-carboxylate] | 39640-51-2 | |
2-Picoline N-oxide | 931-19-1 | |
Benzenesulphenyl-2-pyridine [2-(Phenylsulphenyl)-pyridine] | - | |
Chromium-3-picolinate | 14639-25-9 | |
Isonicotinic acid n-oxide | 13602-12-5 | |
Pyridine hydrobromide | 18820-82-1 | |
3-Pyridinesulfonic acid | 636-73-7 | |
Pyridine-N-oxide | 694-59-7 | |
2,3-Diamino-6-methylpyridine | - | |
HDMC | 1082951-62-9 | |
2,6-Diamino-3-nitropyridine | - | |
2,6-Dibromo-3-nitropyridine | - | |
2-Amino-3-methyl-5-nitropyridine | - | |
2-Amino-3-methoxypyridine | - | |
2-benzyl thionicotinic acid | - | |
Tetrabutylammonium bromide (TBAB) | 1643-19-2 | |
2-(Nitroimino)-imidazolidine | - | |
4-Propoxybenzaldehyde | 5736-85-6 | |
3,5-Diethyl-1,2-dihydro-1-phenyl-2-propylpyridine | - | |
4-(5-Nonyl)-pyridine | 2961-47-9 | |
4-Chloropyridine-3-sulfinamide | - | |
Niacinamide-N-oxide | 1986-81-8 | |
N-Methyl ethyl isonipecotate | - | |
N-Methyl-isonipecotic acid | - | |
Piperidine-4-aldehyde | - | |
Pyridinium acetate | - | |
Pyridine-3-acetic acid [3-Pyridinylacetic acid] | - | |
L-Cystine 2HCl | 30925-07-6 | |
Actimet-L/M | - | |
L(-) Xylose | 609-06-3 | |
D-Norleucine methylester hydrochloride | 60687-33-4 | |
3-Methyl 2-thiophenecarboxylic acid | 23806-24-8 | |
Diphenylmethyleneglycine ethylester | 69555-14-2 | |
(S,S)-TsDPEN-ruthenium chloride p-cymene complex | 192139-90-5 | |
2-Aminobenzophenone | - | |
1,3-Dimethylbarbituric acid | 769-42-6 | |
N-Boc-D-4,4'-biphenylalaninol | - | |
Boc-L-4,4'-biphenylalanine | 147923-08-8 | |
3-(Bromomethyl)-biphenyl | 14704-31-5 | |
3-Phenyl benzaldehyde | 1204-60-0 | |
3-Phenyl benzylalcohol | 69605-90-9 | |
3-Phenyltoluene [3-Methylbiphenyl] | 643-93-6 | |
Boc-L-2-Indanylglycine (Boc-(2-indanyl)-Gly-OH) | 181227-47-4 | |
2-Oxabutane-1,4-diol diacetate [OBDA] | 5927-00-1 | |
5-Chloropentanol | 5259-98-3 | |
Tamoxifen precursor | 748-97-0 | |
2-Thiophenecarboxylic acid hydrazide | 2361-27-5 | |
5-Amino-4-imidazolecarboxamide HCl (AICA HCl) | 72-40-2 | |
Tributyltinchloride (TBTCI) | 1461-22-9 | |
Formylhydrazine | 624-84-0 | |
4-Ethoxy-1,1,1-trifluoro-3-buten-2-one (ETFBO) | 17129-06-5 | |
Diphenylphosphoryl azide (DPPA) | 26386-88-9 | |
Bromoacetylchlorthiophensulfonamide PS4497 | - | |
Boc-N-methyl-(D-3,4-dichlorophenyl)-alanine | 933474-86-3 | |
Cytidine 5'-diphosphocholine sodium salt dihydrate | 33818-15-4 | |
Arsenic trioxide | 1327-53-3 | |
2-Cyano-3-hydroxypyridine | 932-35-4 | |
Ferulic acid [trans-4-Hydroxy-3-methoxycinnamic acid] | 537-98-4 | |
3-(4-Chlorophenyl) 1-propanol | 6282-88-8 | |
Isopentenyl pyrophosphate sodium salt | 358-71-4 | |
Triethyl 3-methyl-4-phosphono-2-butenoate (cis+trans) [TEMPC] | 41891-54-7 | |
3,3,3-Trifluoro-1-(2-thenoyl)-acetone [4,4,4-Trifluoro-1-(2-thienyl)-1,3-butanedione] | 326-91-0 | |
3,5-Dimethyl-4-methoxybenzoic acid [3,5-Dimethyl-p-anisic acid] | 21553-46-8 | |
Ethyl 8-chloro-2-octenoate | 139376-66-2 | |
2-Methylbutyryl chloride | 57526-28-0 | |
2,2-Dimethylsuccinic anhydride | 17347-61-4 | |
2-Methylsuccinic anhydride | 4150-20-5 | |
Octanoyl chloride | 111-64-8 | |
Tigloyl chloride [(E)-2-methylbut-2-enoyl chloride] | 35660-94-7 | |
Ethyl-2-hexenoate | 27829-72-7 | |
Methyl-2-hexenoate | 2396-77-2 | |
trans-2-Hexenoic acid | 13419-69-7 | |
Iodoacetic acid | 64-69-7 | |
1-tert-Butyl-5-bromo-1H-pyrrolo-[2,3-b]-pyridine-3-carbonitrile | - | |
1-Cyclohexyl-1H-pyrrolo-[2,3-b]-pyridine-3-carboxylic acid | - | |
1-Cyclohexyl-1H-pyrrolo-[2,3-b]-pyridine-5-carboxylic acid | - | |
2-Acetyl-1H-pyrrolo-[2,3-b]-pyridine-6-carboxylic acid | - | |
1-Benzyl-6-trifluoromethyl-1H-pyrrolo-[2,3-b]-pyridine-3-carboxylic acid | - | |
2'-Fluoroacetophenone | 445-27-2 | |
4'-(4-Bromophenyl)acetophenone | 5731-01-1 | |
Boc-L-2-Bromophenylalanine (Boc-Phe(2-Br)-OH) | 261165-02-0 | |
N-[3-Methyl-5-(4,4,5,5-tetrametyl-[1,3,2]-dioxaborolan-2-yl)-N-methyl-2,2-dimethylpropanamid | - | |
Fmoc-D-3,3-Diphenylalanine | 189937-46-0 | |
1-(Tetrahydropyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | - | |
6-Bromohexanal | 57978-00-4 | |
2-Benzoyl-pyrrole | 7697-46-3 | |
2-Phenyl-4-methyl-oxazole | 877-39-4 | |
2-Phenyl-5-methyl-oxazole | 5221-67-0 | |
Piperonyl acetone [4-(3,4-Methylenedioxyphenyl)-2-butanone ] | 55418-52-5 | |
2,3-Dimethylbenzaldehyde | 5779-93-1 | |
2-Methoxypyridine-5-ylboronic acid | 163105-89-3 | |
3-Acetylthiophene | 1468-83-3 | |
2,5-Dichloropyridine | 16110-09-1 | |
2-Benzoylthiophene | 135-00-2 | |
2-Acetyl-5-chlorothiophene | 6310-09-4 | |
5-Chlorothiophene-2-sulfonamide | 53595-66-7 | |
Tetrazolyl-biphenyl-valinesteramide / Valsartan Step 9 - new | - | |
Ni-5132 P Katalysator | - | |
RAP-Benzoyluridine (RAP04) | 812647-80-6 | |
LCX696-Chiral Acid (Step A7) | - | |
Ethanol | 64-17-5 | |
N-Acetyl-L-glutamic acid | 1188-37-0 | |
(R,R)-TsDPEN-ruthenium chloride p-cymene complex | 192139-92-7 | |
Fmoc-L-Pentafluorophenylalanine | 205526-32-5 | |
3-Quinolineboronic acid | 191162-39-7 | |
3-Methoxypropionic acid | 2544-06-1 | |
4-[(1S,2S,3R,5S)-(+)-Pinane-dioxaborolan]-1-bromobutane | - | |
6-Fluoro-1-H-indazole | 348-25-4 | |
Diethyl methyl phosphonite | 15715-41-0 | |
Diisopropyl-4-toluenesulfonyloxy-methyl-phosphonate | 35717-98-7 | |
(Ethoxymethyl phosphinyl)-acetic acid ethyl ester | 18359-00-7 | |
(Ethoxymethyl phosphinyl)-acetic acid methyl ester | 18359-01-8 | |
3-Methoxythiophene | 17573-92-1 | |
4-Chlorothieno[3,2-d]pyrimidine | 16269-66-2 | |
4-Hydroxy-thieno[3,2-d]pyrimidine | 16233-51-5 | |
Valsartan Cru 25 / Valsartan Step 10 | - | |
Valsartan IP 25 / Valsartan Step 11 | - | |
trans-1.4-Dibromo-2-butene (DBBE) | 821-06-7 | |
Fmoc-Ser(t-Bu)-Ser(psiMe,Mepro)-OH | - | |
Boc-L-Serine(Methyl Ether) | 51293-47-1 | |
"N-[(5-chloro-2-thienyl ) sulfonyl]-carbamic acid ethyl ester ( "" thiophene carbamate "" )" | 849793-87-9 | |
Amino acid starter kit | - | |
1-Eicosanthiol | 13373-97-2 | |
DL-Homocystein thiolactone | - | |
PyOxim | 153433-21-7 | |
Sodium dimethyldithiocarbamate Solution | 128-04-1 | |
1-Hydroxybenzotriazole monohydrate (HOBT) | 80029-43-2 | |
COMU | 1075198-30-9 | |
2-Methyl-6-Ethylaniline (MEA) | 24549-06-2 | |
Methyl-4-methoxyacetoacetate | 41051-15-4 | |
Ethyl cyanoglyoxylate-2-oxime (OxymaPure) | 3849-21-6 | |
Pyrazole | 288-13-1 | |
"4-Picoline; Gamma-picoline; 4-Methylpyridine" | 108-89-4 | |
N-(Ethoxycarbonyl)-phthalimide | 22509-74-6 | |
Methylmalonic acid | 516-05-2 | |
2-Chloropyridine-3-aldehyde | 36404-88-3 | |
2-Fluoro-4-hydroxybenzonitrile | 82380-18-5 | |
4-Fluorobenzenesulphinate sodium salt | 824-80-6 | |
Fmoc-D-Dab(Boc)-OH | 114360-56-4 | |
Fmoc-D-2,3-Diaminopropionic Acid(Boc) (Fmoc-D-Dap(Boc)-OH) | 198544-42-2 | |
trans-4-(4-chlorophenyl)cyclohexyl acetic acid methyl ester | - | |
D-tert-Leucinol | 112245-09-7 | |
R-Pyrrolidine-3-carboxylic acid | 72580-54-2 | |
"Lithium Aluminium Hydride 2.4M in THF; LAH" | 16853-85-3 | |
Boc-2,6-dimethyl-4-carboxamido-L-phenylalanine (T3298) | 623950-02-7 | |
1,6-Dihydro-1-methyl-6-oxopyridine-3-carboxylic acid | 3719-45-7 | |
3-Chloro-4-hydroxybenzaldehyde | 2420-16-8 | |
Lithium t-Amoxide (LTA) in Heptane | 53535-81-2 | |
4-Hydroxymethylbenzaldehyde | 52010-97-6 | |
L-Aspartic acid sodium salt monohydrate | 323194-76-9 | |
Peptide Synthesizer | - | |
Peptide | - | |
2-Isopropoxy-4,4,5,5,-Tetramethyl-1,3,2-dioxaborolane | 61676-62-8 | |
Diethylaminomalonate HCl | 13433-00-6 | |
Polaris C18-A Conventional Valco Type | - | |
3,4-Dichlorophenylboronic acid | 151169-75-4 | |
2,2'-Diaminodiphenyl disulphide (DTDA) | 1141-88-4 | |
2-Methyltetrahydrofuran | 96-47-9 | |
Bromopyruvic acid | 1113-59-3 | |
1-Bromo-2-Chloroethane | 107-04-0 | |
2-Hydroxynicotinic acid | 609-71-2 | |
Succinic Acid | 110-15-6 | |
(1R,2R)-Boc-Amino-2-Et-cycloprop-COOH | 159700-60-4 | |
(1R,2S)Boc-Amino-2-vinylcyclopropane-EOt | 259217-95-3 | |
N-Isopropyl-L-2-piperidinecarboxylic acid | 342793-00-4 | |
L-Cyclohexylglycine Benzyl Ester HCI | - | |
N-I-propyl-L-Homopro-L-Chg-OH | - | |
Benzyl Isocyanide | 10340-91-7 | |
Various Catalysts | - | |
Fmoc-L-3-Bromophenylalanine | 220497-47-2 | |
Phenylphosphonic Dichloride (BPOD) | 824-72-6 | |
N-isopropyl-L-homoproline-L-cyclohexylglycine | - | |
Toxogonin (Obidoxime Chloride pure) | - | |
Methyl 2,3-dibromopropionate | 1729-67-5 | |
Fmoc-N-Me-Trp(Boc)-OH | 197632-75-0 | |
3,5-Dimethyl-4H-1,2,4-triazole | 7343-34-2 | |
3,4-(Methylenedioxy)-benzylcyanid | 4439-02-5 | |
Sodium glycerophosphate solution 50% | 17603-42-8 | |
p-Hydroxypropiophenone | 70-70-2 | |
2-Methoxybenzoic Anhydride | 64508-50-5 | |
Nitroflutazin | - | |
N-(4-cyano-1-(2-cyanoethyl)piperidin-4-yl)-N-Phenylpropionamide | - | |
N-Fmoc-2-octyl-L-glycine | 193885-59-5 | |
5-Hydroxy-L-tryptophan | 4350-09-8 | |
Fmoc-Orn(Boc)-Lys(Boc)-OH | - | |
2,2,4-Trimethyl-1,2-dihydroquinoline | - | |
Potassium lodide 1% in Maltodextrin | - | |
Isonipecotic acid [4-Piperidinecarboxylic acid] | 498-94-2 | |
Lithium diisopropylamide (LDA 9505) | 4111-54-0 | |
Lithium hydroxide, anhydrous | 1310-65-2 | |
D-alpha-Amino-epsilon-caprolactam-hydrochloride | 26081-03-8 | |
Lithium tetraborate, anhydrous | 12007-60-2 | |
Magnesium pentasilicate | 95193-35-4 | |
Magnesium phosphate, monobasic | 10043-83-1 | |
2-Aminopyridine | 504-29-0 | |
Methyl 2-bromohexanoate (Methyl 2-bromocaproate) | 5445-19-2 | |
Methyl 2-bromooctanoate (Methyl 2-bromocaprylate) | 5445-29-4 | |
Methyl 2-bromotetradecanoate (Methyl 2-bromomyristate) | 16631-25-7 | |
S-Methylisothiourea sulphate | 867-44-7 | |
Methyllithium (MeLi 9307) in Cumene/Tetrahydrofuran | 917-54-4 | |
"Methyl maltol (3-Hydroxy-2-methyl-4-pyrone; PIROMATOL)" | 118-71-8 | |
N-Methyl-2,2,2-trifluoroacetamide (MTFAA) | 815-06-5 | |
Morpholine salicylate | 147-90-0 | |
p-Nitrobenzaldehyde | 555-16-8 | |
4-Phenyl Propyl Pyridine (4-PPP) | 2057-49-0 | |
Potassium phthalimide | 1074-82-4 | |
Probenicid | 57-66-9 | |
Pyrazinamide | 98-96-4 | |
Raspberry ketone [4-(4-Hydroxyphenyl)-2-butanone] | 5471-51-2 | |
Sodium 2-ethylhexanoate | 19766-89-3 | |
Sodium thiobenzoate | 51066-54-7 | |
Sodium thiocyanate | 540-72-7 | |
Sulfuryl chloride (SC) | 7791-25-5 | |
Sulfuryl fluoride | 2699-79-8 | |
Tetradecene-1-oxide | 3234-28-4 | |
Myristyl bromide | 112-71-0 | |
L-Serine benzyl ester x HCl | 1738-72-3 | |
2-Thiophenecarboxylic acid chloride (Thenoyl chloride) | 5271-67-0 | |
2-Thiophenecarboxylic acid (2-Thenoic acid) | 527-72-0 | |
2-Thiophenecarboxylic acid, sodium salt | 25112-68-9 | |
Didecyldimethylammonium bromide | 2390-68-3 | |
Trichloroacetamide | 594-65-0 | |
1,1,1-Trichloro-2,2,2-trifluoroethane(TFTC) | 354-58-5 | |
Trifluoroacetic acid phenyl ester (TFAPh) | 500-73-2 | |
Trifluoroacetic acid trifluoroethyl ester (TFAEF) | 407-38-5 | |
2,2,2-Trifluoroacetophenone (BTFA) | 434-45-7 | |
3,4,5-Trimethoxybenzoyl chloride | 4521-61-3 | |
L-Tyrosine ethyl ester hydrochloride | 4089-87-0 | |
Vinblastine Sulfate | 143-67-9 | |
Vincamine | 1617-90-9 | |
Vincristine | 2068-78-2 | |
Zinc phenolsulphonate | 127-82-2 | |
Z-L-leucine x DCHA | - | |
L-Asparagine monohydrate | 5794-13-8 | |
4-Biphenylcarboxylic acid (4-Phenylbenzoic acid) | 92-92-2 | |
3-Bromoacetophenone | 2142-63-4 | |
Dibenzoyl peroxide (LUPEROX A 75 FP) | 94-36-0 | |
S-tert-Butylmercapto-L-cysteine | 30044-51-0 | |
L-Hepalidine (L-Thiazolidine-4-carboxylic acid) (L-Thioproline) | 34592-47-7 | |
Esculin | 531-75-9 | |
N,N-Diisopropylethylamine (N-Ethyldiisopropylamine, Huenigs Base] | 7087-68-5 | |
1,3-Dimethyl-2-imidazolidinone | 80-73-9 | |
2-Diethylaminoethyl chloride HCl (DEC) | 869-24-9 | |
N-Fluoro-N-methylsulfonamide | - | |
Fmoc-L-Cysteine(S-t-Butylthio) (FCYSBU) | 73724-43-3 | |
4-Formylphenoxyacetic acid | 22042-71-3 | |
2-Hydroxyacetophenone | 118-93-4 | |
p-Hydroxyacetophenone | 99-93-4 | |
Magnesium L-pyrrolidone carboxylate [L-Magnesium pidolate] | 62003-27-4 | |
4-Methoxyacetophenone | 100-06-1 | |
Pepsin | 9001-75-6 | |
Trifluoroacetic acid, sodium salt (NATFA) | 2923-18-4 | |
L-Glutamic acid gamma-tert.butyl ester | - | |
Benzyltriethylammonium chloride (BTEAC) | 56-37-1 | |
Lysine pyrrolidone carboxylate [LYSIDONE®] | 30657-38-6 | |
Troxerutine | 7085-55-4 | |
Chlorodifluoromethane (SOLKANE 22) | 75-45-6 | |
Thiophene-2-aldehyde | 98-03-3 | |
N,N,N'-Trimethylethylenediamine | 142-25-6 | |
N,N,N',N'-Tetramethylethylenediamine | 110-18-9 | |
DL-2-Pyrrolidone-5-carboxylic acid [DL-Pidolic acid] | 149-87-1 | |
Fluorine | 7782-41-4 | |
Iodine pentafluoride (IF5) | 7783-66-6 | |
Tetrafluoromethane | 75-73-0 | |
1-Chloro-1,1-difluoroethane | 75-68-3 | |
1,1-Dichloro-1-fluoroethane | 1717-00-6 | |
Cyclohexyl isocyanate | 3173-53-3 | |
2-Chlorobenzonitrile | 873-32-5 | |
Melatonine | 73-31-4 | |
Phenyllithium in Dibutyl ether | 591-51-5 | |
Adenosine triphosphate, disodium salt | 987-65-5 | |
Tetrahydro-2H-Thiopyran-4-OL | 29683-23-6 | |
2-Bromoisobutyric acid (2-Bromo-2-Methylpropionic acid) | 2052-01-9 | |
Ethyl 2-bromooctanoate (Ethyl 2-bromocaprylate) | 5445-29-4 | |
Ammonium Hydrogen Difluoride | 1341-49-7 | |
2-Chloropyrimidine | 1722-12-9 | |
2-Aminobenzonitrile | 1885-29-6 | |
1-Methylimidazole | 616-47-7 | |
R-Amido-TH-Naphthyridin | - | |
1-ethyl-1,2-dihydro-5H-tetrazol-5-one | 69048-98-2 | |
Diphenyl chlorophosphate | 2524-64-3 | |
3-Amino-4-methylphenol | 2836-00-2 | |
Fmoc-L-Hydroxyproline(BCC)-OH | 187223-15-0 |